From 0f98b1506f5bfcec062d0124d408a82ae25856a9 Mon Sep 17 00:00:00 2001 From: Derek Collison Date: Tue, 9 Apr 2019 17:13:25 -0700 Subject: [PATCH] Update to gomod with vendor directory, update vendored pkgs Signed-off-by: Derek Collison --- go.mod | 10 + go.sum | 24 + vendor/github.com/nats-io/go-nats/.gitignore | 39 + vendor/github.com/nats-io/go-nats/.travis.yml | 21 + .../github.com/nats-io/go-nats/GOVERNANCE.md | 3 + vendor/github.com/nats-io/go-nats/LICENSE | 201 + .../github.com/nats-io/go-nats/MAINTAINERS.md | 10 + vendor/github.com/nats-io/go-nats/README.md | 384 ++ vendor/github.com/nats-io/go-nats/TODO.md | 26 + vendor/github.com/nats-io/go-nats/context.go | 241 + vendor/github.com/nats-io/go-nats/enc.go | 269 ++ .../go-nats/encoders/builtin/default_enc.go | 117 + .../go-nats/encoders/builtin/gob_enc.go | 45 + .../go-nats/encoders/builtin/json_enc.go | 56 + vendor/github.com/nats-io/go-nats/nats.go | 3940 +++++++++++++++++ vendor/github.com/nats-io/go-nats/netchan.go | 111 + vendor/github.com/nats-io/go-nats/parser.go | 481 ++ .../nats-io/go-nats/staticcheck.ignore | 4 + vendor/github.com/nats-io/go-nats/timer.go | 56 + vendor/github.com/nats-io/go-nats/util/tls.go | 27 + .../nats-io/go-nats/util/tls_go17.go | 49 + vendor/github.com/nats-io/jwt/.gitignore | 16 + vendor/github.com/nats-io/jwt/.travis.yml | 21 + vendor/github.com/nats-io/jwt/Makefile | 18 + vendor/github.com/nats-io/jwt/README.md | 54 + .../github.com/nats-io/jwt/account_claims.go | 20 +- .../nats-io/jwt/activation_claims.go | 15 + vendor/github.com/nats-io/jwt/claims.go | 21 +- .../github.com/nats-io/jwt/cluster_claims.go | 15 + vendor/github.com/nats-io/jwt/exports.go | 15 + vendor/github.com/nats-io/jwt/genericlaims.go | 15 + vendor/github.com/nats-io/jwt/go.mod | 3 + vendor/github.com/nats-io/jwt/go.sum | 6 + vendor/github.com/nats-io/jwt/header.go | 19 +- vendor/github.com/nats-io/jwt/imports.go | 15 + .../github.com/nats-io/jwt/operator_claims.go | 15 + .../nats-io/jwt/revocation_claims.go | 15 + .../github.com/nats-io/jwt/server_claims.go | 15 + vendor/github.com/nats-io/jwt/types.go | 15 + vendor/github.com/nats-io/jwt/user_claims.go | 15 + vendor/github.com/nats-io/jwt/validation.go | 15 + vendor/github.com/nats-io/nkeys/.gitignore | 15 + .../github.com/nats-io/nkeys/.goreleaser.yml | 38 + vendor/github.com/nats-io/nkeys/.travis.yml | 32 + vendor/github.com/nats-io/nkeys/GOVERNANCE.md | 3 + .../github.com/nats-io/nkeys/MAINTAINERS.md | 6 + vendor/github.com/nats-io/nkeys/README.md | 72 + vendor/github.com/nats-io/nkeys/TODO.md | 5 + vendor/github.com/nats-io/nkeys/go.mod | 3 + vendor/github.com/nats-io/nkeys/go.sum | 2 + vendor/github.com/nats-io/nkeys/nk/main.go | 288 -- vendor/github.com/nats-io/nuid/.gitignore | 24 + vendor/github.com/nats-io/nuid/.travis.yml | 17 + vendor/github.com/nats-io/nuid/README.md | 47 + vendor/github.com/nats-io/nuid/nuid.go | 6 +- vendor/golang.org/x/crypto/AUTHORS | 3 + vendor/golang.org/x/crypto/CONTRIBUTORS | 3 + .../golang.org/x/crypto/{bcrypt => }/LICENSE | 0 vendor/golang.org/x/crypto/PATENTS | 22 + vendor/golang.org/x/crypto/blowfish/cipher.go | 8 + vendor/golang.org/x/crypto/ed25519/LICENSE | 27 - vendor/golang.org/x/sys/AUTHORS | 3 + vendor/golang.org/x/sys/CONTRIBUTORS | 3 + .../x/{crypto/blowfish => sys}/LICENSE | 0 vendor/golang.org/x/sys/PATENTS | 22 + vendor/golang.org/x/sys/windows/LICENSE | 27 - vendor/golang.org/x/sys/windows/aliases.go | 13 + .../x/sys/windows/asm_windows_386.s | 4 +- .../x/sys/windows/asm_windows_amd64.s | 2 +- .../x/sys/windows/asm_windows_arm.s | 11 + .../golang.org/x/sys/windows/dll_windows.go | 18 +- vendor/golang.org/x/sys/windows/env_unset.go | 15 - .../golang.org/x/sys/windows/env_windows.go | 6 +- .../x/sys/windows/memory_windows.go | 26 + vendor/golang.org/x/sys/windows/mksyscall.go | 2 +- vendor/golang.org/x/sys/windows/race.go | 2 +- vendor/golang.org/x/sys/windows/race0.go | 2 +- .../golang.org/x/sys/windows/registry/key.go | 10 +- .../sys/windows/registry/zsyscall_windows.go | 2 +- .../x/sys/windows/security_windows.go | 218 +- vendor/golang.org/x/sys/windows/service.go | 19 + .../x/sys/windows/svc/debug/service.go | 2 +- .../x/sys/windows/svc/example/beep.go | 22 - .../x/sys/windows/svc/example/install.go | 92 - .../x/sys/windows/svc/example/main.go | 76 - .../x/sys/windows/svc/example/manage.go | 62 - .../x/sys/windows/svc/example/service.go | 82 - vendor/golang.org/x/sys/windows/svc/go12.go | 2 +- vendor/golang.org/x/sys/windows/svc/go13.go | 2 +- .../x/sys/windows/svc/mgr/config.go | 40 +- .../x/sys/windows/svc/mgr/recovery.go | 135 + .../golang.org/x/sys/windows/svc/service.go | 40 +- vendor/golang.org/x/sys/windows/svc/sys_386.s | 3 +- .../golang.org/x/sys/windows/svc/sys_amd64.s | 4 +- vendor/golang.org/x/sys/windows/svc/sys_arm.s | 38 + vendor/golang.org/x/sys/windows/syscall.go | 9 +- .../x/sys/windows/syscall_windows.go | 250 +- .../{ztypes_windows.go => types_windows.go} | 303 +- ...es_windows_386.go => types_windows_386.go} | 2 +- ...indows_amd64.go => types_windows_amd64.go} | 2 +- .../x/sys/windows/types_windows_arm.go | 22 + .../x/sys/windows/zsyscall_windows.go | 468 +- vendor/manifest | 65 - vendor/modules.txt | 22 + 104 files changed, 8338 insertions(+), 888 deletions(-) create mode 100644 go.mod create mode 100644 go.sum create mode 100644 vendor/github.com/nats-io/go-nats/.gitignore create mode 100644 vendor/github.com/nats-io/go-nats/.travis.yml create mode 100644 vendor/github.com/nats-io/go-nats/GOVERNANCE.md create mode 100644 vendor/github.com/nats-io/go-nats/LICENSE create mode 100644 vendor/github.com/nats-io/go-nats/MAINTAINERS.md create mode 100644 vendor/github.com/nats-io/go-nats/README.md create mode 100644 vendor/github.com/nats-io/go-nats/TODO.md create mode 100644 vendor/github.com/nats-io/go-nats/context.go create mode 100644 vendor/github.com/nats-io/go-nats/enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/nats.go create mode 100644 vendor/github.com/nats-io/go-nats/netchan.go create mode 100644 vendor/github.com/nats-io/go-nats/parser.go create mode 100644 vendor/github.com/nats-io/go-nats/staticcheck.ignore create mode 100644 vendor/github.com/nats-io/go-nats/timer.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls_go17.go create mode 100644 vendor/github.com/nats-io/jwt/.gitignore create mode 100644 vendor/github.com/nats-io/jwt/.travis.yml create mode 100644 vendor/github.com/nats-io/jwt/Makefile create mode 100644 vendor/github.com/nats-io/jwt/README.md create mode 100644 vendor/github.com/nats-io/jwt/go.mod create mode 100644 vendor/github.com/nats-io/jwt/go.sum create mode 100644 vendor/github.com/nats-io/nkeys/.gitignore create mode 100644 vendor/github.com/nats-io/nkeys/.goreleaser.yml create mode 100644 vendor/github.com/nats-io/nkeys/.travis.yml create mode 100644 vendor/github.com/nats-io/nkeys/GOVERNANCE.md create mode 100644 vendor/github.com/nats-io/nkeys/MAINTAINERS.md create mode 100644 vendor/github.com/nats-io/nkeys/README.md create mode 100644 vendor/github.com/nats-io/nkeys/TODO.md create mode 100644 vendor/github.com/nats-io/nkeys/go.mod create mode 100644 vendor/github.com/nats-io/nkeys/go.sum delete mode 100644 vendor/github.com/nats-io/nkeys/nk/main.go create mode 100644 vendor/github.com/nats-io/nuid/.gitignore create mode 100644 vendor/github.com/nats-io/nuid/.travis.yml create mode 100644 vendor/github.com/nats-io/nuid/README.md create mode 100644 vendor/golang.org/x/crypto/AUTHORS create mode 100644 vendor/golang.org/x/crypto/CONTRIBUTORS rename vendor/golang.org/x/crypto/{bcrypt => }/LICENSE (100%) create mode 100644 vendor/golang.org/x/crypto/PATENTS delete mode 100644 vendor/golang.org/x/crypto/ed25519/LICENSE create mode 100644 vendor/golang.org/x/sys/AUTHORS create mode 100644 vendor/golang.org/x/sys/CONTRIBUTORS rename vendor/golang.org/x/{crypto/blowfish => sys}/LICENSE (100%) create mode 100644 vendor/golang.org/x/sys/PATENTS delete mode 100644 vendor/golang.org/x/sys/windows/LICENSE create mode 100644 vendor/golang.org/x/sys/windows/aliases.go create mode 100644 vendor/golang.org/x/sys/windows/asm_windows_arm.s delete mode 100644 vendor/golang.org/x/sys/windows/env_unset.go create mode 100644 vendor/golang.org/x/sys/windows/memory_windows.go delete mode 100644 vendor/golang.org/x/sys/windows/svc/example/beep.go delete mode 100644 vendor/golang.org/x/sys/windows/svc/example/install.go delete mode 100644 vendor/golang.org/x/sys/windows/svc/example/main.go delete mode 100644 vendor/golang.org/x/sys/windows/svc/example/manage.go delete mode 100644 vendor/golang.org/x/sys/windows/svc/example/service.go create mode 100644 vendor/golang.org/x/sys/windows/svc/mgr/recovery.go create mode 100644 vendor/golang.org/x/sys/windows/svc/sys_arm.s rename vendor/golang.org/x/sys/windows/{ztypes_windows.go => types_windows.go} (73%) rename vendor/golang.org/x/sys/windows/{ztypes_windows_386.go => types_windows_386.go} (88%) rename vendor/golang.org/x/sys/windows/{ztypes_windows_amd64.go => types_windows_amd64.go} (88%) create mode 100644 vendor/golang.org/x/sys/windows/types_windows_arm.go delete mode 100644 vendor/manifest create mode 100644 vendor/modules.txt diff --git a/go.mod b/go.mod new file mode 100644 index 00000000..cc02ae8c --- /dev/null +++ b/go.mod @@ -0,0 +1,10 @@ +module github.com/nats-io/gnatsd + +require ( + github.com/nats-io/go-nats v1.7.2 + github.com/nats-io/jwt v0.1.0 + github.com/nats-io/nkeys v0.0.2 + github.com/nats-io/nuid v1.0.1 + golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5 + golang.org/x/sys v0.0.0-20190405154228-4b34438f7a67 +) diff --git a/go.sum b/go.sum new file mode 100644 index 00000000..980a8167 --- /dev/null +++ b/go.sum @@ -0,0 +1,24 @@ +github.com/nats-io/go-nats v1.7.2 h1:cJujlwCYR8iMz5ofZSD/p2WLW8FabhkQ2lIEVbSvNSA= +github.com/nats-io/go-nats v1.7.2/go.mod h1:+t7RHT5ApZebkrQdnn6AhQJmhJJiKAvJUio1PiiCtj0= +github.com/nats-io/jwt v0.0.8 h1:oQsISWFvSmzKEs13h6X7p+8jQaXa9/X2fnBWoU2Zh4g= +github.com/nats-io/jwt v0.0.8/go.mod h1:mQxQ0uHQ9FhEVPIcTSKwx2lqZEpXWWcCgA7R6NrWvvY= +github.com/nats-io/jwt v0.1.0 h1:xO7kj8fyt0ECycBVG6WtOW+TnX8Aax4tI8i2fwspUro= +github.com/nats-io/jwt v0.1.0/go.mod h1:mQxQ0uHQ9FhEVPIcTSKwx2lqZEpXWWcCgA7R6NrWvvY= +github.com/nats-io/nkeys v0.0.2 h1:+qM7QpgXnvDDixitZtQUBDY9w/s9mu1ghS+JIbsrx6M= +github.com/nats-io/nkeys v0.0.2/go.mod h1:dab7URMsZm6Z/jp9Z5UGa87Uutgc2mVpXLC4B7TDb/4= +github.com/nats-io/nuid v0.0.0-20180712044959-3024a71c3cbe h1:2nFZc8mo/vXfkJX5mTrTUUhHt6mIHwDoamuqIs3U1jU= +github.com/nats-io/nuid v0.0.0-20180712044959-3024a71c3cbe/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= +github.com/nats-io/nuid v1.0.0 h1:44QGdhbiANq8ZCbUkdn6W5bqtg+mHuDE4wOUuxxndFs= +github.com/nats-io/nuid v1.0.0/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= +github.com/nats-io/nuid v1.0.1 h1:5iA8DT8V7q8WK2EScv2padNa/rTESc1KdnPw4TC2paw= +github.com/nats-io/nuid v1.0.1/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= +golang.org/x/crypto v0.0.0-20181112202954-3d3f9f413869/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 h1:mKdxBk7AujPs8kU4m80U72y/zjbZ3UcXC7dClwKbUI0= +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= +golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5 h1:bselrhR0Or1vomJZC8ZIjWtbDmn9OYFLX5Ik9alpJpE= +golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5/go.mod h1:WFFai1msRO1wXaEeE5yQxYXgSfI8pQAWXbQop6sCtWE= +golang.org/x/sys v0.0.0-20170627012538-f7928cfef4d0 h1:zBqTV7BZW0C9WnFZU5Izl5ZfxL5+qtufgtwXGFU4t7g= +golang.org/x/sys v0.0.0-20170627012538-f7928cfef4d0/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190403152447-81d4e9dc473e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190405154228-4b34438f7a67 h1:1Fzlr8kkDLQwqMP8GxrhptBLqZG/EDpiATneiZHY998= +golang.org/x/sys v0.0.0-20190405154228-4b34438f7a67/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/nats-io/go-nats/.gitignore b/vendor/github.com/nats-io/go-nats/.gitignore new file mode 100644 index 00000000..3d5981fa --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/.gitignore @@ -0,0 +1,39 @@ +# Compiled Object files, Static and Dynamic libs (Shared Objects) +*.o +*.a +*.so + +# Folders +_obj +_test + +# Architecture specific extensions/prefixes +*.[568vq] +[568vq].out + +*.cgo1.go +*.cgo2.c +_cgo_defun.c +_cgo_gotypes.go +_cgo_export.* + +_testmain.go + +*.exe + +# Emacs +*~ +\#*\# +.\#* + +# vi/vim +.??*.swp + +# Mac +.DS_Store + +# Eclipse +.project +.settings/ + +# bin diff --git a/vendor/github.com/nats-io/go-nats/.travis.yml b/vendor/github.com/nats-io/go-nats/.travis.yml new file mode 100644 index 00000000..b46060de --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/.travis.yml @@ -0,0 +1,21 @@ +language: go +sudo: false +go: +- 1.11.x +- 1.10.x +go_import_path: github.com/nats-io/go-nats +install: +- go get -t ./... +- go get github.com/nats-io/gnatsd +- go get github.com/mattn/goveralls +- go get github.com/wadey/gocovmerge +- go get -u honnef.co/go/tools/cmd/staticcheck +- go get -u github.com/client9/misspell/cmd/misspell +before_script: +- $(exit $(go fmt ./... | wc -l)) +- go vet ./... +- misspell -error -locale US . +- staticcheck -ignore "$(cat staticcheck.ignore)" ./... +script: +- go test -i -race ./... +- if [[ "$TRAVIS_GO_VERSION" =~ 1.11 ]]; then ./scripts/cov.sh TRAVIS; else go test -race ./...; fi diff --git a/vendor/github.com/nats-io/go-nats/GOVERNANCE.md b/vendor/github.com/nats-io/go-nats/GOVERNANCE.md new file mode 100644 index 00000000..1d5a7be3 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/GOVERNANCE.md @@ -0,0 +1,3 @@ +# NATS Go Client Governance + +NATS Go Client (go-nats) is part of the NATS project and is subject to the [NATS Governance](https://github.com/nats-io/nats-general/blob/master/GOVERNANCE.md). \ No newline at end of file diff --git a/vendor/github.com/nats-io/go-nats/LICENSE b/vendor/github.com/nats-io/go-nats/LICENSE new file mode 100644 index 00000000..261eeb9e --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/nats-io/go-nats/MAINTAINERS.md b/vendor/github.com/nats-io/go-nats/MAINTAINERS.md new file mode 100644 index 00000000..323faa8e --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/MAINTAINERS.md @@ -0,0 +1,10 @@ +# Maintainers + +Maintainership is on a per project basis. + +### Core-maintainers + - Derek Collison [@derekcollison](https://github.com/derekcollison) + - Ivan Kozlovic [@kozlovic](https://github.com/kozlovic) + +### Maintainers + - Waldemar Quevedo [@wallyqs](https://github.com/wallyqs) \ No newline at end of file diff --git a/vendor/github.com/nats-io/go-nats/README.md b/vendor/github.com/nats-io/go-nats/README.md new file mode 100644 index 00000000..a2bbdf9e --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/README.md @@ -0,0 +1,384 @@ +# NATS - Go Client +A [Go](http://golang.org) client for the [NATS messaging system](https://nats.io). + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats.svg?type=shield)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats?ref=badge_shield) +[![Go Report Card](https://goreportcard.com/badge/github.com/nats-io/go-nats)](https://goreportcard.com/report/github.com/nats-io/go-nats) [![Build Status](https://travis-ci.org/nats-io/go-nats.svg?branch=master)](http://travis-ci.org/nats-io/go-nats) [![GoDoc](https://godoc.org/github.com/nats-io/go-nats?status.svg)](http://godoc.org/github.com/nats-io/go-nats) [![Coverage Status](https://coveralls.io/repos/nats-io/go-nats/badge.svg?branch=master)](https://coveralls.io/r/nats-io/go-nats?branch=master) + +## Installation + +```bash +# Go client +go get github.com/nats-io/go-nats + +# Server +go get github.com/nats-io/gnatsd +``` + +## Basic Usage + +```go +import nats "github.com/nats-io/go-nats" + +// Connect to a server +nc, _ := nats.Connect(nats.DefaultURL) + +// Simple Publisher +nc.Publish("foo", []byte("Hello World")) + +// Simple Async Subscriber +nc.Subscribe("foo", func(m *nats.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +// Simple Sync Subscriber +sub, err := nc.SubscribeSync("foo") +m, err := sub.NextMsg(timeout) + +// Channel Subscriber +ch := make(chan *nats.Msg, 64) +sub, err := nc.ChanSubscribe("foo", ch) +msg := <- ch + +// Unsubscribe +sub.Unsubscribe() + +// Drain +sub.Drain() + +// Requests +msg, err := nc.Request("help", []byte("help me"), 10*time.Millisecond) + +// Replies +nc.Subscribe("help", func(m *Msg) { + nc.Publish(m.Reply, []byte("I can help!")) +}) + +// Drain connection (Preferred for responders) +// Close() not needed if this is called. +nc.Drain() + +// Close connection +nc.Close() +``` + +## Encoded Connections + +```go + +nc, _ := nats.Connect(nats.DefaultURL) +c, _ := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +defer c.Close() + +// Simple Publisher +c.Publish("foo", "Hello World") + +// Simple Async Subscriber +c.Subscribe("foo", func(s string) { + fmt.Printf("Received a message: %s\n", s) +}) + +// EncodedConn can Publish any raw Go type using the registered Encoder +type person struct { + Name string + Address string + Age int +} + +// Go type Subscriber +c.Subscribe("hello", func(p *person) { + fmt.Printf("Received a person: %+v\n", p) +}) + +me := &person{Name: "derek", Age: 22, Address: "140 New Montgomery Street, San Francisco, CA"} + +// Go type Publisher +c.Publish("hello", me) + +// Unsubscribe +sub, err := c.Subscribe("foo", nil) +... +sub.Unsubscribe() + +// Requests +var response string +err := c.Request("help", "help me", &response, 10*time.Millisecond) +if err != nil { + fmt.Printf("Request failed: %v\n", err) +} + +// Replying +c.Subscribe("help", func(subj, reply string, msg string) { + c.Publish(reply, "I can help!") +}) + +// Close connection +c.Close(); +``` + +## New Authentication (Nkeys and User Credentials) +This requires server with version >= 2.0.0 + +NATS servers have a new security and authentication mechanism to authenticate with user credentials and Nkeys. +The simplest form is to use the helper method UserCredentials(credsFilepath). +```go +nc, err := nats.Connect(url, UserCredentials("user.creds")) +``` + +The helper methos creates two callback handlers to present the user JWT and sign the nonce challenge from the server. +The core client library never has direct access to your private key and simply performs the callback for signing the server challenge. +The helper will load and wipe and erase memory it uses for each connect or reconnect. + +The helper also can take two entries, one for the JWT and one for the NKey seed file. +```go +nc, err := nats.Connect(url, UserCredentials("user.jwt", "user.nk")) +``` + +You can also set the callback handlers directly and manage challenge signing directly. +```go +nc, err := nats.Connect(url, UserJWT(jwtCB, sigCB)) +``` + +Bare Nkeys are also supported. The nkey seed should be in a read only file, e.g. seed.txt +```bash +> cat seed.txt +# This is my seed nkey! +SUAGMJH5XLGZKQQWAWKRZJIGMOU4HPFUYLXJMXOO5NLFEO2OOQJ5LPRDPM +``` + +This is a helper function which will load and decode and do the proper signing for the server nonce. +It will clear memory in between invocations. +You can choose to use the low level option and provide the public key and a signature callback on your own. + +```go +opt, err := nats.NkeyOptionFromSeed("seed.txt") +nc, err := nats.Connect(serverUrl, opt) + +// Direct +nc, err := nats.Connect(serverUrl, Nkey(pubNkey, sigCB)) +``` + +## TLS + +```go +// tls as a scheme will enable secure connections by default. This will also verify the server name. +nc, err := nats.Connect("tls://nats.demo.io:4443") + +// If you are using a self-signed certificate, you need to have a tls.Config with RootCAs setup. +// We provide a helper method to make this case easier. +nc, err = nats.Connect("tls://localhost:4443", nats.RootCAs("./configs/certs/ca.pem")) + +// If the server requires client certificate, there is an helper function for that too: +cert := nats.ClientCert("./configs/certs/client-cert.pem", "./configs/certs/client-key.pem") +nc, err = nats.Connect("tls://localhost:4443", cert) + +// You can also supply a complete tls.Config + +certFile := "./configs/certs/client-cert.pem" +keyFile := "./configs/certs/client-key.pem" +cert, err := tls.LoadX509KeyPair(certFile, keyFile) +if err != nil { + t.Fatalf("error parsing X509 certificate/key pair: %v", err) +} + +config := &tls.Config{ + ServerName: opts.Host, + Certificates: []tls.Certificate{cert}, + RootCAs: pool, + MinVersion: tls.VersionTLS12, +} + +nc, err = nats.Connect("nats://localhost:4443", nats.Secure(config)) +if err != nil { + t.Fatalf("Got an error on Connect with Secure Options: %+v\n", err) +} + +``` + +## Using Go Channels (netchan) + +```go +nc, _ := nats.Connect(nats.DefaultURL) +ec, _ := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +defer ec.Close() + +type person struct { + Name string + Address string + Age int +} + +recvCh := make(chan *person) +ec.BindRecvChan("hello", recvCh) + +sendCh := make(chan *person) +ec.BindSendChan("hello", sendCh) + +me := &person{Name: "derek", Age: 22, Address: "140 New Montgomery Street"} + +// Send via Go channels +sendCh <- me + +// Receive via Go channels +who := <- recvCh +``` + +## Wildcard Subscriptions + +```go + +// "*" matches any token, at any level of the subject. +nc.Subscribe("foo.*.baz", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +nc.Subscribe("foo.bar.*", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +// ">" matches any length of the tail of a subject, and can only be the last token +// E.g. 'foo.>' will match 'foo.bar', 'foo.bar.baz', 'foo.foo.bar.bax.22' +nc.Subscribe("foo.>", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +// Matches all of the above +nc.Publish("foo.bar.baz", []byte("Hello World")) + +``` + +## Queue Groups + +```go +// All subscriptions with the same queue name will form a queue group. +// Each message will be delivered to only one subscriber per queue group, +// using queuing semantics. You can have as many queue groups as you wish. +// Normal subscribers will continue to work as expected. + +nc.QueueSubscribe("foo", "job_workers", func(_ *Msg) { + received += 1; +}) + +``` + +## Advanced Usage + +```go + +// Flush connection to server, returns when all messages have been processed. +nc.Flush() +fmt.Println("All clear!") + +// FlushTimeout specifies a timeout value as well. +err := nc.FlushTimeout(1*time.Second) +if err != nil { + fmt.Println("All clear!") +} else { + fmt.Println("Flushed timed out!") +} + +// Auto-unsubscribe after MAX_WANTED messages received +const MAX_WANTED = 10 +sub, err := nc.Subscribe("foo") +sub.AutoUnsubscribe(MAX_WANTED) + +// Multiple connections +nc1 := nats.Connect("nats://host1:4222") +nc2 := nats.Connect("nats://host2:4222") + +nc1.Subscribe("foo", func(m *Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +nc2.Publish("foo", []byte("Hello World!")); + +``` + +## Clustered Usage + +```go + +var servers = "nats://localhost:1222, nats://localhost:1223, nats://localhost:1224" + +nc, err := nats.Connect(servers) + +// Optionally set ReconnectWait and MaxReconnect attempts. +// This example means 10 seconds total per backend. +nc, err = nats.Connect(servers, nats.MaxReconnects(5), nats.ReconnectWait(2 * time.Second)) + +// Optionally disable randomization of the server pool +nc, err = nats.Connect(servers, nats.DontRandomize()) + +// Setup callbacks to be notified on disconnects, reconnects and connection closed. +nc, err = nats.Connect(servers, + nats.DisconnectHandler(func(nc *nats.Conn) { + fmt.Printf("Got disconnected!\n") + }), + nats.ReconnectHandler(func(nc *nats.Conn) { + fmt.Printf("Got reconnected to %v!\n", nc.ConnectedUrl()) + }), + nats.ClosedHandler(func(nc *nats.Conn) { + fmt.Printf("Connection closed. Reason: %q\n", nc.LastError()) + }) +) + +// When connecting to a mesh of servers with auto-discovery capabilities, +// you may need to provide a username/password or token in order to connect +// to any server in that mesh when authentication is required. +// Instead of providing the credentials in the initial URL, you will use +// new option setters: +nc, err = nats.Connect("nats://localhost:4222", nats.UserInfo("foo", "bar")) + +// For token based authentication: +nc, err = nats.Connect("nats://localhost:4222", nats.Token("S3cretT0ken")) + +// You can even pass the two at the same time in case one of the server +// in the mesh requires token instead of user name and password. +nc, err = nats.Connect("nats://localhost:4222", + nats.UserInfo("foo", "bar"), + nats.Token("S3cretT0ken")) + +// Note that if credentials are specified in the initial URLs, they take +// precedence on the credentials specfied through the options. +// For instance, in the connect call below, the client library will use +// the user "my" and password "pwd" to connect to locahost:4222, however, +// it will use username "foo" and password "bar" when (re)connecting to +// a different server URL that it got as part of the auto-discovery. +nc, err = nats.Connect("nats://my:pwd@localhost:4222", nats.UserInfo("foo", "bar")) + +``` + +## Context support (+Go 1.7) + +```go +ctx, cancel := context.WithTimeout(context.Background(), 2*time.Second) +defer cancel() + +nc, err := nats.Connect(nats.DefaultURL) + +// Request with context +msg, err := nc.RequestWithContext(ctx, "foo", []byte("bar")) + +// Synchronous subscriber with context +sub, err := nc.SubscribeSync("foo") +msg, err := sub.NextMsgWithContext(ctx) + +// Encoded Request with context +c, err := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +type request struct { + Message string `json:"message"` +} +type response struct { + Code int `json:"code"` +} +req := &request{Message: "Hello"} +resp := &response{} +err := c.RequestWithContext(ctx, "foo", req, resp) +``` + +## License + +Unless otherwise noted, the NATS source files are distributed +under the Apache Version 2.0 license found in the LICENSE file. + +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats.svg?type=large)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats?ref=badge_large) diff --git a/vendor/github.com/nats-io/go-nats/TODO.md b/vendor/github.com/nats-io/go-nats/TODO.md new file mode 100644 index 00000000..213aaeca --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/TODO.md @@ -0,0 +1,26 @@ + +- [ ] Better constructors, options handling +- [ ] Functions for callback settings after connection created. +- [ ] Better options for subscriptions. Slow Consumer state settable, Go routines vs Inline. +- [ ] Move off of channels for subscribers, use syncPool linkedLists, etc with highwater. +- [ ] Test for valid subjects on publish and subscribe? +- [ ] SyncSubscriber and Next for EncodedConn +- [ ] Fast Publisher? +- [ ] pooling for structs used? leaky bucket? +- [ ] Timeout 0 should work as no timeout +- [x] Ping timer +- [x] Name in Connect for gnatsd +- [x] Asynchronous error handling +- [x] Parser rewrite +- [x] Reconnect +- [x] Hide Lock +- [x] Easier encoder interface +- [x] QueueSubscribeSync +- [x] Make nats specific errors prefixed with 'nats:' +- [x] API test for closed connection +- [x] TLS/SSL +- [x] Stats collection +- [x] Disconnect detection +- [x] Optimized Publish (coalescing) +- [x] Do Examples via Go style +- [x] Standardized Errors diff --git a/vendor/github.com/nats-io/go-nats/context.go b/vendor/github.com/nats-io/go-nats/context.go new file mode 100644 index 00000000..ee5576f5 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/context.go @@ -0,0 +1,241 @@ +// Copyright 2016-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.7 + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "context" + "reflect" +) + +// RequestWithContext takes a context, a subject and payload +// in bytes and request expecting a single response. +func (nc *Conn) RequestWithContext(ctx context.Context, subj string, data []byte) (*Msg, error) { + if ctx == nil { + return nil, ErrInvalidContext + } + if nc == nil { + return nil, ErrInvalidConnection + } + // Check whether the context is done already before making + // the request. + if ctx.Err() != nil { + return nil, ctx.Err() + } + + nc.mu.Lock() + // If user wants the old style. + if nc.Opts.UseOldRequestStyle { + nc.mu.Unlock() + return nc.oldRequestWithContext(ctx, subj, data) + } + + // Do setup for the new style. + if nc.respMap == nil { + nc.initNewResp() + } + // Create literal Inbox and map to a chan msg. + mch := make(chan *Msg, RequestChanLen) + respInbox := nc.newRespInbox() + token := respToken(respInbox) + nc.respMap[token] = mch + createSub := nc.respMux == nil + ginbox := nc.respSub + nc.mu.Unlock() + + if createSub { + // Make sure scoped subscription is setup only once. + var err error + nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) }) + if err != nil { + return nil, err + } + } + + err := nc.PublishRequest(subj, respInbox, data) + if err != nil { + return nil, err + } + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + case <-ctx.Done(): + nc.mu.Lock() + delete(nc.respMap, token) + nc.mu.Unlock() + return nil, ctx.Err() + } + + return msg, nil +} + +// oldRequestWithContext utilizes inbox and subscription per request. +func (nc *Conn) oldRequestWithContext(ctx context.Context, subj string, data []byte) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + + return s.NextMsgWithContext(ctx) +} + +// NextMsgWithContext takes a context and returns the next message +// available to a synchronous subscriber, blocking until it is delivered +// or context gets canceled. +func (s *Subscription) NextMsgWithContext(ctx context.Context) (*Msg, error) { + if ctx == nil { + return nil, ErrInvalidContext + } + if s == nil { + return nil, ErrBadSubscription + } + if ctx.Err() != nil { + return nil, ctx.Err() + } + + s.mu.Lock() + err := s.validateNextMsgState() + if err != nil { + s.mu.Unlock() + return nil, err + } + + // snapshot + mch := s.mch + s.mu.Unlock() + + var ok bool + var msg *Msg + + // If something is available right away, let's optimize that case. + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } else { + return msg, nil + } + default: + } + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } + case <-ctx.Done(): + return nil, ctx.Err() + } + + return msg, nil +} + +// FlushWithContext will allow a context to control the duration +// of a Flush() call. This context should be non-nil and should +// have a deadline set. We will return an error if none is present. +func (nc *Conn) FlushWithContext(ctx context.Context) error { + if nc == nil { + return ErrInvalidConnection + } + if ctx == nil { + return ErrInvalidContext + } + _, ok := ctx.Deadline() + if !ok { + return ErrNoDeadlineContext + } + + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + // Create a buffered channel to prevent chan send to block + // in processPong() + ch := make(chan struct{}, 1) + nc.sendPing(ch) + nc.mu.Unlock() + + var err error + + select { + case _, ok := <-ch: + if !ok { + err = ErrConnectionClosed + } else { + close(ch) + } + case <-ctx.Done(): + err = ctx.Err() + } + + if err != nil { + nc.removeFlushEntry(ch) + } + + return err +} + +// RequestWithContext will create an Inbox and perform a Request +// using the provided cancellation context with the Inbox reply +// for the data v. A response will be decoded into the vPtrResponse. +func (c *EncodedConn) RequestWithContext(ctx context.Context, subject string, v interface{}, vPtr interface{}) error { + if ctx == nil { + return ErrInvalidContext + } + + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.RequestWithContext(ctx, subject, b) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err := c.Enc.Decode(m.Subject, m.Data, vPtr) + if err != nil { + return err + } + } + + return nil +} diff --git a/vendor/github.com/nats-io/go-nats/enc.go b/vendor/github.com/nats-io/go-nats/enc.go new file mode 100644 index 00000000..9a0dd2c0 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/enc.go @@ -0,0 +1,269 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "errors" + "fmt" + "reflect" + "sync" + "time" + + // Default Encoders + "github.com/nats-io/go-nats/encoders/builtin" +) + +// Encoder interface is for all register encoders +type Encoder interface { + Encode(subject string, v interface{}) ([]byte, error) + Decode(subject string, data []byte, vPtr interface{}) error +} + +var encMap map[string]Encoder +var encLock sync.Mutex + +// Indexe names into the Registered Encoders. +const ( + JSON_ENCODER = "json" + GOB_ENCODER = "gob" + DEFAULT_ENCODER = "default" +) + +func init() { + encMap = make(map[string]Encoder) + // Register json, gob and default encoder + RegisterEncoder(JSON_ENCODER, &builtin.JsonEncoder{}) + RegisterEncoder(GOB_ENCODER, &builtin.GobEncoder{}) + RegisterEncoder(DEFAULT_ENCODER, &builtin.DefaultEncoder{}) +} + +// EncodedConn are the preferred way to interface with NATS. They wrap a bare connection to +// a nats server and have an extendable encoder system that will encode and decode messages +// from raw Go types. +type EncodedConn struct { + Conn *Conn + Enc Encoder +} + +// NewEncodedConn will wrap an existing Connection and utilize the appropriate registered +// encoder. +func NewEncodedConn(c *Conn, encType string) (*EncodedConn, error) { + if c == nil { + return nil, errors.New("nats: Nil Connection") + } + if c.IsClosed() { + return nil, ErrConnectionClosed + } + ec := &EncodedConn{Conn: c, Enc: EncoderForType(encType)} + if ec.Enc == nil { + return nil, fmt.Errorf("no encoder registered for '%s'", encType) + } + return ec, nil +} + +// RegisterEncoder will register the encType with the given Encoder. Useful for customization. +func RegisterEncoder(encType string, enc Encoder) { + encLock.Lock() + defer encLock.Unlock() + encMap[encType] = enc +} + +// EncoderForType will return the registered Encoder for the encType. +func EncoderForType(encType string) Encoder { + encLock.Lock() + defer encLock.Unlock() + return encMap[encType] +} + +// Publish publishes the data argument to the given subject. The data argument +// will be encoded using the associated encoder. +func (c *EncodedConn) Publish(subject string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, _EMPTY_, b) +} + +// PublishRequest will perform a Publish() expecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (c *EncodedConn) PublishRequest(subject, reply string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, reply, b) +} + +// Request will create an Inbox and perform a Request() call +// with the Inbox reply for the data v. A response will be +// decoded into the vPtrResponse. +func (c *EncodedConn) Request(subject string, v interface{}, vPtr interface{}, timeout time.Duration) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.Request(subject, b, timeout) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err = c.Enc.Decode(m.Subject, m.Data, vPtr) + } + return err +} + +// Handler is a specific callback used for Subscribe. It is generalized to +// an interface{}, but we will discover its format and arguments at runtime +// and perform the correct callback, including de-marshaling JSON strings +// back into the appropriate struct based on the signature of the Handler. +// +// Handlers are expected to have one of four signatures. +// +// type person struct { +// Name string `json:"name,omitempty"` +// Age uint `json:"age,omitempty"` +// } +// +// handler := func(m *Msg) +// handler := func(p *person) +// handler := func(subject string, o *obj) +// handler := func(subject, reply string, o *obj) +// +// These forms allow a callback to request a raw Msg ptr, where the processing +// of the message from the wire is untouched. Process a JSON representation +// and demarshal it into the given struct, e.g. person. +// There are also variants where the callback wants either the subject, or the +// subject and the reply subject. +type Handler interface{} + +// Dissect the cb Handler's signature +func argInfo(cb Handler) (reflect.Type, int) { + cbType := reflect.TypeOf(cb) + if cbType.Kind() != reflect.Func { + panic("nats: Handler needs to be a func") + } + numArgs := cbType.NumIn() + if numArgs == 0 { + return nil, numArgs + } + return cbType.In(numArgs - 1), numArgs +} + +var emptyMsgType = reflect.TypeOf(&Msg{}) + +// Subscribe will create a subscription on the given subject and process incoming +// messages using the specified Handler. The Handler should be a func that matches +// a signature from the description of Handler from above. +func (c *EncodedConn) Subscribe(subject string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, _EMPTY_, cb) +} + +// QueueSubscribe will create a queue subscription on the given subject and process +// incoming messages using the specified Handler. The Handler should be a func that +// matches a signature from the description of Handler from above. +func (c *EncodedConn) QueueSubscribe(subject, queue string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, queue, cb) +} + +// Internal implementation that all public functions will use. +func (c *EncodedConn) subscribe(subject, queue string, cb Handler) (*Subscription, error) { + if cb == nil { + return nil, errors.New("nats: Handler required for EncodedConn Subscription") + } + argType, numArgs := argInfo(cb) + if argType == nil { + return nil, errors.New("nats: Handler requires at least one argument") + } + + cbValue := reflect.ValueOf(cb) + wantsRaw := (argType == emptyMsgType) + + natsCB := func(m *Msg) { + var oV []reflect.Value + if wantsRaw { + oV = []reflect.Value{reflect.ValueOf(m)} + } else { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach.push(func() { + c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, errors.New("nats: Got an error trying to unmarshal: "+err.Error())) + }) + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + + // Callback Arity + switch numArgs { + case 1: + oV = []reflect.Value{oPtr} + case 2: + subV := reflect.ValueOf(m.Subject) + oV = []reflect.Value{subV, oPtr} + case 3: + subV := reflect.ValueOf(m.Subject) + replyV := reflect.ValueOf(m.Reply) + oV = []reflect.Value{subV, replyV, oPtr} + } + + } + cbValue.Call(oV) + } + + return c.Conn.subscribe(subject, queue, natsCB, nil) +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (c *EncodedConn) FlushTimeout(timeout time.Duration) (err error) { + return c.Conn.FlushTimeout(timeout) +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (c *EncodedConn) Flush() error { + return c.Conn.Flush() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush(), etc. +func (c *EncodedConn) Close() { + c.Conn.Close() +} + +// Drain will put a connection into a drain state. All subscriptions will +// immediately be put into a drain state. Upon completion, the publishers +// will be drained and can not publish any additional messages. Upon draining +// of the publishers, the connection will be closed. Use the ClosedCB() +// option to know when the connection has moved from draining to closed. +func (c *EncodedConn) Drain() error { + return c.Conn.Drain() +} + +// LastError reports the last error encountered via the Connection. +func (c *EncodedConn) LastError() error { + return c.Conn.err +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go new file mode 100644 index 00000000..46d918ee --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go @@ -0,0 +1,117 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package builtin + +import ( + "bytes" + "fmt" + "reflect" + "strconv" + "unsafe" +) + +// DefaultEncoder implementation for EncodedConn. +// This encoder will leave []byte and string untouched, but will attempt to +// turn numbers into appropriate strings that can be decoded. It will also +// propely encoded and decode bools. If will encode a struct, but if you want +// to properly handle structures you should use JsonEncoder. +type DefaultEncoder struct { + // Empty +} + +var trueB = []byte("true") +var falseB = []byte("false") +var nilB = []byte("") + +// Encode +func (je *DefaultEncoder) Encode(subject string, v interface{}) ([]byte, error) { + switch arg := v.(type) { + case string: + bytes := *(*[]byte)(unsafe.Pointer(&arg)) + return bytes, nil + case []byte: + return arg, nil + case bool: + if arg { + return trueB, nil + } else { + return falseB, nil + } + case nil: + return nilB, nil + default: + var buf bytes.Buffer + fmt.Fprintf(&buf, "%+v", arg) + return buf.Bytes(), nil + } +} + +// Decode +func (je *DefaultEncoder) Decode(subject string, data []byte, vPtr interface{}) error { + // Figure out what it's pointing to... + sData := *(*string)(unsafe.Pointer(&data)) + switch arg := vPtr.(type) { + case *string: + *arg = sData + return nil + case *[]byte: + *arg = data + return nil + case *int: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int(n) + return nil + case *int32: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int32(n) + return nil + case *int64: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int64(n) + return nil + case *float32: + n, err := strconv.ParseFloat(sData, 32) + if err != nil { + return err + } + *arg = float32(n) + return nil + case *float64: + n, err := strconv.ParseFloat(sData, 64) + if err != nil { + return err + } + *arg = float64(n) + return nil + case *bool: + b, err := strconv.ParseBool(sData) + if err != nil { + return err + } + *arg = b + return nil + default: + vt := reflect.TypeOf(arg).Elem() + return fmt.Errorf("nats: Default Encoder can't decode to type %s", vt) + } +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go new file mode 100644 index 00000000..632bcbd3 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go @@ -0,0 +1,45 @@ +// Copyright 2013-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package builtin + +import ( + "bytes" + "encoding/gob" +) + +// GobEncoder is a Go specific GOB Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/gob to Marshal +// and Unmarshal most types, including structs. +type GobEncoder struct { + // Empty +} + +// FIXME(dlc) - This could probably be more efficient. + +// Encode +func (ge *GobEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b := new(bytes.Buffer) + enc := gob.NewEncoder(b) + if err := enc.Encode(v); err != nil { + return nil, err + } + return b.Bytes(), nil +} + +// Decode +func (ge *GobEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + dec := gob.NewDecoder(bytes.NewBuffer(data)) + err = dec.Decode(vPtr) + return +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go new file mode 100644 index 00000000..c9670f31 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go @@ -0,0 +1,56 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package builtin + +import ( + "encoding/json" + "strings" +) + +// JsonEncoder is a JSON Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/json to Marshal +// and Unmarshal most types, including structs. +type JsonEncoder struct { + // Empty +} + +// Encode +func (je *JsonEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b, err := json.Marshal(v) + if err != nil { + return nil, err + } + return b, nil +} + +// Decode +func (je *JsonEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + switch arg := vPtr.(type) { + case *string: + // If they want a string and it is a JSON string, strip quotes + // This allows someone to send a struct but receive as a plain string + // This cast should be efficient for Go 1.3 and beyond. + str := string(data) + if strings.HasPrefix(str, `"`) && strings.HasSuffix(str, `"`) { + *arg = str[1 : len(str)-1] + } else { + *arg = str + } + case *[]byte: + *arg = data + default: + err = json.Unmarshal(data, arg) + } + return +} diff --git a/vendor/github.com/nats-io/go-nats/nats.go b/vendor/github.com/nats-io/go-nats/nats.go new file mode 100644 index 00000000..ec43708a --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/nats.go @@ -0,0 +1,3940 @@ +// Copyright 2012-2019 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "bufio" + "bytes" + "crypto/tls" + "crypto/x509" + "encoding/base64" + "encoding/json" + "errors" + "fmt" + "io" + "io/ioutil" + "math/rand" + "net" + "net/url" + "regexp" + "runtime" + "strconv" + "strings" + "sync" + "sync/atomic" + "time" + + "github.com/nats-io/go-nats/util" + "github.com/nats-io/nkeys" + "github.com/nats-io/nuid" +) + +// Default Constants +const ( + Version = "1.7.2" + DefaultURL = "nats://localhost:4222" + DefaultPort = 4222 + DefaultMaxReconnect = 60 + DefaultReconnectWait = 2 * time.Second + DefaultTimeout = 2 * time.Second + DefaultPingInterval = 2 * time.Minute + DefaultMaxPingOut = 2 + DefaultMaxChanLen = 8192 // 8k + DefaultReconnectBufSize = 8 * 1024 * 1024 // 8MB + RequestChanLen = 8 + DefaultDrainTimeout = 30 * time.Second + LangString = "go" +) + +const ( + // STALE_CONNECTION is for detection and proper handling of stale connections. + STALE_CONNECTION = "stale connection" + + // PERMISSIONS_ERR is for when nats server subject authorization has failed. + PERMISSIONS_ERR = "permissions violation" + + // AUTHORIZATION_ERR is for when nats server user authorization has failed. + AUTHORIZATION_ERR = "authorization violation" +) + +// Errors +var ( + ErrConnectionClosed = errors.New("nats: connection closed") + ErrConnectionDraining = errors.New("nats: connection draining") + ErrDrainTimeout = errors.New("nats: draining connection timed out") + ErrConnectionReconnecting = errors.New("nats: connection reconnecting") + ErrSecureConnRequired = errors.New("nats: secure connection required") + ErrSecureConnWanted = errors.New("nats: secure connection not available") + ErrBadSubscription = errors.New("nats: invalid subscription") + ErrTypeSubscription = errors.New("nats: invalid subscription type") + ErrBadSubject = errors.New("nats: invalid subject") + ErrSlowConsumer = errors.New("nats: slow consumer, messages dropped") + ErrTimeout = errors.New("nats: timeout") + ErrBadTimeout = errors.New("nats: timeout invalid") + ErrAuthorization = errors.New("nats: authorization violation") + ErrNoServers = errors.New("nats: no servers available for connection") + ErrJsonParse = errors.New("nats: connect message, json parse error") + ErrChanArg = errors.New("nats: argument needs to be a channel type") + ErrMaxPayload = errors.New("nats: maximum payload exceeded") + ErrMaxMessages = errors.New("nats: maximum messages delivered") + ErrSyncSubRequired = errors.New("nats: illegal call on an async subscription") + ErrMultipleTLSConfigs = errors.New("nats: multiple tls.Configs not allowed") + ErrNoInfoReceived = errors.New("nats: protocol exception, INFO not received") + ErrReconnectBufExceeded = errors.New("nats: outbound buffer limit exceeded") + ErrInvalidConnection = errors.New("nats: invalid connection") + ErrInvalidMsg = errors.New("nats: invalid message or message nil") + ErrInvalidArg = errors.New("nats: invalid argument") + ErrInvalidContext = errors.New("nats: invalid context") + ErrNoDeadlineContext = errors.New("nats: context requires a deadline") + ErrNoEchoNotSupported = errors.New("nats: no echo option not supported by this server") + ErrClientIDNotSupported = errors.New("nats: client ID not supported by this server") + ErrUserButNoSigCB = errors.New("nats: user callback defined without a signature handler") + ErrNkeyButNoSigCB = errors.New("nats: nkey defined without a signature handler") + ErrNoUserCB = errors.New("nats: user callback not defined") + ErrNkeyAndUser = errors.New("nats: user callback and nkey defined") + ErrNkeysNotSupported = errors.New("nats: nkeys not supported by the server") + ErrStaleConnection = errors.New("nats: " + STALE_CONNECTION) + ErrTokenAlreadySet = errors.New("nats: token and token handler both set") +) + +// GetDefaultOptions returns default configuration options for the client. +func GetDefaultOptions() Options { + return Options{ + AllowReconnect: true, + MaxReconnect: DefaultMaxReconnect, + ReconnectWait: DefaultReconnectWait, + Timeout: DefaultTimeout, + PingInterval: DefaultPingInterval, + MaxPingsOut: DefaultMaxPingOut, + SubChanLen: DefaultMaxChanLen, + ReconnectBufSize: DefaultReconnectBufSize, + DrainTimeout: DefaultDrainTimeout, + } +} + +// DEPRECATED: Use GetDefaultOptions() instead. +// DefaultOptions is not safe for use by multiple clients. +// For details see #308. +var DefaultOptions = GetDefaultOptions() + +// Status represents the state of the connection. +type Status int + +const ( + DISCONNECTED = Status(iota) + CONNECTED + CLOSED + RECONNECTING + CONNECTING + DRAINING_SUBS + DRAINING_PUBS +) + +// ConnHandler is used for asynchronous events such as +// disconnected and closed connections. +type ConnHandler func(*Conn) + +// ErrHandler is used to process asynchronous errors encountered +// while processing inbound messages. +type ErrHandler func(*Conn, *Subscription, error) + +// UserJWTHandler is used to fetch and return the account signed +// JWT for this user. +type UserJWTHandler func() (string, error) + +// SignatureHandler is used to sign a nonce from the server while +// authenticating with nkeys. The user should sign the nonce and +// return the base64 encoded signature. +type SignatureHandler func([]byte) ([]byte, error) + +// AuthTokenHandler is used to generate a new token. +type AuthTokenHandler func() string + +// asyncCB is used to preserve order for async callbacks. +type asyncCB struct { + f func() + next *asyncCB +} + +type asyncCallbacksHandler struct { + mu sync.Mutex + cond *sync.Cond + head *asyncCB + tail *asyncCB +} + +// Option is a function on the options for a connection. +type Option func(*Options) error + +// CustomDialer can be used to specify any dialer, not necessarily +// a *net.Dialer. +type CustomDialer interface { + Dial(network, address string) (net.Conn, error) +} + +// Options can be used to create a customized connection. +type Options struct { + + // Url represents a single NATS server url to which the client + // will be connecting. If the Servers option is also set, it + // then becomes the first server in the Servers array. + Url string + + // Servers is a configured set of servers which this client + // will use when attempting to connect. + Servers []string + + // NoRandomize configures whether we will randomize the + // server pool. + NoRandomize bool + + // NoEcho configures whether the server will echo back messages + // that are sent on this connection if we also have matching subscriptions. + // Note this is supported on servers >= version 1.2. Proto 1 or greater. + NoEcho bool + + // Name is an optional name label which will be sent to the server + // on CONNECT to identify the client. + Name string + + // Verbose signals the server to send an OK ack for commands + // successfully processed by the server. + Verbose bool + + // Pedantic signals the server whether it should be doing further + // validation of subjects. + Pedantic bool + + // Secure enables TLS secure connections that skip server + // verification by default. NOT RECOMMENDED. + Secure bool + + // TLSConfig is a custom TLS configuration to use for secure + // transports. + TLSConfig *tls.Config + + // AllowReconnect enables reconnection logic to be used when we + // encounter a disconnect from the current server. + AllowReconnect bool + + // MaxReconnect sets the number of reconnect attempts that will be + // tried before giving up. If negative, then it will never give up + // trying to reconnect. + MaxReconnect int + + // ReconnectWait sets the time to backoff after attempting a reconnect + // to a server that we were already connected to previously. + ReconnectWait time.Duration + + // Timeout sets the timeout for a Dial operation on a connection. + Timeout time.Duration + + // DrainTimeout sets the timeout for a Drain Operation to complete. + DrainTimeout time.Duration + + // FlusherTimeout is the maximum time to wait for write operations + // to the underlying connection to complete (including the flusher loop). + FlusherTimeout time.Duration + + // PingInterval is the period at which the client will be sending ping + // commands to the server, disabled if 0 or negative. + PingInterval time.Duration + + // MaxPingsOut is the maximum number of pending ping commands that can + // be awaiting a response before raising an ErrStaleConnection error. + MaxPingsOut int + + // ClosedCB sets the closed handler that is called when a client will + // no longer be connected. + ClosedCB ConnHandler + + // DisconnectedCB sets the disconnected handler that is called + // whenever the connection is disconnected. + DisconnectedCB ConnHandler + + // ReconnectedCB sets the reconnected handler called whenever + // the connection is successfully reconnected. + ReconnectedCB ConnHandler + + // DiscoveredServersCB sets the callback that is invoked whenever a new + // server has joined the cluster. + DiscoveredServersCB ConnHandler + + // AsyncErrorCB sets the async error handler (e.g. slow consumer errors) + AsyncErrorCB ErrHandler + + // ReconnectBufSize is the size of the backing bufio during reconnect. + // Once this has been exhausted publish operations will return an error. + ReconnectBufSize int + + // SubChanLen is the size of the buffered channel used between the socket + // Go routine and the message delivery for SyncSubscriptions. + // NOTE: This does not affect AsyncSubscriptions which are + // dictated by PendingLimits() + SubChanLen int + + // UserJWT sets the callback handler that will fetch a user's JWT. + UserJWT UserJWTHandler + + // Nkey sets the public nkey that will be used to authenticate + // when connecting to the server. UserJWT and Nkey are mutually exclusive + // and if defined, UserJWT will take precedence. + Nkey string + + // SignatureCB designates the function used to sign the nonce + // presented from the server. + SignatureCB SignatureHandler + + // User sets the username to be used when connecting to the server. + User string + + // Password sets the password to be used when connecting to a server. + Password string + + // Token sets the token to be used when connecting to a server. + Token string + + // TokenHandler designates the function used to generate the token to be used when connecting to a server. + TokenHandler AuthTokenHandler + + // Dialer allows a custom net.Dialer when forming connections. + // DEPRECATED: should use CustomDialer instead. + Dialer *net.Dialer + + // CustomDialer allows to specify a custom dialer (not necessarily + // a *net.Dialer). + CustomDialer CustomDialer + + // UseOldRequestStyle forces the old method of Requests that utilize + // a new Inbox and a new Subscription for each request. + UseOldRequestStyle bool +} + +const ( + // Scratch storage for assembling protocol headers + scratchSize = 512 + + // The size of the bufio reader/writer on top of the socket. + defaultBufSize = 32768 + + // The buffered size of the flush "kick" channel + flushChanSize = 1024 + + // Default server pool size + srvPoolSize = 4 + + // NUID size + nuidSize = 22 + + // Default port used if none is specified in given URL(s) + defaultPortString = "4222" +) + +// A Conn represents a bare connection to a nats-server. +// It can send and receive []byte payloads. +type Conn struct { + // Keep all members for which we use atomic at the beginning of the + // struct and make sure they are all 64bits (or use padding if necessary). + // atomic.* functions crash on 32bit machines if operand is not aligned + // at 64bit. See https://github.com/golang/go/issues/599 + Statistics + mu sync.Mutex + // Opts holds the configuration of the Conn. + // Modifying the configuration of a running Conn is a race. + Opts Options + wg sync.WaitGroup + srvPool []*srv + current *srv + urls map[string]struct{} // Keep track of all known URLs (used by processInfo) + conn net.Conn + bw *bufio.Writer + pending *bytes.Buffer + fch chan struct{} + info serverInfo + ssid int64 + subsMu sync.RWMutex + subs map[int64]*Subscription + ach *asyncCallbacksHandler + pongs []chan struct{} + scratch [scratchSize]byte + status Status + initc bool // true if the connection is performing the initial connect + err error + ps *parseState + ptmr *time.Timer + pout int + + // New style response handler + respSub string // The wildcard subject + respMux *Subscription // A single response subscription + respMap map[string]chan *Msg // Request map for the response msg channels + respSetup sync.Once // Ensures response subscription occurs once + respRand *rand.Rand // Used for generating suffix. +} + +// A Subscription represents interest in a given subject. +type Subscription struct { + mu sync.Mutex + sid int64 + + // Subject that represents this subscription. This can be different + // than the received subject inside a Msg if this is a wildcard. + Subject string + + // Optional queue group name. If present, all subscriptions with the + // same name will form a distributed queue, and each message will + // only be processed by one member of the group. + Queue string + + delivered uint64 + max uint64 + conn *Conn + mcb MsgHandler + mch chan *Msg + closed bool + sc bool + connClosed bool + + // Type of Subscription + typ SubscriptionType + + // Async linked list + pHead *Msg + pTail *Msg + pCond *sync.Cond + + // Pending stats, async subscriptions, high-speed etc. + pMsgs int + pBytes int + pMsgsMax int + pBytesMax int + pMsgsLimit int + pBytesLimit int + dropped int +} + +// Msg is a structure used by Subscribers and PublishMsg(). +type Msg struct { + Subject string + Reply string + Data []byte + Sub *Subscription + next *Msg + barrier *barrierInfo +} + +type barrierInfo struct { + refs int64 + f func() +} + +// Tracks various stats received and sent on this connection, +// including counts for messages and bytes. +type Statistics struct { + InMsgs uint64 + OutMsgs uint64 + InBytes uint64 + OutBytes uint64 + Reconnects uint64 +} + +// Tracks individual backend servers. +type srv struct { + url *url.URL + didConnect bool + reconnects int + lastAttempt time.Time + isImplicit bool + tlsName string +} + +type serverInfo struct { + Id string `json:"server_id"` + Host string `json:"host"` + Port uint `json:"port"` + Version string `json:"version"` + AuthRequired bool `json:"auth_required"` + TLSRequired bool `json:"tls_required"` + MaxPayload int64 `json:"max_payload"` + ConnectURLs []string `json:"connect_urls,omitempty"` + Proto int `json:"proto,omitempty"` + CID uint64 `json:"client_id,omitempty"` + Nonce string `json:"nonce,omitempty"` +} + +const ( + // clientProtoZero is the original client protocol from 2009. + // http://nats.io/documentation/internals/nats-protocol/ + /* clientProtoZero */ _ = iota + // clientProtoInfo signals a client can receive more then the original INFO block. + // This can be used to update clients on other cluster members, etc. + clientProtoInfo +) + +type connectInfo struct { + Verbose bool `json:"verbose"` + Pedantic bool `json:"pedantic"` + UserJWT string `json:"jwt,omitempty"` + Nkey string `json:"nkey,omitempty"` + Signature string `json:"sig,omitempty"` + User string `json:"user,omitempty"` + Pass string `json:"pass,omitempty"` + Token string `json:"auth_token,omitempty"` + TLS bool `json:"tls_required"` + Name string `json:"name"` + Lang string `json:"lang"` + Version string `json:"version"` + Protocol int `json:"protocol"` + Echo bool `json:"echo"` +} + +// MsgHandler is a callback function that processes messages delivered to +// asynchronous subscribers. +type MsgHandler func(msg *Msg) + +// Connect will attempt to connect to the NATS system. +// The url can contain username/password semantics. e.g. nats://derek:pass@localhost:4222 +// Comma separated arrays are also supported, e.g. urlA, urlB. +// Options start with the defaults but can be overridden. +func Connect(url string, options ...Option) (*Conn, error) { + opts := GetDefaultOptions() + opts.Servers = processUrlString(url) + for _, opt := range options { + if opt != nil { + if err := opt(&opts); err != nil { + return nil, err + } + } + } + return opts.Connect() +} + +// Options that can be passed to Connect. + +// Name is an Option to set the client name. +func Name(name string) Option { + return func(o *Options) error { + o.Name = name + return nil + } +} + +// Secure is an Option to enable TLS secure connections that skip server verification by default. +// Pass a TLS Configuration for proper TLS. +// NOTE: This should NOT be used in a production setting. +func Secure(tls ...*tls.Config) Option { + return func(o *Options) error { + o.Secure = true + // Use of variadic just simplifies testing scenarios. We only take the first one. + if len(tls) > 1 { + return ErrMultipleTLSConfigs + } + if len(tls) == 1 { + o.TLSConfig = tls[0] + } + return nil + } +} + +// RootCAs is a helper option to provide the RootCAs pool from a list of filenames. +// If Secure is not already set this will set it as well. +func RootCAs(file ...string) Option { + return func(o *Options) error { + pool := x509.NewCertPool() + for _, f := range file { + rootPEM, err := ioutil.ReadFile(f) + if err != nil || rootPEM == nil { + return fmt.Errorf("nats: error loading or parsing rootCA file: %v", err) + } + ok := pool.AppendCertsFromPEM(rootPEM) + if !ok { + return fmt.Errorf("nats: failed to parse root certificate from %q", f) + } + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.RootCAs = pool + o.Secure = true + return nil + } +} + +// ClientCert is a helper option to provide the client certificate from a file. +// If Secure is not already set this will set it as well. +func ClientCert(certFile, keyFile string) Option { + return func(o *Options) error { + cert, err := tls.LoadX509KeyPair(certFile, keyFile) + if err != nil { + return fmt.Errorf("nats: error loading client certificate: %v", err) + } + cert.Leaf, err = x509.ParseCertificate(cert.Certificate[0]) + if err != nil { + return fmt.Errorf("nats: error parsing client certificate: %v", err) + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.Certificates = []tls.Certificate{cert} + o.Secure = true + return nil + } +} + +// NoReconnect is an Option to turn off reconnect behavior. +func NoReconnect() Option { + return func(o *Options) error { + o.AllowReconnect = false + return nil + } +} + +// DontRandomize is an Option to turn off randomizing the server pool. +func DontRandomize() Option { + return func(o *Options) error { + o.NoRandomize = true + return nil + } +} + +// NoEcho is an Option to turn off messages echoing back from a server. +// Note this is supported on servers >= version 1.2. Proto 1 or greater. +func NoEcho() Option { + return func(o *Options) error { + o.NoEcho = true + return nil + } +} + +// ReconnectWait is an Option to set the wait time between reconnect attempts. +func ReconnectWait(t time.Duration) Option { + return func(o *Options) error { + o.ReconnectWait = t + return nil + } +} + +// MaxReconnects is an Option to set the maximum number of reconnect attempts. +func MaxReconnects(max int) Option { + return func(o *Options) error { + o.MaxReconnect = max + return nil + } +} + +// PingInterval is an Option to set the period for client ping commands. +func PingInterval(t time.Duration) Option { + return func(o *Options) error { + o.PingInterval = t + return nil + } +} + +// MaxPingsOutstanding is an Option to set the maximum number of ping requests +// that can go un-answered by the server before closing the connection. +func MaxPingsOutstanding(max int) Option { + return func(o *Options) error { + o.MaxPingsOut = max + return nil + } +} + +// ReconnectBufSize sets the buffer size of messages kept while busy reconnecting. +func ReconnectBufSize(size int) Option { + return func(o *Options) error { + o.ReconnectBufSize = size + return nil + } +} + +// Timeout is an Option to set the timeout for Dial on a connection. +func Timeout(t time.Duration) Option { + return func(o *Options) error { + o.Timeout = t + return nil + } +} + +// FlusherTimeout is an Option to set the write (and flush) timeout on a connection. +func FlusherTimeout(t time.Duration) Option { + return func(o *Options) error { + o.FlusherTimeout = t + return nil + } +} + +// DrainTimeout is an Option to set the timeout for draining a connection. +func DrainTimeout(t time.Duration) Option { + return func(o *Options) error { + o.DrainTimeout = t + return nil + } +} + +// DisconnectHandler is an Option to set the disconnected handler. +func DisconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DisconnectedCB = cb + return nil + } +} + +// ReconnectHandler is an Option to set the reconnected handler. +func ReconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ReconnectedCB = cb + return nil + } +} + +// ClosedHandler is an Option to set the closed handler. +func ClosedHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ClosedCB = cb + return nil + } +} + +// DiscoveredServersHandler is an Option to set the new servers handler. +func DiscoveredServersHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DiscoveredServersCB = cb + return nil + } +} + +// ErrorHandler is an Option to set the async error handler. +func ErrorHandler(cb ErrHandler) Option { + return func(o *Options) error { + o.AsyncErrorCB = cb + return nil + } +} + +// UserInfo is an Option to set the username and password to +// use when not included directly in the URLs. +func UserInfo(user, password string) Option { + return func(o *Options) error { + o.User = user + o.Password = password + return nil + } +} + +// Token is an Option to set the token to use +// when a token is not included directly in the URLs +// and when a token handler is not provided. +func Token(token string) Option { + return func(o *Options) error { + if o.TokenHandler != nil { + return ErrTokenAlreadySet + } + o.Token = token + return nil + } +} + +// TokenHandler is an Option to set the token handler to use +// when a token is not included directly in the URLs +// and when a token is not set. +func TokenHandler(cb AuthTokenHandler) Option { + return func(o *Options) error { + if o.Token != "" { + return ErrTokenAlreadySet + } + o.TokenHandler = cb + return nil + } +} + +// UserCredentials is a convenience function that takes a filename +// for a user's JWT and a filename for the user's private Nkey seed. +func UserCredentials(userOrChainedFile string, seedFiles ...string) Option { + userCB := func() (string, error) { + return userFromFile(userOrChainedFile) + } + var keyFile string + if len(seedFiles) > 0 { + keyFile = seedFiles[0] + } else { + keyFile = userOrChainedFile + } + sigCB := func(nonce []byte) ([]byte, error) { + return sigHandler(nonce, keyFile) + } + return UserJWT(userCB, sigCB) +} + +// UserJWT will set the callbacks to retrieve the user's JWT and +// the signature callback to sign the server nonce. This an the Nkey +// option are mutually exclusive. +func UserJWT(userCB UserJWTHandler, sigCB SignatureHandler) Option { + return func(o *Options) error { + if userCB == nil { + return ErrNoUserCB + } + if sigCB == nil { + return ErrUserButNoSigCB + } + o.UserJWT = userCB + o.SignatureCB = sigCB + return nil + } +} + +// Nkey will set the public Nkey and the signature callback to +// sign the server nonce. +func Nkey(pubKey string, sigCB SignatureHandler) Option { + return func(o *Options) error { + o.Nkey = pubKey + o.SignatureCB = sigCB + if pubKey != "" && sigCB == nil { + return ErrNkeyButNoSigCB + } + return nil + } +} + +// SyncQueueLen will set the maximum queue len for the internal +// channel used for SubscribeSync(). +func SyncQueueLen(max int) Option { + return func(o *Options) error { + o.SubChanLen = max + return nil + } +} + +// Dialer is an Option to set the dialer which will be used when +// attempting to establish a connection. +// DEPRECATED: Should use CustomDialer instead. +func Dialer(dialer *net.Dialer) Option { + return func(o *Options) error { + o.Dialer = dialer + return nil + } +} + +// SetCustomDialer is an Option to set a custom dialer which will be +// used when attempting to establish a connection. If both Dialer +// and CustomDialer are specified, CustomDialer takes precedence. +func SetCustomDialer(dialer CustomDialer) Option { + return func(o *Options) error { + o.CustomDialer = dialer + return nil + } +} + +// UseOldRequestStyle is an Option to force usage of the old Request style. +func UseOldRequestStyle() Option { + return func(o *Options) error { + o.UseOldRequestStyle = true + return nil + } +} + +// Handler processing + +// SetDisconnectHandler will set the disconnect event handler. +func (nc *Conn) SetDisconnectHandler(dcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DisconnectedCB = dcb +} + +// SetReconnectHandler will set the reconnect event handler. +func (nc *Conn) SetReconnectHandler(rcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ReconnectedCB = rcb +} + +// SetDiscoveredServersHandler will set the discovered servers handler. +func (nc *Conn) SetDiscoveredServersHandler(dscb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DiscoveredServersCB = dscb +} + +// SetClosedHandler will set the reconnect event handler. +func (nc *Conn) SetClosedHandler(cb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ClosedCB = cb +} + +// SetErrorHandler will set the async error handler. +func (nc *Conn) SetErrorHandler(cb ErrHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.AsyncErrorCB = cb +} + +// Process the url string argument to Connect. +// Return an array of urls, even if only one. +func processUrlString(url string) []string { + urls := strings.Split(url, ",") + for i, s := range urls { + urls[i] = strings.TrimSpace(s) + } + return urls +} + +// Connect will attempt to connect to a NATS server with multiple options. +func (o Options) Connect() (*Conn, error) { + nc := &Conn{Opts: o} + + // Some default options processing. + if nc.Opts.MaxPingsOut == 0 { + nc.Opts.MaxPingsOut = DefaultMaxPingOut + } + // Allow old default for channel length to work correctly. + if nc.Opts.SubChanLen == 0 { + nc.Opts.SubChanLen = DefaultMaxChanLen + } + // Default ReconnectBufSize + if nc.Opts.ReconnectBufSize == 0 { + nc.Opts.ReconnectBufSize = DefaultReconnectBufSize + } + // Ensure that Timeout is not 0 + if nc.Opts.Timeout == 0 { + nc.Opts.Timeout = DefaultTimeout + } + + // Check first for user jwt callback being defined and nkey. + if nc.Opts.UserJWT != nil && nc.Opts.Nkey != "" { + return nil, ErrNkeyAndUser + } + + // Check if we have an nkey but no signature callback defined. + if nc.Opts.Nkey != "" && nc.Opts.SignatureCB == nil { + return nil, ErrNkeyButNoSigCB + } + + // Allow custom Dialer for connecting using DialTimeout by default + if nc.Opts.Dialer == nil { + nc.Opts.Dialer = &net.Dialer{ + Timeout: nc.Opts.Timeout, + } + } + + if err := nc.setupServerPool(); err != nil { + return nil, err + } + + // Create the async callback handler. + nc.ach = &asyncCallbacksHandler{} + nc.ach.cond = sync.NewCond(&nc.ach.mu) + + if err := nc.connect(); err != nil { + return nil, err + } + + // Spin up the async cb dispatcher on success + go nc.ach.asyncCBDispatcher() + + return nc, nil +} + +const ( + _CRLF_ = "\r\n" + _EMPTY_ = "" + _SPC_ = " " + _PUB_P_ = "PUB " +) + +const ( + _OK_OP_ = "+OK" + _ERR_OP_ = "-ERR" + _PONG_OP_ = "PONG" + _INFO_OP_ = "INFO" +) + +const ( + conProto = "CONNECT %s" + _CRLF_ + pingProto = "PING" + _CRLF_ + pongProto = "PONG" + _CRLF_ + subProto = "SUB %s %s %d" + _CRLF_ + unsubProto = "UNSUB %d %s" + _CRLF_ + okProto = _OK_OP_ + _CRLF_ +) + +// Return the currently selected server +func (nc *Conn) currentServer() (int, *srv) { + for i, s := range nc.srvPool { + if s == nil { + continue + } + if s == nc.current { + return i, s + } + } + return -1, nil +} + +// Pop the current server and put onto the end of the list. Select head of list as long +// as number of reconnect attempts under MaxReconnect. +func (nc *Conn) selectNextServer() (*srv, error) { + i, s := nc.currentServer() + if i < 0 { + return nil, ErrNoServers + } + sp := nc.srvPool + num := len(sp) + copy(sp[i:num-1], sp[i+1:num]) + maxReconnect := nc.Opts.MaxReconnect + if maxReconnect < 0 || s.reconnects < maxReconnect { + nc.srvPool[num-1] = s + } else { + nc.srvPool = sp[0 : num-1] + } + if len(nc.srvPool) <= 0 { + nc.current = nil + return nil, ErrNoServers + } + nc.current = nc.srvPool[0] + return nc.srvPool[0], nil +} + +// Will assign the correct server to nc.current +func (nc *Conn) pickServer() error { + nc.current = nil + if len(nc.srvPool) <= 0 { + return ErrNoServers + } + + for _, s := range nc.srvPool { + if s != nil { + nc.current = s + return nil + } + } + return ErrNoServers +} + +const tlsScheme = "tls" + +// Create the server pool using the options given. +// We will place a Url option first, followed by any +// Server Options. We will randomize the server pool unless +// the NoRandomize flag is set. +func (nc *Conn) setupServerPool() error { + nc.srvPool = make([]*srv, 0, srvPoolSize) + nc.urls = make(map[string]struct{}, srvPoolSize) + + // Create srv objects from each url string in nc.Opts.Servers + // and add them to the pool. + for _, urlString := range nc.Opts.Servers { + if err := nc.addURLToPool(urlString, false, false); err != nil { + return err + } + } + + // Randomize if allowed to + if !nc.Opts.NoRandomize { + nc.shufflePool() + } + + // Normally, if this one is set, Options.Servers should not be, + // but we always allowed that, so continue to do so. + if nc.Opts.Url != _EMPTY_ { + // Add to the end of the array + if err := nc.addURLToPool(nc.Opts.Url, false, false); err != nil { + return err + } + // Then swap it with first to guarantee that Options.Url is tried first. + last := len(nc.srvPool) - 1 + if last > 0 { + nc.srvPool[0], nc.srvPool[last] = nc.srvPool[last], nc.srvPool[0] + } + } else if len(nc.srvPool) <= 0 { + // Place default URL if pool is empty. + if err := nc.addURLToPool(DefaultURL, false, false); err != nil { + return err + } + } + + // Check for Scheme hint to move to TLS mode. + for _, srv := range nc.srvPool { + if srv.url.Scheme == tlsScheme { + // FIXME(dlc), this is for all in the pool, should be case by case. + nc.Opts.Secure = true + if nc.Opts.TLSConfig == nil { + nc.Opts.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + } + } + + return nc.pickServer() +} + +// Helper function to return scheme +func (nc *Conn) connScheme() string { + if nc.Opts.Secure { + return tlsScheme + } + return "nats" +} + +// Return true iff u.Hostname() is an IP address. +func hostIsIP(u *url.URL) bool { + return net.ParseIP(u.Hostname()) != nil +} + +// addURLToPool adds an entry to the server pool +func (nc *Conn) addURLToPool(sURL string, implicit, saveTLSName bool) error { + if !strings.Contains(sURL, "://") { + sURL = fmt.Sprintf("%s://%s", nc.connScheme(), sURL) + } + var ( + u *url.URL + err error + ) + for i := 0; i < 2; i++ { + u, err = url.Parse(sURL) + if err != nil { + return err + } + if u.Port() != "" { + break + } + // In case given URL is of the form "localhost:", just add + // the port number at the end, otherwise, add ":4222". + if sURL[len(sURL)-1] != ':' { + sURL += ":" + } + sURL += defaultPortString + } + + var tlsName string + if implicit { + curl := nc.current.url + // Check to see if we do not have a url.User but current connected + // url does. If so copy over. + if u.User == nil && curl.User != nil { + u.User = curl.User + } + // We are checking to see if we have a secure connection and are + // adding an implicit server that just has an IP. If so we will remember + // the current hostname we are connected to. + if saveTLSName && hostIsIP(u) { + tlsName = curl.Hostname() + } + } + + s := &srv{url: u, isImplicit: implicit, tlsName: tlsName} + nc.srvPool = append(nc.srvPool, s) + nc.urls[u.Host] = struct{}{} + return nil +} + +// shufflePool swaps randomly elements in the server pool +func (nc *Conn) shufflePool() { + if len(nc.srvPool) <= 1 { + return + } + source := rand.NewSource(time.Now().UnixNano()) + r := rand.New(source) + for i := range nc.srvPool { + j := r.Intn(i + 1) + nc.srvPool[i], nc.srvPool[j] = nc.srvPool[j], nc.srvPool[i] + } +} + +func (nc *Conn) newBuffer() *bufio.Writer { + var w io.Writer = nc.conn + if nc.Opts.FlusherTimeout > 0 { + w = &timeoutWriter{conn: nc.conn, timeout: nc.Opts.FlusherTimeout} + } + return bufio.NewWriterSize(w, defaultBufSize) +} + +// createConn will connect to the server and wrap the appropriate +// bufio structures. It will do the right thing when an existing +// connection is in place. +func (nc *Conn) createConn() (err error) { + if nc.Opts.Timeout < 0 { + return ErrBadTimeout + } + if _, cur := nc.currentServer(); cur == nil { + return ErrNoServers + } else { + cur.lastAttempt = time.Now() + } + + // We will auto-expand host names if they resolve to multiple IPs + hosts := map[string]struct{}{} + u := nc.current.url + + if net.ParseIP(u.Hostname()) == nil { + addrs, _ := net.LookupHost(u.Hostname()) + for _, addr := range addrs { + hosts[net.JoinHostPort(addr, u.Port())] = struct{}{} + } + } + // Fall back to what we were given. + if len(hosts) == 0 { + hosts[u.Host] = struct{}{} + } + + // CustomDialer takes precedence. If not set, use Opts.Dialer which + // is set to a default *net.Dialer (in Connect()) if not explicitly + // set by the user. + dialer := nc.Opts.CustomDialer + if dialer == nil { + // We will copy and shorten the timeout if we have multiple hosts to try. + copyDialer := *nc.Opts.Dialer + copyDialer.Timeout = copyDialer.Timeout / time.Duration(len(hosts)) + dialer = ©Dialer + } + + for host := range hosts { + nc.conn, err = dialer.Dial("tcp", host) + if err == nil { + break + } + } + if err != nil { + return err + } + + // No clue why, but this stalls and kills performance on Mac (Mavericks). + // https://code.google.com/p/go/issues/detail?id=6930 + //if ip, ok := nc.conn.(*net.TCPConn); ok { + // ip.SetReadBuffer(defaultBufSize) + //} + + if nc.pending != nil && nc.bw != nil { + // Move to pending buffer. + nc.bw.Flush() + } + nc.bw = nc.newBuffer() + return nil +} + +// makeTLSConn will wrap an existing Conn using TLS +func (nc *Conn) makeTLSConn() error { + // Allow the user to configure their own tls.Config structure. + var tlsCopy *tls.Config + if nc.Opts.TLSConfig != nil { + tlsCopy = util.CloneTLSConfig(nc.Opts.TLSConfig) + } else { + tlsCopy = &tls.Config{} + } + // If its blank we will override it with the current host + if tlsCopy.ServerName == _EMPTY_ { + if nc.current.tlsName != _EMPTY_ { + tlsCopy.ServerName = nc.current.tlsName + } else { + h, _, _ := net.SplitHostPort(nc.current.url.Host) + tlsCopy.ServerName = h + } + } + nc.conn = tls.Client(nc.conn, tlsCopy) + conn := nc.conn.(*tls.Conn) + if err := conn.Handshake(); err != nil { + return err + } + nc.bw = nc.newBuffer() + return nil +} + +// waitForExits will wait for all socket watcher Go routines to +// be shutdown before proceeding. +func (nc *Conn) waitForExits() { + // Kick old flusher forcefully. + select { + case nc.fch <- struct{}{}: + default: + } + + // Wait for any previous go routines. + nc.wg.Wait() +} + +// Report the connected server's Url +func (nc *Conn) ConnectedUrl() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.current.url.String() +} + +// ConnectedAddr returns the connected server's IP +func (nc *Conn) ConnectedAddr() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.conn.RemoteAddr().String() +} + +// Report the connected server's Id +func (nc *Conn) ConnectedServerId() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.info.Id +} + +// Low level setup for structs, etc +func (nc *Conn) setup() { + nc.subs = make(map[int64]*Subscription) + nc.pongs = make([]chan struct{}, 0, 8) + + nc.fch = make(chan struct{}, flushChanSize) + + // Setup scratch outbound buffer for PUB + pub := nc.scratch[:len(_PUB_P_)] + copy(pub, _PUB_P_) +} + +// Process a connected connection and initialize properly. +func (nc *Conn) processConnectInit() error { + + // Set our deadline for the whole connect process + nc.conn.SetDeadline(time.Now().Add(nc.Opts.Timeout)) + defer nc.conn.SetDeadline(time.Time{}) + + // Set our status to connecting. + nc.status = CONNECTING + + // Process the INFO protocol received from the server + err := nc.processExpectedInfo() + if err != nil { + return err + } + + // Send the CONNECT protocol along with the initial PING protocol. + // Wait for the PONG response (or any error that we get from the server). + err = nc.sendConnect() + if err != nil { + return err + } + + // Reset the number of PING sent out + nc.pout = 0 + + // Start or reset Timer + if nc.Opts.PingInterval > 0 { + if nc.ptmr == nil { + nc.ptmr = time.AfterFunc(nc.Opts.PingInterval, nc.processPingTimer) + } else { + nc.ptmr.Reset(nc.Opts.PingInterval) + } + } + + // Start the readLoop and flusher go routines, we will wait on both on a reconnect event. + nc.wg.Add(2) + go nc.readLoop() + go nc.flusher() + + return nil +} + +// Main connect function. Will connect to the nats-server +func (nc *Conn) connect() error { + var returnedErr error + + // Create actual socket connection + // For first connect we walk all servers in the pool and try + // to connect immediately. + nc.mu.Lock() + nc.initc = true + // The pool may change inside the loop iteration due to INFO protocol. + for i := 0; i < len(nc.srvPool); i++ { + nc.current = nc.srvPool[i] + + if err := nc.createConn(); err == nil { + // This was moved out of processConnectInit() because + // that function is now invoked from doReconnect() too. + nc.setup() + + err = nc.processConnectInit() + + if err == nil { + nc.srvPool[i].didConnect = true + nc.srvPool[i].reconnects = 0 + returnedErr = nil + break + } else { + returnedErr = err + nc.mu.Unlock() + nc.close(DISCONNECTED, false) + nc.mu.Lock() + nc.current = nil + } + } else { + // Cancel out default connection refused, will trigger the + // No servers error conditional + if strings.Contains(err.Error(), "connection refused") { + returnedErr = nil + } + } + } + nc.initc = false + defer nc.mu.Unlock() + + if returnedErr == nil && nc.status != CONNECTED { + returnedErr = ErrNoServers + } + return returnedErr +} + +// This will check to see if the connection should be +// secure. This can be dictated from either end and should +// only be called after the INIT protocol has been received. +func (nc *Conn) checkForSecure() error { + // Check to see if we need to engage TLS + o := nc.Opts + + // Check for mismatch in setups + if o.Secure && !nc.info.TLSRequired { + return ErrSecureConnWanted + } else if nc.info.TLSRequired && !o.Secure { + // Switch to Secure since server needs TLS. + o.Secure = true + } + + // Need to rewrap with bufio + if o.Secure { + if err := nc.makeTLSConn(); err != nil { + return err + } + } + return nil +} + +// processExpectedInfo will look for the expected first INFO message +// sent when a connection is established. The lock should be held entering. +func (nc *Conn) processExpectedInfo() error { + + c := &control{} + + // Read the protocol + err := nc.readOp(c) + if err != nil { + return err + } + + // The nats protocol should send INFO first always. + if c.op != _INFO_OP_ { + return ErrNoInfoReceived + } + + // Parse the protocol + if err := nc.processInfo(c.args); err != nil { + return err + } + + if nc.Opts.Nkey != "" && nc.info.Nonce == "" { + return ErrNkeysNotSupported + } + + return nc.checkForSecure() +} + +// Sends a protocol control message by queuing into the bufio writer +// and kicking the flush Go routine. These writes are protected. +func (nc *Conn) sendProto(proto string) { + nc.mu.Lock() + nc.bw.WriteString(proto) + nc.kickFlusher() + nc.mu.Unlock() +} + +// Generate a connect protocol message, issuing user/password if +// applicable. The lock is assumed to be held upon entering. +func (nc *Conn) connectProto() (string, error) { + o := nc.Opts + var nkey, sig, user, pass, token, ujwt string + u := nc.current.url.User + if u != nil { + // if no password, assume username is authToken + if _, ok := u.Password(); !ok { + token = u.Username() + } else { + user = u.Username() + pass, _ = u.Password() + } + } else { + // Take from options (possibly all empty strings) + user = o.User + pass = o.Password + token = o.Token + nkey = o.Nkey + } + + // Look for user jwt. + if o.UserJWT != nil { + if jwt, err := o.UserJWT(); err != nil { + return _EMPTY_, err + } else { + ujwt = jwt + } + if nkey != _EMPTY_ { + return _EMPTY_, ErrNkeyAndUser + } + } + + if ujwt != _EMPTY_ || nkey != _EMPTY_ { + if o.SignatureCB == nil { + if ujwt == _EMPTY_ { + return _EMPTY_, ErrNkeyButNoSigCB + } + return _EMPTY_, ErrUserButNoSigCB + } + sigraw, err := o.SignatureCB([]byte(nc.info.Nonce)) + if err != nil { + return _EMPTY_, err + } + sig = base64.RawURLEncoding.EncodeToString(sigraw) + } + + if nc.Opts.TokenHandler != nil { + if token != _EMPTY_ { + return _EMPTY_, ErrTokenAlreadySet + } + token = nc.Opts.TokenHandler() + } + + cinfo := connectInfo{o.Verbose, o.Pedantic, ujwt, nkey, sig, user, pass, token, + o.Secure, o.Name, LangString, Version, clientProtoInfo, !o.NoEcho} + + b, err := json.Marshal(cinfo) + if err != nil { + return _EMPTY_, ErrJsonParse + } + + // Check if NoEcho is set and we have a server that supports it. + if o.NoEcho && nc.info.Proto < 1 { + return _EMPTY_, ErrNoEchoNotSupported + } + + return fmt.Sprintf(conProto, b), nil +} + +// normalizeErr removes the prefix -ERR, trim spaces and remove the quotes. +func normalizeErr(line string) string { + s := strings.TrimSpace(strings.TrimPrefix(line, _ERR_OP_)) + s = strings.TrimLeft(strings.TrimRight(s, "'"), "'") + return s +} + +// Send a connect protocol message to the server, issue user/password if +// applicable. Will wait for a flush to return from the server for error +// processing. +func (nc *Conn) sendConnect() error { + + // Construct the CONNECT protocol string + cProto, err := nc.connectProto() + if err != nil { + return err + } + + // Write the protocol into the buffer + _, err = nc.bw.WriteString(cProto) + if err != nil { + return err + } + + // Add to the buffer the PING protocol + _, err = nc.bw.WriteString(pingProto) + if err != nil { + return err + } + + // Flush the buffer + err = nc.bw.Flush() + if err != nil { + return err + } + + // We don't want to read more than we need here, otherwise + // we would need to transfer the excess read data to the readLoop. + // Since in normal situations we just are looking for a PONG\r\n, + // reading byte-by-byte here is ok. + proto, err := nc.readProto() + if err != nil { + return err + } + + // If opts.Verbose is set, handle +OK + if nc.Opts.Verbose && proto == okProto { + // Read the rest now... + proto, err = nc.readProto() + if err != nil { + return err + } + } + + // We expect a PONG + if proto != pongProto { + // But it could be something else, like -ERR + + // Since we no longer use ReadLine(), trim the trailing "\r\n" + proto = strings.TrimRight(proto, "\r\n") + + // If it's a server error... + if strings.HasPrefix(proto, _ERR_OP_) { + // Remove -ERR, trim spaces and quotes, and convert to lower case. + proto = normalizeErr(proto) + return errors.New("nats: " + proto) + } + + // Notify that we got an unexpected protocol. + return fmt.Errorf("nats: expected '%s', got '%s'", _PONG_OP_, proto) + } + + // This is where we are truly connected. + nc.status = CONNECTED + + return nil +} + +// reads a protocol one byte at a time. +func (nc *Conn) readProto() (string, error) { + var ( + _buf = [10]byte{} + buf = _buf[:0] + b = [1]byte{} + protoEnd = byte('\n') + ) + for { + if _, err := nc.conn.Read(b[:1]); err != nil { + // Do not report EOF error + if err == io.EOF { + return string(buf), nil + } + return "", err + } + buf = append(buf, b[0]) + if b[0] == protoEnd { + return string(buf), nil + } + } +} + +// A control protocol line. +type control struct { + op, args string +} + +// Read a control line and process the intended op. +func (nc *Conn) readOp(c *control) error { + br := bufio.NewReaderSize(nc.conn, defaultBufSize) + line, err := br.ReadString('\n') + if err != nil { + return err + } + parseControl(line, c) + return nil +} + +// Parse a control line from the server. +func parseControl(line string, c *control) { + toks := strings.SplitN(line, _SPC_, 2) + if len(toks) == 1 { + c.op = strings.TrimSpace(toks[0]) + c.args = _EMPTY_ + } else if len(toks) == 2 { + c.op, c.args = strings.TrimSpace(toks[0]), strings.TrimSpace(toks[1]) + } else { + c.op = _EMPTY_ + } +} + +// flushReconnectPending will push the pending items that were +// gathered while we were in a RECONNECTING state to the socket. +func (nc *Conn) flushReconnectPendingItems() { + if nc.pending == nil { + return + } + if nc.pending.Len() > 0 { + nc.bw.Write(nc.pending.Bytes()) + } +} + +// Stops the ping timer if set. +// Connection lock is held on entry. +func (nc *Conn) stopPingTimer() { + if nc.ptmr != nil { + nc.ptmr.Stop() + } +} + +// Try to reconnect using the option parameters. +// This function assumes we are allowed to reconnect. +func (nc *Conn) doReconnect() { + // We want to make sure we have the other watchers shutdown properly + // here before we proceed past this point. + nc.waitForExits() + + // FIXME(dlc) - We have an issue here if we have + // outstanding flush points (pongs) and they were not + // sent out, but are still in the pipe. + + // Hold the lock manually and release where needed below, + // can't do defer here. + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any errors. + nc.err = nil + // Perform appropriate callback if needed for a disconnect. + if nc.Opts.DisconnectedCB != nil { + nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) }) + } + + // This is used to wait on go routines exit if we start them in the loop + // but an error occurs after that. + waitForGoRoutines := false + + for len(nc.srvPool) > 0 { + cur, err := nc.selectNextServer() + if err != nil { + nc.err = err + break + } + + sleepTime := int64(0) + + // Sleep appropriate amount of time before the + // connection attempt if connecting to same server + // we just got disconnected from.. + if time.Since(cur.lastAttempt) < nc.Opts.ReconnectWait { + sleepTime = int64(nc.Opts.ReconnectWait - time.Since(cur.lastAttempt)) + } + + // On Windows, createConn() will take more than a second when no + // server is running at that address. So it could be that the + // time elapsed between reconnect attempts is always > than + // the set option. Release the lock to give a chance to a parallel + // nc.Close() to break the loop. + nc.mu.Unlock() + if sleepTime <= 0 { + runtime.Gosched() + } else { + time.Sleep(time.Duration(sleepTime)) + } + // If the readLoop, etc.. go routines were started, wait for them to complete. + if waitForGoRoutines { + nc.waitForExits() + waitForGoRoutines = false + } + nc.mu.Lock() + + // Check if we have been closed first. + if nc.isClosed() { + break + } + + // Mark that we tried a reconnect + cur.reconnects++ + + // Try to create a new connection + err = nc.createConn() + + // Not yet connected, retry... + // Continue to hold the lock + if err != nil { + nc.err = nil + continue + } + + // We are reconnected + nc.Reconnects++ + + // Process connect logic + if nc.err = nc.processConnectInit(); nc.err != nil { + nc.status = RECONNECTING + // Reset the buffered writer to the pending buffer + // (was set to a buffered writer on nc.conn in createConn) + nc.bw.Reset(nc.pending) + continue + } + + // Clear out server stats for the server we connected to.. + cur.didConnect = true + cur.reconnects = 0 + + // Send existing subscription state + nc.resendSubscriptions() + + // Now send off and clear pending buffer + nc.flushReconnectPendingItems() + + // Flush the buffer + nc.err = nc.bw.Flush() + if nc.err != nil { + nc.status = RECONNECTING + // Reset the buffered writer to the pending buffer (bytes.Buffer). + nc.bw.Reset(nc.pending) + // Stop the ping timer (if set) + nc.stopPingTimer() + // Since processConnectInit() returned without error, the + // go routines were started, so wait for them to return + // on the next iteration (after releasing the lock). + waitForGoRoutines = true + continue + } + + // Done with the pending buffer + nc.pending = nil + + // This is where we are truly connected. + nc.status = CONNECTED + + // Queue up the reconnect callback. + if nc.Opts.ReconnectedCB != nil { + nc.ach.push(func() { nc.Opts.ReconnectedCB(nc) }) + } + // Release lock here, we will return below. + nc.mu.Unlock() + + // Make sure to flush everything + nc.Flush() + + return + } + + // Call into close.. We have no servers left.. + if nc.err == nil { + nc.err = ErrNoServers + } + nc.mu.Unlock() + nc.Close() +} + +// processOpErr handles errors from reading or parsing the protocol. +// The lock should not be held entering this function. +func (nc *Conn) processOpErr(err error) { + nc.mu.Lock() + if nc.isConnecting() || nc.isClosed() || nc.isReconnecting() { + nc.mu.Unlock() + return + } + + if nc.Opts.AllowReconnect && nc.status == CONNECTED { + // Set our new status + nc.status = RECONNECTING + // Stop ping timer if set + nc.stopPingTimer() + if nc.conn != nil { + nc.bw.Flush() + nc.conn.Close() + nc.conn = nil + } + + // Create pending buffer before reconnecting. + nc.pending = new(bytes.Buffer) + nc.bw.Reset(nc.pending) + + go nc.doReconnect() + nc.mu.Unlock() + return + } + + nc.status = DISCONNECTED + nc.err = err + nc.mu.Unlock() + nc.Close() +} + +// dispatch is responsible for calling any async callbacks +func (ac *asyncCallbacksHandler) asyncCBDispatcher() { + for { + ac.mu.Lock() + // Protect for spurious wakeups. We should get out of the + // wait only if there is an element to pop from the list. + for ac.head == nil { + ac.cond.Wait() + } + cur := ac.head + ac.head = cur.next + if cur == ac.tail { + ac.tail = nil + } + ac.mu.Unlock() + + // This signals that the dispatcher has been closed and all + // previous callbacks have been dispatched. + if cur.f == nil { + return + } + // Invoke callback outside of handler's lock + cur.f() + } +} + +// Add the given function to the tail of the list and +// signals the dispatcher. +func (ac *asyncCallbacksHandler) push(f func()) { + ac.pushOrClose(f, false) +} + +// Signals that we are closing... +func (ac *asyncCallbacksHandler) close() { + ac.pushOrClose(nil, true) +} + +// Add the given function to the tail of the list and +// signals the dispatcher. +func (ac *asyncCallbacksHandler) pushOrClose(f func(), close bool) { + ac.mu.Lock() + defer ac.mu.Unlock() + // Make sure that library is not calling push with nil function, + // since this is used to notify the dispatcher that it should stop. + if !close && f == nil { + panic("pushing a nil callback") + } + cb := &asyncCB{f: f} + if ac.tail != nil { + ac.tail.next = cb + } else { + ac.head = cb + } + ac.tail = cb + if close { + ac.cond.Broadcast() + } else { + ac.cond.Signal() + } +} + +// readLoop() will sit on the socket reading and processing the +// protocol from the server. It will dispatch appropriately based +// on the op type. +func (nc *Conn) readLoop() { + // Release the wait group on exit + defer nc.wg.Done() + + // Create a parseState if needed. + nc.mu.Lock() + if nc.ps == nil { + nc.ps = &parseState{} + } + nc.mu.Unlock() + + // Stack based buffer. + b := make([]byte, defaultBufSize) + + for { + // FIXME(dlc): RWLock here? + nc.mu.Lock() + sb := nc.isClosed() || nc.isReconnecting() + if sb { + nc.ps = &parseState{} + } + conn := nc.conn + nc.mu.Unlock() + + if sb || conn == nil { + break + } + + n, err := conn.Read(b) + if err != nil { + nc.processOpErr(err) + break + } + if err := nc.parse(b[:n]); err != nil { + nc.processOpErr(err) + break + } + } + // Clear the parseState here.. + nc.mu.Lock() + nc.ps = nil + nc.mu.Unlock() +} + +// waitForMsgs waits on the conditional shared with readLoop and processMsg. +// It is used to deliver messages to asynchronous subscribers. +func (nc *Conn) waitForMsgs(s *Subscription) { + var closed bool + var delivered, max uint64 + + // Used to account for adjustments to sub.pBytes when we wrap back around. + msgLen := -1 + + for { + s.mu.Lock() + // Do accounting for last msg delivered here so we only lock once + // and drain state trips after callback has returned. + if msgLen >= 0 { + s.pMsgs-- + s.pBytes -= msgLen + msgLen = -1 + } + + if s.pHead == nil && !s.closed { + s.pCond.Wait() + } + // Pop the msg off the list + m := s.pHead + if m != nil { + s.pHead = m.next + if s.pHead == nil { + s.pTail = nil + } + if m.barrier != nil { + s.mu.Unlock() + if atomic.AddInt64(&m.barrier.refs, -1) == 0 { + m.barrier.f() + } + continue + } + msgLen = len(m.Data) + } + mcb := s.mcb + max = s.max + closed = s.closed + if !s.closed { + s.delivered++ + delivered = s.delivered + } + s.mu.Unlock() + + if closed { + break + } + + // Deliver the message. + if m != nil && (max == 0 || delivered <= max) { + mcb(m) + } + // If we have hit the max for delivered msgs, remove sub. + if max > 0 && delivered >= max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + break + } + } + // Check for barrier messages + s.mu.Lock() + for m := s.pHead; m != nil; m = s.pHead { + if m.barrier != nil { + s.mu.Unlock() + if atomic.AddInt64(&m.barrier.refs, -1) == 0 { + m.barrier.f() + } + s.mu.Lock() + } + s.pHead = m.next + } + s.mu.Unlock() +} + +// processMsg is called by parse and will place the msg on the +// appropriate channel/pending queue for processing. If the channel is full, +// or the pending queue is over the pending limits, the connection is +// considered a slow consumer. +func (nc *Conn) processMsg(data []byte) { + // Don't lock the connection to avoid server cutting us off if the + // flusher is holding the connection lock, trying to send to the server + // that is itself trying to send data to us. + nc.subsMu.RLock() + + // Stats + nc.InMsgs++ + nc.InBytes += uint64(len(data)) + + sub := nc.subs[nc.ps.ma.sid] + if sub == nil { + nc.subsMu.RUnlock() + return + } + + // Copy them into string + subj := string(nc.ps.ma.subject) + reply := string(nc.ps.ma.reply) + + // Doing message create outside of the sub's lock to reduce contention. + // It's possible that we end-up not using the message, but that's ok. + + // FIXME(dlc): Need to copy, should/can do COW? + msgPayload := make([]byte, len(data)) + copy(msgPayload, data) + + // FIXME(dlc): Should we recycle these containers? + m := &Msg{Data: msgPayload, Subject: subj, Reply: reply, Sub: sub} + + sub.mu.Lock() + + // Subscription internal stats (applicable only for non ChanSubscription's) + if sub.typ != ChanSubscription { + sub.pMsgs++ + if sub.pMsgs > sub.pMsgsMax { + sub.pMsgsMax = sub.pMsgs + } + sub.pBytes += len(m.Data) + if sub.pBytes > sub.pBytesMax { + sub.pBytesMax = sub.pBytes + } + + // Check for a Slow Consumer + if (sub.pMsgsLimit > 0 && sub.pMsgs > sub.pMsgsLimit) || + (sub.pBytesLimit > 0 && sub.pBytes > sub.pBytesLimit) { + goto slowConsumer + } + } + + // We have two modes of delivery. One is the channel, used by channel + // subscribers and syncSubscribers, the other is a linked list for async. + if sub.mch != nil { + select { + case sub.mch <- m: + default: + goto slowConsumer + } + } else { + // Push onto the async pList + if sub.pHead == nil { + sub.pHead = m + sub.pTail = m + sub.pCond.Signal() + } else { + sub.pTail.next = m + sub.pTail = m + } + } + + // Clear SlowConsumer status. + sub.sc = false + + sub.mu.Unlock() + nc.subsMu.RUnlock() + return + +slowConsumer: + sub.dropped++ + sc := !sub.sc + sub.sc = true + // Undo stats from above + if sub.typ != ChanSubscription { + sub.pMsgs-- + sub.pBytes -= len(m.Data) + } + sub.mu.Unlock() + nc.subsMu.RUnlock() + if sc { + // Now we need connection's lock and we may end-up in the situation + // that we were trying to avoid, except that in this case, the client + // is already experiencing client-side slow consumer situation. + nc.mu.Lock() + nc.err = ErrSlowConsumer + if nc.Opts.AsyncErrorCB != nil { + nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, sub, ErrSlowConsumer) }) + } + nc.mu.Unlock() + } +} + +// processPermissionsViolation is called when the server signals a subject +// permissions violation on either publish or subscribe. +func (nc *Conn) processPermissionsViolation(err string) { + nc.mu.Lock() + // create error here so we can pass it as a closure to the async cb dispatcher. + e := errors.New("nats: " + err) + nc.err = e + if nc.Opts.AsyncErrorCB != nil { + nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, e) }) + } + nc.mu.Unlock() +} + +// processAuthorizationViolation is called when the server signals a user +// authorization violation. +func (nc *Conn) processAuthorizationViolation(err string) { + nc.mu.Lock() + nc.err = ErrAuthorization + if nc.Opts.AsyncErrorCB != nil { + nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, ErrAuthorization) }) + } + nc.mu.Unlock() +} + +// flusher is a separate Go routine that will process flush requests for the write +// bufio. This allows coalescing of writes to the underlying socket. +func (nc *Conn) flusher() { + // Release the wait group + defer nc.wg.Done() + + // snapshot the bw and conn since they can change from underneath of us. + nc.mu.Lock() + bw := nc.bw + conn := nc.conn + fch := nc.fch + nc.mu.Unlock() + + if conn == nil || bw == nil { + return + } + + for { + if _, ok := <-fch; !ok { + return + } + nc.mu.Lock() + + // Check to see if we should bail out. + if !nc.isConnected() || nc.isConnecting() || bw != nc.bw || conn != nc.conn { + nc.mu.Unlock() + return + } + if bw.Buffered() > 0 { + if err := bw.Flush(); err != nil { + if nc.err == nil { + nc.err = err + } + } + } + nc.mu.Unlock() + } +} + +// processPing will send an immediate pong protocol response to the +// server. The server uses this mechanism to detect dead clients. +func (nc *Conn) processPing() { + nc.sendProto(pongProto) +} + +// processPong is used to process responses to the client's ping +// messages. We use pings for the flush mechanism as well. +func (nc *Conn) processPong() { + var ch chan struct{} + + nc.mu.Lock() + if len(nc.pongs) > 0 { + ch = nc.pongs[0] + nc.pongs = nc.pongs[1:] + } + nc.pout = 0 + nc.mu.Unlock() + if ch != nil { + ch <- struct{}{} + } +} + +// processOK is a placeholder for processing OK messages. +func (nc *Conn) processOK() { + // do nothing +} + +// processInfo is used to parse the info messages sent +// from the server. +// This function may update the server pool. +func (nc *Conn) processInfo(info string) error { + if info == _EMPTY_ { + return nil + } + ncInfo := serverInfo{} + if err := json.Unmarshal([]byte(info), &ncInfo); err != nil { + return err + } + // Copy content into connection's info structure. + nc.info = ncInfo + // The array could be empty/not present on initial connect, + // if advertise is disabled on that server, or servers that + // did not include themselves in the async INFO protocol. + // If empty, do not remove the implicit servers from the pool. + if len(ncInfo.ConnectURLs) == 0 { + return nil + } + // Note about pool randomization: when the pool was first created, + // it was randomized (if allowed). We keep the order the same (removing + // implicit servers that are no longer sent to us). New URLs are sent + // to us in no specific order so don't need extra randomization. + hasNew := false + // This is what we got from the server we are connected to. + urls := nc.info.ConnectURLs + // Transform that to a map for easy lookups + tmp := make(map[string]struct{}, len(urls)) + for _, curl := range urls { + tmp[curl] = struct{}{} + } + // Walk the pool and removed the implicit servers that are no longer in the + // given array/map + sp := nc.srvPool + for i := 0; i < len(sp); i++ { + srv := sp[i] + curl := srv.url.Host + // Check if this URL is in the INFO protocol + _, inInfo := tmp[curl] + // Remove from the temp map so that at the end we are left with only + // new (or restarted) servers that need to be added to the pool. + delete(tmp, curl) + // Keep servers that were set through Options, but also the one that + // we are currently connected to (even if it is a discovered server). + if !srv.isImplicit || srv.url == nc.current.url { + continue + } + if !inInfo { + // Remove from server pool. Keep current order. + copy(sp[i:], sp[i+1:]) + nc.srvPool = sp[:len(sp)-1] + sp = nc.srvPool + i-- + } + } + // Figure out if we should save off the current non-IP hostname if we encounter a bare IP. + var saveTLS bool + if nc.current != nil && nc.Opts.Secure && !hostIsIP(nc.current.url) { + saveTLS = true + } + // If there are any left in the tmp map, these are new (or restarted) servers + // and need to be added to the pool. + for curl := range tmp { + // Before adding, check if this is a new (as in never seen) URL. + // This is used to figure out if we invoke the DiscoveredServersCB + if _, present := nc.urls[curl]; !present { + hasNew = true + } + nc.addURLToPool(fmt.Sprintf("%s://%s", nc.connScheme(), curl), true, saveTLS) + } + if hasNew && !nc.initc && nc.Opts.DiscoveredServersCB != nil { + nc.ach.push(func() { nc.Opts.DiscoveredServersCB(nc) }) + } + + return nil +} + +// processAsyncInfo does the same than processInfo, but is called +// from the parser. Calls processInfo under connection's lock +// protection. +func (nc *Conn) processAsyncInfo(info []byte) { + nc.mu.Lock() + // Ignore errors, we will simply not update the server pool... + nc.processInfo(string(info)) + nc.mu.Unlock() +} + +// LastError reports the last error encountered via the connection. +// It can be used reliably within ClosedCB in order to find out reason +// why connection was closed for example. +func (nc *Conn) LastError() error { + if nc == nil { + return ErrInvalidConnection + } + nc.mu.Lock() + err := nc.err + nc.mu.Unlock() + return err +} + +// processErr processes any error messages from the server and +// sets the connection's lastError. +func (nc *Conn) processErr(ie string) { + // Trim, remove quotes + ne := normalizeErr(ie) + // convert to lower case. + e := strings.ToLower(ne) + + // FIXME(dlc) - process Slow Consumer signals special. + if e == STALE_CONNECTION { + nc.processOpErr(ErrStaleConnection) + } else if strings.HasPrefix(e, PERMISSIONS_ERR) { + nc.processPermissionsViolation(ne) + } else if strings.HasPrefix(e, AUTHORIZATION_ERR) { + nc.processAuthorizationViolation(ne) + } else { + nc.mu.Lock() + nc.err = errors.New("nats: " + ne) + nc.mu.Unlock() + nc.Close() + } +} + +// kickFlusher will send a bool on a channel to kick the +// flush Go routine to flush data to the server. +func (nc *Conn) kickFlusher() { + if nc.bw != nil { + select { + case nc.fch <- struct{}{}: + default: + } + } +} + +// Publish publishes the data argument to the given subject. The data +// argument is left untouched and needs to be correctly interpreted on +// the receiver. +func (nc *Conn) Publish(subj string, data []byte) error { + return nc.publish(subj, _EMPTY_, data) +} + +// PublishMsg publishes the Msg structure, which includes the +// Subject, an optional Reply and an optional Data field. +func (nc *Conn) PublishMsg(m *Msg) error { + if m == nil { + return ErrInvalidMsg + } + return nc.publish(m.Subject, m.Reply, m.Data) +} + +// PublishRequest will perform a Publish() excpecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (nc *Conn) PublishRequest(subj, reply string, data []byte) error { + return nc.publish(subj, reply, data) +} + +// Used for handrolled itoa +const digits = "0123456789" + +// publish is the internal function to publish messages to a nats-server. +// Sends a protocol data message by queuing into the bufio writer +// and kicking the flush go routine. These writes should be protected. +func (nc *Conn) publish(subj, reply string, data []byte) error { + if nc == nil { + return ErrInvalidConnection + } + if subj == "" { + return ErrBadSubject + } + nc.mu.Lock() + + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + + if nc.isDrainingPubs() { + nc.mu.Unlock() + return ErrConnectionDraining + } + + // Proactively reject payloads over the threshold set by server. + msgSize := int64(len(data)) + if msgSize > nc.info.MaxPayload { + nc.mu.Unlock() + return ErrMaxPayload + } + + // Check if we are reconnecting, and if so check if + // we have exceeded our reconnect outbound buffer limits. + if nc.isReconnecting() { + // Flush to underlying buffer. + nc.bw.Flush() + // Check if we are over + if nc.pending.Len() >= nc.Opts.ReconnectBufSize { + nc.mu.Unlock() + return ErrReconnectBufExceeded + } + } + + msgh := nc.scratch[:len(_PUB_P_)] + msgh = append(msgh, subj...) + msgh = append(msgh, ' ') + if reply != "" { + msgh = append(msgh, reply...) + msgh = append(msgh, ' ') + } + + // We could be smarter here, but simple loop is ok, + // just avoid strconv in fast path + // FIXME(dlc) - Find a better way here. + // msgh = strconv.AppendInt(msgh, int64(len(data)), 10) + + var b [12]byte + var i = len(b) + if len(data) > 0 { + for l := len(data); l > 0; l /= 10 { + i -= 1 + b[i] = digits[l%10] + } + } else { + i -= 1 + b[i] = digits[0] + } + + msgh = append(msgh, b[i:]...) + msgh = append(msgh, _CRLF_...) + + _, err := nc.bw.Write(msgh) + if err == nil { + _, err = nc.bw.Write(data) + } + if err == nil { + _, err = nc.bw.WriteString(_CRLF_) + } + if err != nil { + nc.mu.Unlock() + return err + } + + nc.OutMsgs++ + nc.OutBytes += uint64(len(data)) + + if len(nc.fch) == 0 { + nc.kickFlusher() + } + nc.mu.Unlock() + return nil +} + +// respHandler is the global response handler. It will look up +// the appropriate channel based on the last token and place +// the message on the channel if possible. +func (nc *Conn) respHandler(m *Msg) { + rt := respToken(m.Subject) + + nc.mu.Lock() + // Just return if closed. + if nc.isClosed() { + nc.mu.Unlock() + return + } + + // Grab mch + mch := nc.respMap[rt] + // Delete the key regardless, one response only. + // FIXME(dlc) - should we track responses past 1 + // just statistics wise? + delete(nc.respMap, rt) + nc.mu.Unlock() + + // Don't block, let Request timeout instead, mch is + // buffered and we should delete the key before a + // second response is processed. + select { + case mch <- m: + default: + return + } +} + +// Create the response subscription we will use for all +// new style responses. This will be on an _INBOX with an +// additional terminal token. The subscription will be on +// a wildcard. Caller is responsible for ensuring this is +// only called once. +func (nc *Conn) createRespMux(respSub string) error { + s, err := nc.Subscribe(respSub, nc.respHandler) + if err != nil { + return err + } + nc.mu.Lock() + nc.respMux = s + nc.mu.Unlock() + return nil +} + +// Request will send a request payload and deliver the response message, +// or an error, including a timeout if no message was received properly. +func (nc *Conn) Request(subj string, data []byte, timeout time.Duration) (*Msg, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + + nc.mu.Lock() + // If user wants the old style. + if nc.Opts.UseOldRequestStyle { + nc.mu.Unlock() + return nc.oldRequest(subj, data, timeout) + } + + // Do setup for the new style. + if nc.respMap == nil { + nc.initNewResp() + } + // Create literal Inbox and map to a chan msg. + mch := make(chan *Msg, RequestChanLen) + respInbox := nc.newRespInbox() + token := respToken(respInbox) + nc.respMap[token] = mch + createSub := nc.respMux == nil + ginbox := nc.respSub + nc.mu.Unlock() + + if createSub { + // Make sure scoped subscription is setup only once. + var err error + nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) }) + if err != nil { + return nil, err + } + } + + if err := nc.PublishRequest(subj, respInbox, data); err != nil { + return nil, err + } + + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + case <-t.C: + nc.mu.Lock() + delete(nc.respMap, token) + nc.mu.Unlock() + return nil, ErrTimeout + } + + return msg, nil +} + +// oldRequest will create an Inbox and perform a Request() call +// with the Inbox reply and return the first reply received. +// This is optimized for the case of multiple responses. +func (nc *Conn) oldRequest(subj string, data []byte, timeout time.Duration) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + return s.NextMsg(timeout) +} + +// InboxPrefix is the prefix for all inbox subjects. +const ( + InboxPrefix = "_INBOX." + inboxPrefixLen = len(InboxPrefix) + respInboxPrefixLen = inboxPrefixLen + nuidSize + 1 + replySuffixLen = 8 // Gives us 62^8 + rdigits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz" + base = 62 +) + +// NewInbox will return an inbox string which can be used for directed replies from +// subscribers. These are guaranteed to be unique, but can be shared and subscribed +// to by others. +func NewInbox() string { + var b [inboxPrefixLen + nuidSize]byte + pres := b[:inboxPrefixLen] + copy(pres, InboxPrefix) + ns := b[inboxPrefixLen:] + copy(ns, nuid.Next()) + return string(b[:]) +} + +// Function to init new response structures. +func (nc *Conn) initNewResp() { + // _INBOX wildcard + nc.respSub = fmt.Sprintf("%s.*", NewInbox()) + nc.respMap = make(map[string]chan *Msg) + nc.respRand = rand.New(rand.NewSource(time.Now().UnixNano())) +} + +// newRespInbox creates a new literal response subject +// that will trigger the mux subscription handler. +// Lock should be held. +func (nc *Conn) newRespInbox() string { + if nc.respMap == nil { + nc.initNewResp() + } + var b [respInboxPrefixLen + replySuffixLen]byte + pres := b[:respInboxPrefixLen] + copy(pres, nc.respSub) + rn := nc.respRand.Int63() + for i, l := respInboxPrefixLen, rn; i < len(b); i++ { + b[i] = rdigits[l%base] + l /= base + } + return string(b[:]) +} + +// NewRespInbox is the new format used for _INBOX. +func (nc *Conn) NewRespInbox() string { + nc.mu.Lock() + s := nc.newRespInbox() + nc.mu.Unlock() + return s +} + +// respToken will return the last token of a literal response inbox +// which we use for the message channel lookup. +func respToken(respInbox string) string { + return respInbox[respInboxPrefixLen:] +} + +// Subscribe will express interest in the given subject. The subject +// can have wildcards (partial:*, full:>). Messages will be delivered +// to the associated MsgHandler. +func (nc *Conn) Subscribe(subj string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, cb, nil) +} + +// ChanSubscribe will express interest in the given subject and place +// all messages received on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +func (nc *Conn) ChanSubscribe(subj string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, nil, ch) +} + +// ChanQueueSubscribe will express interest in the given subject. +// All subscribers with the same queue name will form the queue group +// and only one member of the group will be selected to receive any given message, +// which will be placed on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +// Note: This is the same than QueueSubscribeSyncWithChan. +func (nc *Conn) ChanQueueSubscribe(subj, group string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, group, nil, ch) +} + +// SubscribeSync will express interest on the given subject. Messages will +// be received synchronously using Subscription.NextMsg(). +func (nc *Conn) SubscribeSync(subj string) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, _EMPTY_, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribe creates an asynchronous queue subscriber on the given subject. +// All subscribers with the same queue name will form the queue group and +// only one member of the group will be selected to receive any given +// message asynchronously. +func (nc *Conn) QueueSubscribe(subj, queue string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, queue, cb, nil) +} + +// QueueSubscribeSync creates a synchronous queue subscriber on the given +// subject. All subscribers with the same queue name will form the queue +// group and only one member of the group will be selected to receive any +// given message synchronously using Subscription.NextMsg(). +func (nc *Conn) QueueSubscribeSync(subj, queue string) (*Subscription, error) { + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, queue, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribeSyncWithChan will express interest in the given subject. +// All subscribers with the same queue name will form the queue group +// and only one member of the group will be selected to receive any given message, +// which will be placed on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +// Note: This is the same than ChanQueueSubscribe. +func (nc *Conn) QueueSubscribeSyncWithChan(subj, queue string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, queue, nil, ch) +} + +// subscribe is the internal subscribe function that indicates interest in a subject. +func (nc *Conn) subscribe(subj, queue string, cb MsgHandler, ch chan *Msg) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + nc.mu.Lock() + // ok here, but defer is generally expensive + defer nc.mu.Unlock() + + // Check for some error conditions. + if nc.isClosed() { + return nil, ErrConnectionClosed + } + if nc.isDraining() { + return nil, ErrConnectionDraining + } + + if cb == nil && ch == nil { + return nil, ErrBadSubscription + } + + sub := &Subscription{Subject: subj, Queue: queue, mcb: cb, conn: nc} + // Set pending limits. + sub.pMsgsLimit = DefaultSubPendingMsgsLimit + sub.pBytesLimit = DefaultSubPendingBytesLimit + + // If we have an async callback, start up a sub specific + // Go routine to deliver the messages. + if cb != nil { + sub.typ = AsyncSubscription + sub.pCond = sync.NewCond(&sub.mu) + go nc.waitForMsgs(sub) + } else { + sub.typ = ChanSubscription + sub.mch = ch + } + + nc.subsMu.Lock() + nc.ssid++ + sub.sid = nc.ssid + nc.subs[sub.sid] = sub + nc.subsMu.Unlock() + + // We will send these for all subs when we reconnect + // so that we can suppress here if reconnecting. + if !nc.isReconnecting() { + fmt.Fprintf(nc.bw, subProto, subj, queue, sub.sid) + // Kick flusher if needed. + if len(nc.fch) == 0 { + nc.kickFlusher() + } + } + + return sub, nil +} + +// NumSubscriptions returns active number of subscriptions. +func (nc *Conn) NumSubscriptions() int { + nc.mu.Lock() + defer nc.mu.Unlock() + return len(nc.subs) +} + +// Lock for nc should be held here upon entry +func (nc *Conn) removeSub(s *Subscription) { + nc.subsMu.Lock() + delete(nc.subs, s.sid) + nc.subsMu.Unlock() + s.mu.Lock() + defer s.mu.Unlock() + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + + // Mark as invalid + s.conn = nil + s.closed = true + if s.pCond != nil { + s.pCond.Broadcast() + } +} + +// SubscriptionType is the type of the Subscription. +type SubscriptionType int + +// The different types of subscription types. +const ( + AsyncSubscription = SubscriptionType(iota) + SyncSubscription + ChanSubscription + NilSubscription +) + +// Type returns the type of Subscription. +func (s *Subscription) Type() SubscriptionType { + if s == nil { + return NilSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + return s.typ +} + +// IsValid returns a boolean indicating whether the subscription +// is still active. This will return false if the subscription has +// already been closed. +func (s *Subscription) IsValid() bool { + if s == nil { + return false + } + s.mu.Lock() + defer s.mu.Unlock() + return s.conn != nil +} + +// Drain will remove interest but continue callbacks until all messages +// have been processed. +func (s *Subscription) Drain() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, 0, true) +} + +// Unsubscribe will remove interest in the given subject. +func (s *Subscription) Unsubscribe() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + if conn.IsDraining() { + return ErrConnectionDraining + } + return conn.unsubscribe(s, 0, false) +} + +// checkDrained will watch for a subscription to be fully drained +// and then remove it. +func (nc *Conn) checkDrained(sub *Subscription) { + if nc == nil || sub == nil { + return + } + + // This allows us to know that whatever we have in the client pending + // is correct and the server will not send additional information. + nc.Flush() + + // Once we are here we just wait for Pending to reach 0 or + // any other state to exit this go routine. + for { + // check connection is still valid. + if nc.IsClosed() { + return + } + + // Check subscription state + sub.mu.Lock() + conn := sub.conn + closed := sub.closed + pMsgs := sub.pMsgs + sub.mu.Unlock() + + if conn == nil || closed || pMsgs == 0 { + nc.mu.Lock() + nc.removeSub(sub) + nc.mu.Unlock() + return + } + + time.Sleep(100 * time.Millisecond) + } +} + +// AutoUnsubscribe will issue an automatic Unsubscribe that is +// processed by the server when max messages have been received. +// This can be useful when sending a request to an unknown number +// of subscribers. +func (s *Subscription) AutoUnsubscribe(max int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, max, false) +} + +// unsubscribe performs the low level unsubscribe to the server. +// Use Subscription.Unsubscribe() +func (nc *Conn) unsubscribe(sub *Subscription, max int, drainMode bool) error { + nc.mu.Lock() + // ok here, but defer is expensive + defer nc.mu.Unlock() + defer nc.kickFlusher() + + if nc.isClosed() { + return ErrConnectionClosed + } + + nc.subsMu.RLock() + s := nc.subs[sub.sid] + nc.subsMu.RUnlock() + // Already unsubscribed + if s == nil { + return nil + } + + maxStr := _EMPTY_ + if max > 0 { + s.max = uint64(max) + maxStr = strconv.Itoa(max) + } else if !drainMode { + nc.removeSub(s) + } + + if drainMode { + go nc.checkDrained(sub) + } + + // We will send these for all subs when we reconnect + // so that we can suppress here. + if !nc.isReconnecting() { + fmt.Fprintf(nc.bw, unsubProto, s.sid, maxStr) + } + return nil +} + +// NextMsg will return the next message available to a synchronous subscriber +// or block until one is available. A timeout can be used to return when no +// message has been delivered. +func (s *Subscription) NextMsg(timeout time.Duration) (*Msg, error) { + if s == nil { + return nil, ErrBadSubscription + } + + s.mu.Lock() + err := s.validateNextMsgState() + if err != nil { + s.mu.Unlock() + return nil, err + } + + // snapshot + mch := s.mch + s.mu.Unlock() + + var ok bool + var msg *Msg + + // If something is available right away, let's optimize that case. + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } else { + return msg, nil + } + default: + } + + // If we are here a message was not immediately available, so lets loop + // with a timeout. + + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } + case <-t.C: + return nil, ErrTimeout + } + + return msg, nil +} + +// validateNextMsgState checks whether the subscription is in a valid +// state to call NextMsg and be delivered another message synchronously. +// This should be called while holding the lock. +func (s *Subscription) validateNextMsgState() error { + if s.connClosed { + return ErrConnectionClosed + } + if s.mch == nil { + if s.max > 0 && s.delivered >= s.max { + return ErrMaxMessages + } else if s.closed { + return ErrBadSubscription + } + } + if s.mcb != nil { + return ErrSyncSubRequired + } + if s.sc { + s.sc = false + return ErrSlowConsumer + } + + return nil +} + +// processNextMsgDelivered takes a message and applies the needed +// accounting to the stats from the subscription, returning an +// error in case we have the maximum number of messages have been +// delivered already. It should not be called while holding the lock. +func (s *Subscription) processNextMsgDelivered(msg *Msg) error { + s.mu.Lock() + nc := s.conn + max := s.max + + // Update some stats. + s.delivered++ + delivered := s.delivered + if s.typ == SyncSubscription { + s.pMsgs-- + s.pBytes -= len(msg.Data) + } + s.mu.Unlock() + + if max > 0 { + if delivered > max { + return ErrMaxMessages + } + // Remove subscription if we have reached max. + if delivered == max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + } + } + + return nil +} + +// Queued returns the number of queued messages in the client for this subscription. +// DEPRECATED: Use Pending() +func (s *Subscription) QueuedMsgs() (int, error) { + m, _, err := s.Pending() + return int(m), err +} + +// Pending returns the number of queued messages and queued bytes in the client for this subscription. +func (s *Subscription) Pending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgs, s.pBytes, nil +} + +// MaxPending returns the maximum number of queued messages and queued bytes seen so far. +func (s *Subscription) MaxPending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsMax, s.pBytesMax, nil +} + +// ClearMaxPending resets the maximums seen so far. +func (s *Subscription) ClearMaxPending() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + s.pMsgsMax, s.pBytesMax = 0, 0 + return nil +} + +// Pending Limits +const ( + DefaultSubPendingMsgsLimit = 65536 + DefaultSubPendingBytesLimit = 65536 * 1024 +) + +// PendingLimits returns the current limits for this subscription. +// If no error is returned, a negative value indicates that the +// given metric is not limited. +func (s *Subscription) PendingLimits() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsLimit, s.pBytesLimit, nil +} + +// SetPendingLimits sets the limits for pending msgs and bytes for this subscription. +// Zero is not allowed. Any negative value means that the given metric is not limited. +func (s *Subscription) SetPendingLimits(msgLimit, bytesLimit int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + if msgLimit == 0 || bytesLimit == 0 { + return ErrInvalidArg + } + s.pMsgsLimit, s.pBytesLimit = msgLimit, bytesLimit + return nil +} + +// Delivered returns the number of delivered messages for this subscription. +func (s *Subscription) Delivered() (int64, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return int64(s.delivered), nil +} + +// Dropped returns the number of known dropped messages for this subscription. +// This will correspond to messages dropped by violations of PendingLimits. If +// the server declares the connection a SlowConsumer, this number may not be +// valid. +func (s *Subscription) Dropped() (int, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return s.dropped, nil +} + +// FIXME: This is a hack +// removeFlushEntry is needed when we need to discard queued up responses +// for our pings as part of a flush call. This happens when we have a flush +// call outstanding and we call close. +func (nc *Conn) removeFlushEntry(ch chan struct{}) bool { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.pongs == nil { + return false + } + for i, c := range nc.pongs { + if c == ch { + nc.pongs[i] = nil + return true + } + } + return false +} + +// The lock must be held entering this function. +func (nc *Conn) sendPing(ch chan struct{}) { + nc.pongs = append(nc.pongs, ch) + nc.bw.WriteString(pingProto) + // Flush in place. + nc.bw.Flush() +} + +// This will fire periodically and send a client origin +// ping to the server. Will also check that we have received +// responses from the server. +func (nc *Conn) processPingTimer() { + nc.mu.Lock() + + if nc.status != CONNECTED { + nc.mu.Unlock() + return + } + + // Check for violation + nc.pout++ + if nc.pout > nc.Opts.MaxPingsOut { + nc.mu.Unlock() + nc.processOpErr(ErrStaleConnection) + return + } + + nc.sendPing(nil) + nc.ptmr.Reset(nc.Opts.PingInterval) + nc.mu.Unlock() +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (nc *Conn) FlushTimeout(timeout time.Duration) (err error) { + if nc == nil { + return ErrInvalidConnection + } + if timeout <= 0 { + return ErrBadTimeout + } + + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + // Create a buffered channel to prevent chan send to block + // in processPong() if this code here times out just when + // PONG was received. + ch := make(chan struct{}, 1) + nc.sendPing(ch) + nc.mu.Unlock() + + select { + case _, ok := <-ch: + if !ok { + err = ErrConnectionClosed + } else { + close(ch) + } + case <-t.C: + err = ErrTimeout + } + + if err != nil { + nc.removeFlushEntry(ch) + } + return +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (nc *Conn) Flush() error { + return nc.FlushTimeout(60 * time.Second) +} + +// Buffered will return the number of bytes buffered to be sent to the server. +// FIXME(dlc) take into account disconnected state. +func (nc *Conn) Buffered() (int, error) { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.isClosed() || nc.bw == nil { + return -1, ErrConnectionClosed + } + return nc.bw.Buffered(), nil +} + +// resendSubscriptions will send our subscription state back to the +// server. Used in reconnects +func (nc *Conn) resendSubscriptions() { + // Since we are going to send protocols to the server, we don't want to + // be holding the subsMu lock (which is used in processMsg). So copy + // the subscriptions in a temporary array. + nc.subsMu.RLock() + subs := make([]*Subscription, 0, len(nc.subs)) + for _, s := range nc.subs { + subs = append(subs, s) + } + nc.subsMu.RUnlock() + for _, s := range subs { + adjustedMax := uint64(0) + s.mu.Lock() + if s.max > 0 { + if s.delivered < s.max { + adjustedMax = s.max - s.delivered + } + // adjustedMax could be 0 here if the number of delivered msgs + // reached the max, if so unsubscribe. + if adjustedMax == 0 { + s.mu.Unlock() + fmt.Fprintf(nc.bw, unsubProto, s.sid, _EMPTY_) + continue + } + } + s.mu.Unlock() + + fmt.Fprintf(nc.bw, subProto, s.Subject, s.Queue, s.sid) + if adjustedMax > 0 { + maxStr := strconv.Itoa(int(adjustedMax)) + fmt.Fprintf(nc.bw, unsubProto, s.sid, maxStr) + } + } +} + +// This will clear any pending flush calls and release pending calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingFlushCalls() { + // Clear any queued pongs, e.g. pending flush calls. + for _, ch := range nc.pongs { + if ch != nil { + close(ch) + } + } + nc.pongs = nil +} + +// This will clear any pending Request calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingRequestCalls() { + if nc.respMap == nil { + return + } + for key, ch := range nc.respMap { + if ch != nil { + close(ch) + delete(nc.respMap, key) + } + } +} + +// Low level close call that will do correct cleanup and set +// desired status. Also controls whether user defined callbacks +// will be triggered. The lock should not be held entering this +// function. This function will handle the locking manually. +func (nc *Conn) close(status Status, doCBs bool) { + nc.mu.Lock() + if nc.isClosed() { + nc.status = status + nc.mu.Unlock() + return + } + nc.status = CLOSED + + // Kick the Go routines so they fall out. + nc.kickFlusher() + nc.mu.Unlock() + + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any queued and blocking Requests. + nc.clearPendingRequestCalls() + + // Stop ping timer if set. + nc.stopPingTimer() + nc.ptmr = nil + + // Go ahead and make sure we have flushed the outbound + if nc.conn != nil { + nc.bw.Flush() + defer nc.conn.Close() + } + + // Close sync subscriber channels and release any + // pending NextMsg() calls. + nc.subsMu.Lock() + for _, s := range nc.subs { + s.mu.Lock() + + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + // Mark as invalid, for signaling to deliverMsgs + s.closed = true + // Mark connection closed in subscription + s.connClosed = true + // If we have an async subscription, signals it to exit + if s.typ == AsyncSubscription && s.pCond != nil { + s.pCond.Signal() + } + + s.mu.Unlock() + } + nc.subs = nil + nc.subsMu.Unlock() + + nc.status = status + + // Perform appropriate callback if needed for a disconnect. + if doCBs { + if nc.Opts.DisconnectedCB != nil && nc.conn != nil { + nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) }) + } + if nc.Opts.ClosedCB != nil { + nc.ach.push(func() { nc.Opts.ClosedCB(nc) }) + } + nc.ach.close() + } + nc.mu.Unlock() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush() and NextMsg() +func (nc *Conn) Close() { + nc.close(CLOSED, true) +} + +// IsClosed tests if a Conn has been closed. +func (nc *Conn) IsClosed() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isClosed() +} + +// IsReconnecting tests if a Conn is reconnecting. +func (nc *Conn) IsReconnecting() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isReconnecting() +} + +// IsConnected tests if a Conn is connected. +func (nc *Conn) IsConnected() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isConnected() +} + +// drainConnection will run in a separate Go routine and will +// flush all publishes and drain all active subscriptions. +func (nc *Conn) drainConnection() { + // Snapshot subs list. + nc.mu.Lock() + subs := make([]*Subscription, 0, len(nc.subs)) + for _, s := range nc.subs { + subs = append(subs, s) + } + errCB := nc.Opts.AsyncErrorCB + drainWait := nc.Opts.DrainTimeout + nc.mu.Unlock() + + // for pushing errors with context. + pushErr := func(err error) { + nc.mu.Lock() + nc.err = err + if errCB != nil { + nc.ach.push(func() { errCB(nc, nil, err) }) + } + nc.mu.Unlock() + } + + // Do subs first + for _, s := range subs { + if err := s.Drain(); err != nil { + // We will notify about these but continue. + pushErr(err) + } + } + + // Wait for the subscriptions to drop to zero. + timeout := time.Now().Add(drainWait) + for time.Now().Before(timeout) { + if nc.NumSubscriptions() == 0 { + break + } + time.Sleep(10 * time.Millisecond) + } + + // Check if we timed out. + if nc.NumSubscriptions() != 0 { + pushErr(ErrDrainTimeout) + } + + // Flip State + nc.mu.Lock() + nc.status = DRAINING_PUBS + nc.mu.Unlock() + + // Do publish drain via Flush() call. + err := nc.Flush() + if err != nil { + pushErr(err) + nc.Close() + return + } + + // Move to closed state. + nc.Close() +} + +// Drain will put a connection into a drain state. All subscriptions will +// immediately be put into a drain state. Upon completion, the publishers +// will be drained and can not publish any additional messages. Upon draining +// of the publishers, the connection will be closed. Use the ClosedCB() +// option to know when the connection has moved from draining to closed. +func (nc *Conn) Drain() error { + nc.mu.Lock() + defer nc.mu.Unlock() + + if nc.isClosed() { + return ErrConnectionClosed + } + if nc.isConnecting() || nc.isReconnecting() { + return ErrConnectionReconnecting + } + if nc.isDraining() { + return nil + } + + nc.status = DRAINING_SUBS + go nc.drainConnection() + return nil +} + +// IsDraining tests if a Conn is in the draining state. +func (nc *Conn) IsDraining() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isDraining() +} + +// caller must lock +func (nc *Conn) getServers(implicitOnly bool) []string { + poolSize := len(nc.srvPool) + var servers = make([]string, 0) + for i := 0; i < poolSize; i++ { + if implicitOnly && !nc.srvPool[i].isImplicit { + continue + } + url := nc.srvPool[i].url + servers = append(servers, fmt.Sprintf("%s://%s", url.Scheme, url.Host)) + } + return servers +} + +// Servers returns the list of known server urls, including additional +// servers discovered after a connection has been established. If +// authentication is enabled, use UserInfo or Token when connecting with +// these urls. +func (nc *Conn) Servers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(false) +} + +// DiscoveredServers returns only the server urls that have been discovered +// after a connection has been established. If authentication is enabled, +// use UserInfo or Token when connecting with these urls. +func (nc *Conn) DiscoveredServers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(true) +} + +// Status returns the current state of the connection. +func (nc *Conn) Status() Status { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.status +} + +// Test if Conn has been closed Lock is assumed held. +func (nc *Conn) isClosed() bool { + return nc.status == CLOSED +} + +// Test if Conn is in the process of connecting +func (nc *Conn) isConnecting() bool { + return nc.status == CONNECTING +} + +// Test if Conn is being reconnected. +func (nc *Conn) isReconnecting() bool { + return nc.status == RECONNECTING +} + +// Test if Conn is connected or connecting. +func (nc *Conn) isConnected() bool { + return nc.status == CONNECTED || nc.isDraining() +} + +// Test if Conn is in the draining state. +func (nc *Conn) isDraining() bool { + return nc.status == DRAINING_SUBS || nc.status == DRAINING_PUBS +} + +// Test if Conn is in the draining state for pubs. +func (nc *Conn) isDrainingPubs() bool { + return nc.status == DRAINING_PUBS +} + +// Stats will return a race safe copy of the Statistics section for the connection. +func (nc *Conn) Stats() Statistics { + // Stats are updated either under connection's mu or subsMu mutexes. + // Lock both to safely get them. + nc.mu.Lock() + nc.subsMu.RLock() + stats := Statistics{ + InMsgs: nc.InMsgs, + InBytes: nc.InBytes, + OutMsgs: nc.OutMsgs, + OutBytes: nc.OutBytes, + Reconnects: nc.Reconnects, + } + nc.subsMu.RUnlock() + nc.mu.Unlock() + return stats +} + +// MaxPayload returns the size limit that a message payload can have. +// This is set by the server configuration and delivered to the client +// upon connect. +func (nc *Conn) MaxPayload() int64 { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.MaxPayload +} + +// AuthRequired will return if the connected server requires authorization. +func (nc *Conn) AuthRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.AuthRequired +} + +// TLSRequired will return if the connected server requires TLS connections. +func (nc *Conn) TLSRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.TLSRequired +} + +// Barrier schedules the given function `f` to all registered asynchronous +// subscriptions. +// Only the last subscription to see this barrier will invoke the function. +// If no subscription is registered at the time of this call, `f()` is invoked +// right away. +// ErrConnectionClosed is returned if the connection is closed prior to +// the call. +func (nc *Conn) Barrier(f func()) error { + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + nc.subsMu.Lock() + // Need to figure out how many non chan subscriptions there are + numSubs := 0 + for _, sub := range nc.subs { + if sub.typ == AsyncSubscription { + numSubs++ + } + } + if numSubs == 0 { + nc.subsMu.Unlock() + nc.mu.Unlock() + f() + return nil + } + barrier := &barrierInfo{refs: int64(numSubs), f: f} + for _, sub := range nc.subs { + sub.mu.Lock() + if sub.mch == nil { + msg := &Msg{barrier: barrier} + // Push onto the async pList + if sub.pTail != nil { + sub.pTail.next = msg + } else { + sub.pHead = msg + sub.pCond.Signal() + } + sub.pTail = msg + } + sub.mu.Unlock() + } + nc.subsMu.Unlock() + nc.mu.Unlock() + return nil +} + +// GetClientID returns the client ID assigned by the server to which +// the client is currently connected to. Note that the value may change if +// the client reconnects. +// This function returns ErrNoClientIDReturned if the server is of a +// version prior to 1.2.0. +func (nc *Conn) GetClientID() (uint64, error) { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.isClosed() { + return 0, ErrConnectionClosed + } + if nc.info.CID == 0 { + return 0, ErrClientIDNotSupported + } + return nc.info.CID, nil +} + +// NkeyOptionFromSeed will load an nkey pair from a seed file. +// It will return the NKey Option and will handle +// signing of nonce challenges from the server. It will take +// care to not hold keys in memory and to wipe memory. +func NkeyOptionFromSeed(seedFile string) (Option, error) { + kp, err := nkeyPairFromSeedFile(seedFile) + if err != nil { + return nil, err + } + // Wipe our key on exit. + defer kp.Wipe() + + pub, err := kp.PublicKey() + if err != nil { + return nil, err + } + if !nkeys.IsValidPublicUserKey(pub) { + return nil, fmt.Errorf("nats: Not a valid nkey user seed") + } + sigCB := func(nonce []byte) ([]byte, error) { + return sigHandler(nonce, seedFile) + } + return Nkey(string(pub), sigCB), nil +} + +// This is a regex to match decorated jwts in keys/seeds. +// .e.g. +// -----BEGIN NATS USER JWT----- +// eyJ0eXAiOiJqd3QiLCJhbGciOiJlZDI1NTE5... +// ------END NATS USER JWT------ +// +// ************************* IMPORTANT ************************* +// NKEY Seed printed below can be used sign and prove identity. +// NKEYs are sensitive and should be treated as secrets. +// +// -----BEGIN USER NKEY SEED----- +// SUAIO3FHUX5PNV2LQIIP7TZ3N4L7TX3W53MQGEIVYFIGA635OZCKEYHFLM +// ------END USER NKEY SEED------ + +var nscDecoratedRe = regexp.MustCompile(`\s*(?:(?:[-]{3,}[^\n]*[-]{3,}\n)(.+)(?:\n\s*[-]{3,}[^\n]*[-]{3,}\n))`) + +func userFromFile(userFile string) (string, error) { + contents, err := ioutil.ReadFile(userFile) + if err != nil { + return _EMPTY_, fmt.Errorf("nats: %v", err) + } + defer wipeSlice(contents) + + items := nscDecoratedRe.FindAllSubmatch(contents, -1) + if len(items) == 0 { + return string(contents), nil + } + // First result should be the user JWT. + // We copy here so that if the file contained a seed file too we wipe appropriately. + raw := items[0][1] + tmp := make([]byte, len(raw)) + copy(tmp, raw) + return string(tmp), nil +} + +func nkeyPairFromSeedFile(seedFile string) (nkeys.KeyPair, error) { + var seed []byte + contents, err := ioutil.ReadFile(seedFile) + if err != nil { + return nil, fmt.Errorf("nats: %v", err) + } + defer wipeSlice(contents) + + items := nscDecoratedRe.FindAllSubmatch(contents, -1) + if len(items) > 1 { + seed = items[1][1] + } else { + lines := bytes.Split(contents, []byte("\n")) + for _, line := range lines { + if bytes.HasPrefix(bytes.TrimSpace(line), []byte("SU")) { + seed = line + break + } + } + } + + if seed == nil { + return nil, fmt.Errorf("nats: No nkey user seed found in %q", seedFile) + } + kp, err := nkeys.FromSeed(seed) + if err != nil { + return nil, err + } + return kp, nil +} + +// Sign authentication challenges from the server. +// Do not keep private seed in memory. +func sigHandler(nonce []byte, seedFile string) ([]byte, error) { + kp, err := nkeyPairFromSeedFile(seedFile) + if err != nil { + return nil, err + } + // Wipe our key on exit. + defer kp.Wipe() + + sig, _ := kp.Sign(nonce) + return sig, nil +} + +// Just wipe slice with 'x', for clearing contents of nkey seed file. +func wipeSlice(buf []byte) { + for i := range buf { + buf[i] = 'x' + } +} + +type timeoutWriter struct { + timeout time.Duration + conn net.Conn + err error +} + +// Write implements the io.Writer interface. +func (tw *timeoutWriter) Write(p []byte) (int, error) { + if tw.err != nil { + return 0, tw.err + } + + var n int + tw.conn.SetWriteDeadline(time.Now().Add(tw.timeout)) + n, tw.err = tw.conn.Write(p) + tw.conn.SetWriteDeadline(time.Time{}) + return n, tw.err +} diff --git a/vendor/github.com/nats-io/go-nats/netchan.go b/vendor/github.com/nats-io/go-nats/netchan.go new file mode 100644 index 00000000..add3cba5 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/netchan.go @@ -0,0 +1,111 @@ +// Copyright 2013-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "errors" + "reflect" +) + +// This allows the functionality for network channels by binding send and receive Go chans +// to subjects and optionally queue groups. +// Data will be encoded and decoded via the EncodedConn and its associated encoders. + +// BindSendChan binds a channel for send operations to NATS. +func (c *EncodedConn) BindSendChan(subject string, channel interface{}) error { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return ErrChanArg + } + go chPublish(c, chVal, subject) + return nil +} + +// Publish all values that arrive on the channel until it is closed or we +// encounter an error. +func chPublish(c *EncodedConn, chVal reflect.Value, subject string) { + for { + val, ok := chVal.Recv() + if !ok { + // Channel has most likely been closed. + return + } + if e := c.Publish(subject, val.Interface()); e != nil { + // Do this under lock. + c.Conn.mu.Lock() + defer c.Conn.mu.Unlock() + + if c.Conn.Opts.AsyncErrorCB != nil { + // FIXME(dlc) - Not sure this is the right thing to do. + // FIXME(ivan) - If the connection is not yet closed, try to schedule the callback + if c.Conn.isClosed() { + go c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) + } else { + c.Conn.ach.push(func() { c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) }) + } + } + return + } + } +} + +// BindRecvChan binds a channel for receive operations from NATS. +func (c *EncodedConn) BindRecvChan(subject string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, _EMPTY_, channel) +} + +// BindRecvQueueChan binds a channel for queue-based receive operations from NATS. +func (c *EncodedConn) BindRecvQueueChan(subject, queue string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, queue, channel) +} + +// Internal function to bind receive operations for a channel. +func (c *EncodedConn) bindRecvChan(subject, queue string, channel interface{}) (*Subscription, error) { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return nil, ErrChanArg + } + argType := chVal.Type().Elem() + + cb := func(m *Msg) { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + c.Conn.err = errors.New("nats: Got an error trying to unmarshal: " + err.Error()) + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach.push(func() { c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, c.Conn.err) }) + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + // This is a bit hacky, but in this instance we may be trying to send to a closed channel. + // and the user does not know when it is safe to close the channel. + defer func() { + // If we have panicked, recover and close the subscription. + if r := recover(); r != nil { + m.Sub.Unsubscribe() + } + }() + // Actually do the send to the channel. + chVal.Send(oPtr) + } + + return c.Conn.subscribe(subject, queue, cb, nil) +} diff --git a/vendor/github.com/nats-io/go-nats/parser.go b/vendor/github.com/nats-io/go-nats/parser.go new file mode 100644 index 00000000..a4b3ea0e --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/parser.go @@ -0,0 +1,481 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "fmt" +) + +type msgArg struct { + subject []byte + reply []byte + sid int64 + size int +} + +const MAX_CONTROL_LINE_SIZE = 1024 + +type parseState struct { + state int + as int + drop int + ma msgArg + argBuf []byte + msgBuf []byte + scratch [MAX_CONTROL_LINE_SIZE]byte +} + +const ( + OP_START = iota + OP_PLUS + OP_PLUS_O + OP_PLUS_OK + OP_MINUS + OP_MINUS_E + OP_MINUS_ER + OP_MINUS_ERR + OP_MINUS_ERR_SPC + MINUS_ERR_ARG + OP_M + OP_MS + OP_MSG + OP_MSG_SPC + MSG_ARG + MSG_PAYLOAD + MSG_END + OP_P + OP_PI + OP_PIN + OP_PING + OP_PO + OP_PON + OP_PONG + OP_I + OP_IN + OP_INF + OP_INFO + OP_INFO_SPC + INFO_ARG +) + +// parse is the fast protocol parser engine. +func (nc *Conn) parse(buf []byte) error { + var i int + var b byte + + // Move to loop instead of range syntax to allow jumping of i + for i = 0; i < len(buf); i++ { + b = buf[i] + + switch nc.ps.state { + case OP_START: + switch b { + case 'M', 'm': + nc.ps.state = OP_M + case 'P', 'p': + nc.ps.state = OP_P + case '+': + nc.ps.state = OP_PLUS + case '-': + nc.ps.state = OP_MINUS + case 'I', 'i': + nc.ps.state = OP_I + default: + goto parseErr + } + case OP_M: + switch b { + case 'S', 's': + nc.ps.state = OP_MS + default: + goto parseErr + } + case OP_MS: + switch b { + case 'G', 'g': + nc.ps.state = OP_MSG + default: + goto parseErr + } + case OP_MSG: + switch b { + case ' ', '\t': + nc.ps.state = OP_MSG_SPC + default: + goto parseErr + } + case OP_MSG_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MSG_ARG + nc.ps.as = i + } + case MSG_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + if err := nc.processMsgArgs(arg); err != nil { + return err + } + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, MSG_PAYLOAD + + // jump ahead with the index. If this overruns + // what is left we fall out and process split + // buffer. + i = nc.ps.as + nc.ps.ma.size - 1 + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case MSG_PAYLOAD: + if nc.ps.msgBuf != nil { + if len(nc.ps.msgBuf) >= nc.ps.ma.size { + nc.processMsg(nc.ps.msgBuf) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } else { + // copy as much as we can to the buffer and skip ahead. + toCopy := nc.ps.ma.size - len(nc.ps.msgBuf) + avail := len(buf) - i + + if avail < toCopy { + toCopy = avail + } + + if toCopy > 0 { + start := len(nc.ps.msgBuf) + // This is needed for copy to work. + nc.ps.msgBuf = nc.ps.msgBuf[:start+toCopy] + copy(nc.ps.msgBuf[start:], buf[i:i+toCopy]) + // Update our index + i = (i + toCopy) - 1 + } else { + nc.ps.msgBuf = append(nc.ps.msgBuf, b) + } + } + } else if i-nc.ps.as >= nc.ps.ma.size { + nc.processMsg(buf[nc.ps.as:i]) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } + case MSG_END: + switch b { + case '\n': + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + continue + } + case OP_PLUS: + switch b { + case 'O', 'o': + nc.ps.state = OP_PLUS_O + default: + goto parseErr + } + case OP_PLUS_O: + switch b { + case 'K', 'k': + nc.ps.state = OP_PLUS_OK + default: + goto parseErr + } + case OP_PLUS_OK: + switch b { + case '\n': + nc.processOK() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_MINUS: + switch b { + case 'E', 'e': + nc.ps.state = OP_MINUS_E + default: + goto parseErr + } + case OP_MINUS_E: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ER + default: + goto parseErr + } + case OP_MINUS_ER: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ERR + default: + goto parseErr + } + case OP_MINUS_ERR: + switch b { + case ' ', '\t': + nc.ps.state = OP_MINUS_ERR_SPC + default: + goto parseErr + } + case OP_MINUS_ERR_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MINUS_ERR_ARG + nc.ps.as = i + } + case MINUS_ERR_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processErr(string(arg)) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case OP_P: + switch b { + case 'I', 'i': + nc.ps.state = OP_PI + case 'O', 'o': + nc.ps.state = OP_PO + default: + goto parseErr + } + case OP_PO: + switch b { + case 'N', 'n': + nc.ps.state = OP_PON + default: + goto parseErr + } + case OP_PON: + switch b { + case 'G', 'g': + nc.ps.state = OP_PONG + default: + goto parseErr + } + case OP_PONG: + switch b { + case '\n': + nc.processPong() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_PI: + switch b { + case 'N', 'n': + nc.ps.state = OP_PIN + default: + goto parseErr + } + case OP_PIN: + switch b { + case 'G', 'g': + nc.ps.state = OP_PING + default: + goto parseErr + } + case OP_PING: + switch b { + case '\n': + nc.processPing() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_I: + switch b { + case 'N', 'n': + nc.ps.state = OP_IN + default: + goto parseErr + } + case OP_IN: + switch b { + case 'F', 'f': + nc.ps.state = OP_INF + default: + goto parseErr + } + case OP_INF: + switch b { + case 'O', 'o': + nc.ps.state = OP_INFO + default: + goto parseErr + } + case OP_INFO: + switch b { + case ' ', '\t': + nc.ps.state = OP_INFO_SPC + default: + goto parseErr + } + case OP_INFO_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = INFO_ARG + nc.ps.as = i + } + case INFO_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processAsyncInfo(arg) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + default: + goto parseErr + } + } + // Check for split buffer scenarios + if (nc.ps.state == MSG_ARG || nc.ps.state == MINUS_ERR_ARG || nc.ps.state == INFO_ARG) && nc.ps.argBuf == nil { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, buf[nc.ps.as:i-nc.ps.drop]...) + // FIXME, check max len + } + // Check for split msg + if nc.ps.state == MSG_PAYLOAD && nc.ps.msgBuf == nil { + // We need to clone the msgArg if it is still referencing the + // read buffer and we are not able to process the msg. + if nc.ps.argBuf == nil { + nc.cloneMsgArg() + } + + // If we will overflow the scratch buffer, just create a + // new buffer to hold the split message. + if nc.ps.ma.size > cap(nc.ps.scratch)-len(nc.ps.argBuf) { + lrem := len(buf[nc.ps.as:]) + + nc.ps.msgBuf = make([]byte, lrem, nc.ps.ma.size) + copy(nc.ps.msgBuf, buf[nc.ps.as:]) + } else { + nc.ps.msgBuf = nc.ps.scratch[len(nc.ps.argBuf):len(nc.ps.argBuf)] + nc.ps.msgBuf = append(nc.ps.msgBuf, (buf[nc.ps.as:])...) + } + } + + return nil + +parseErr: + return fmt.Errorf("nats: Parse Error [%d]: '%s'", nc.ps.state, buf[i:]) +} + +// cloneMsgArg is used when the split buffer scenario has the pubArg in the existing read buffer, but +// we need to hold onto it into the next read. +func (nc *Conn) cloneMsgArg() { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.subject...) + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.reply...) + nc.ps.ma.subject = nc.ps.argBuf[:len(nc.ps.ma.subject)] + if nc.ps.ma.reply != nil { + nc.ps.ma.reply = nc.ps.argBuf[len(nc.ps.ma.subject):] + } +} + +const argsLenMax = 4 + +func (nc *Conn) processMsgArgs(arg []byte) error { + // Unroll splitArgs to avoid runtime/heap issues + a := [argsLenMax][]byte{} + args := a[:0] + start := -1 + for i, b := range arg { + switch b { + case ' ', '\t', '\r', '\n': + if start >= 0 { + args = append(args, arg[start:i]) + start = -1 + } + default: + if start < 0 { + start = i + } + } + } + if start >= 0 { + args = append(args, arg[start:]) + } + + switch len(args) { + case 3: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = nil + nc.ps.ma.size = int(parseInt64(args[2])) + case 4: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = args[2] + nc.ps.ma.size = int(parseInt64(args[3])) + default: + return fmt.Errorf("nats: processMsgArgs Parse Error: '%s'", arg) + } + if nc.ps.ma.sid < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Sid: '%s'", arg) + } + if nc.ps.ma.size < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Size: '%s'", arg) + } + return nil +} + +// Ascii numbers 0-9 +const ( + ascii_0 = 48 + ascii_9 = 57 +) + +// parseInt64 expects decimal positive numbers. We +// return -1 to signal error +func parseInt64(d []byte) (n int64) { + if len(d) == 0 { + return -1 + } + for _, dec := range d { + if dec < ascii_0 || dec > ascii_9 { + return -1 + } + n = n*10 + (int64(dec) - ascii_0) + } + return n +} diff --git a/vendor/github.com/nats-io/go-nats/staticcheck.ignore b/vendor/github.com/nats-io/go-nats/staticcheck.ignore new file mode 100644 index 00000000..25bbf020 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/staticcheck.ignore @@ -0,0 +1,4 @@ +github.com/nats-io/go-nats/*_test.go:SA2002 +github.com/nats-io/go-nats/*/*_test.go:SA2002 +github.com/nats-io/go-nats/test/context_test.go:SA1012 +github.com/nats-io/go-nats/nats.go:SA6000 diff --git a/vendor/github.com/nats-io/go-nats/timer.go b/vendor/github.com/nats-io/go-nats/timer.go new file mode 100644 index 00000000..1216762d --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/timer.go @@ -0,0 +1,56 @@ +// Copyright 2017-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "sync" + "time" +) + +// global pool of *time.Timer's. can be used by multiple goroutines concurrently. +var globalTimerPool timerPool + +// timerPool provides GC-able pooling of *time.Timer's. +// can be used by multiple goroutines concurrently. +type timerPool struct { + p sync.Pool +} + +// Get returns a timer that completes after the given duration. +func (tp *timerPool) Get(d time.Duration) *time.Timer { + if t, _ := tp.p.Get().(*time.Timer); t != nil { + t.Reset(d) + return t + } + + return time.NewTimer(d) +} + +// Put pools the given timer. +// +// There is no need to call t.Stop() before calling Put. +// +// Put will try to stop the timer before pooling. If the +// given timer already expired, Put will read the unreceived +// value if there is one. +func (tp *timerPool) Put(t *time.Timer) { + if !t.Stop() { + select { + case <-t.C: + default: + } + } + + tp.p.Put(t) +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls.go b/vendor/github.com/nats-io/go-nats/util/tls.go new file mode 100644 index 00000000..53ff9aa2 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls.go @@ -0,0 +1,27 @@ +// Copyright 2017-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.8 + +package util + +import "crypto/tls" + +// CloneTLSConfig returns a copy of c. +func CloneTLSConfig(c *tls.Config) *tls.Config { + if c == nil { + return &tls.Config{} + } + + return c.Clone() +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls_go17.go b/vendor/github.com/nats-io/go-nats/util/tls_go17.go new file mode 100644 index 00000000..fd646d31 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls_go17.go @@ -0,0 +1,49 @@ +// Copyright 2016-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.7,!go1.8 + +package util + +import ( + "crypto/tls" +) + +// CloneTLSConfig returns a copy of c. Only the exported fields are copied. +// This is temporary, until this is provided by the language. +// https://go-review.googlesource.com/#/c/28075/ +func CloneTLSConfig(c *tls.Config) *tls.Config { + return &tls.Config{ + Rand: c.Rand, + Time: c.Time, + Certificates: c.Certificates, + NameToCertificate: c.NameToCertificate, + GetCertificate: c.GetCertificate, + RootCAs: c.RootCAs, + NextProtos: c.NextProtos, + ServerName: c.ServerName, + ClientAuth: c.ClientAuth, + ClientCAs: c.ClientCAs, + InsecureSkipVerify: c.InsecureSkipVerify, + CipherSuites: c.CipherSuites, + PreferServerCipherSuites: c.PreferServerCipherSuites, + SessionTicketsDisabled: c.SessionTicketsDisabled, + SessionTicketKey: c.SessionTicketKey, + ClientSessionCache: c.ClientSessionCache, + MinVersion: c.MinVersion, + MaxVersion: c.MaxVersion, + CurvePreferences: c.CurvePreferences, + DynamicRecordSizingDisabled: c.DynamicRecordSizingDisabled, + Renegotiation: c.Renegotiation, + } +} diff --git a/vendor/github.com/nats-io/jwt/.gitignore b/vendor/github.com/nats-io/jwt/.gitignore new file mode 100644 index 00000000..7117a678 --- /dev/null +++ b/vendor/github.com/nats-io/jwt/.gitignore @@ -0,0 +1,16 @@ +# Binaries for programs and plugins +*.exe +*.exe~ +*.dll +*.so +*.dylib + +# Test binary, build with `go test -c` +*.test + +# Output of the go coverage tool, specifically when used with LiteIDE +*.out + +# IDE Files +.vscode +.idea/ \ No newline at end of file diff --git a/vendor/github.com/nats-io/jwt/.travis.yml b/vendor/github.com/nats-io/jwt/.travis.yml new file mode 100644 index 00000000..f7dc9242 --- /dev/null +++ b/vendor/github.com/nats-io/jwt/.travis.yml @@ -0,0 +1,21 @@ +language: go +sudo: false +go: +- 1.12.x +- 1.11.x + +install: +- go get -t ./... +- go get github.com/mattn/goveralls +- go get github.com/wadey/gocovmerge +- go get -u honnef.co/go/tools/cmd/staticcheck +- go get -u github.com/client9/misspell/cmd/misspell + +before_script: +- $(exit $(go fmt ./... | wc -l)) +- go vet ./... +- misspell -error -locale US . +- staticcheck ./... + +script: +- if [[ "$TRAVIS_GO_VERSION" == 1.10.* ]] ; then ./scripts/cov.sh TRAVIS; else go test -v -race ./...; fi diff --git a/vendor/github.com/nats-io/jwt/Makefile b/vendor/github.com/nats-io/jwt/Makefile new file mode 100644 index 00000000..3e6a5cd5 --- /dev/null +++ b/vendor/github.com/nats-io/jwt/Makefile @@ -0,0 +1,18 @@ +.PHONY: test cover + +build: + go build + +test: + gofmt -s -w *.go + goimports -w *.go + go vet ./... + go test -v + go test -v --race + +fmt: + gofmt -w -s *.go + +cover: + go test -v -covermode=count -coverprofile=coverage.out + go tool cover -html=coverage.out diff --git a/vendor/github.com/nats-io/jwt/README.md b/vendor/github.com/nats-io/jwt/README.md new file mode 100644 index 00000000..d3cb88ac --- /dev/null +++ b/vendor/github.com/nats-io/jwt/README.md @@ -0,0 +1,54 @@ +# JWT +A [JWT](https://jwt.io/) implementation that uses [nkeys](https://github.com/nats-io/nkeys) to digitally sign JWT tokens. +Nkeys use [Ed25519](https://ed25519.cr.yp.to/) to provide authentication of JWT claims. + + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![ReportCard](http://goreportcard.com/badge/nats-io/jwt)](http://goreportcard.com/report/nats-io/jwt) +[![Build Status](https://travis-ci.org/nats-io/jwt.svg?branch=master)](http://travis-ci.org/nats-io/jwt) +[![GoDoc](http://godoc.org/github.com/nats-io/jwt?status.png)](http://godoc.org/github.com/nats-io/jwt) +[![Coverage Status](https://coveralls.io/repos/github/nats-io/jwt/badge.svg?branch=master&t=NmEFup)](https://coveralls.io/github/nats-io/jwt?branch=master) + +```go +// Need a private key to sign the claim, nkeys makes it easy to create +kp, err := nkeys.CreateAccount() +if err != nil { + t.Fatal("unable to create account key", err) +} + +pk, err := kp.PublicKey() +if err != nil { + t.Fatal("error getting public key", err) +} + +// create a new claim +claims := NewAccountClaims(pk) +claims.Expires = time.Now().Add(time.Duration(time.Hour)).Unix() + + +// add details by modifying claims.Account + +// serialize the claim to a JWT token +token, err := claims.Encode(kp) +if err != nil { + t.Fatal("error encoding token", err) +} + +// on the receiving side, decode the token +c, err := DecodeAccountClaims(token) +if err != nil { + t.Fatal(err) +} + +// if the token was decoded, it means that it +// validated and it wasn't tampered. the remaining and +// required test is to insure the issuer is trusted +pk, err := kp.PublicKey() +if err != nil { + t.Fatalf("unable to read public key: %v", err) +} + +if c.Issuer != pk { + t.Fatalf("the public key is not trusted") +} +``` \ No newline at end of file diff --git a/vendor/github.com/nats-io/jwt/account_claims.go b/vendor/github.com/nats-io/jwt/account_claims.go index d8fd7344..2f8cee89 100644 --- a/vendor/github.com/nats-io/jwt/account_claims.go +++ b/vendor/github.com/nats-io/jwt/account_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018-2019 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( @@ -13,6 +28,7 @@ const NoLimit = -1 type OperatorLimits struct { Subs int64 `json:"subs,omitempty"` // Max number of subscriptions Conn int64 `json:"conn,omitempty"` // Max number of active connections + LeafNodeConn int64 `json:"leaf,omitempty"` // Max number of active leaf node connections Imports int64 `json:"imports,omitempty"` // Max number of imports Exports int64 `json:"exports,omitempty"` // Max number of exports Data int64 `json:"data,omitempty"` // Max number of bytes @@ -27,7 +43,7 @@ func (o *OperatorLimits) IsEmpty() bool { // IsUnlimited returns true if all limits are func (o *OperatorLimits) IsUnlimited() bool { - return *o == OperatorLimits{NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, true} + return *o == OperatorLimits{NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, true} } // Validate checks that the operator limits contain valid values @@ -92,7 +108,7 @@ func NewAccountClaims(subject string) *AccountClaims { c := &AccountClaims{} // Set to unlimited to start. We do it this way so we get compiler // errors if we add to the OperatorLimits. - c.Limits = OperatorLimits{NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, true} + c.Limits = OperatorLimits{NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, NoLimit, true} c.Subject = subject return c } diff --git a/vendor/github.com/nats-io/jwt/activation_claims.go b/vendor/github.com/nats-io/jwt/activation_claims.go index 7d5d3ae9..a9f2a39d 100644 --- a/vendor/github.com/nats-io/jwt/activation_claims.go +++ b/vendor/github.com/nats-io/jwt/activation_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/claims.go b/vendor/github.com/nats-io/jwt/claims.go index ae21e997..45f00dad 100644 --- a/vendor/github.com/nats-io/jwt/claims.go +++ b/vendor/github.com/nats-io/jwt/claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018-2019 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( @@ -185,11 +200,7 @@ func parseClaims(s string, target Claims) error { if err != nil { return err } - if err := json.Unmarshal(h, &target); err != nil { - return err - } - - return nil + return json.Unmarshal(h, &target) } // Verify verifies that the encoded payload was signed by the diff --git a/vendor/github.com/nats-io/jwt/cluster_claims.go b/vendor/github.com/nats-io/jwt/cluster_claims.go index 6b3d4e0a..d526ba3f 100644 --- a/vendor/github.com/nats-io/jwt/cluster_claims.go +++ b/vendor/github.com/nats-io/jwt/cluster_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/exports.go b/vendor/github.com/nats-io/jwt/exports.go index 528fbea3..344b41a3 100644 --- a/vendor/github.com/nats-io/jwt/exports.go +++ b/vendor/github.com/nats-io/jwt/exports.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/genericlaims.go b/vendor/github.com/nats-io/jwt/genericlaims.go index a7bba655..7098955b 100644 --- a/vendor/github.com/nats-io/jwt/genericlaims.go +++ b/vendor/github.com/nats-io/jwt/genericlaims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import "github.com/nats-io/nkeys" diff --git a/vendor/github.com/nats-io/jwt/go.mod b/vendor/github.com/nats-io/jwt/go.mod new file mode 100644 index 00000000..2f3d42b1 --- /dev/null +++ b/vendor/github.com/nats-io/jwt/go.mod @@ -0,0 +1,3 @@ +module github.com/nats-io/jwt + +require github.com/nats-io/nkeys v0.0.2 diff --git a/vendor/github.com/nats-io/jwt/go.sum b/vendor/github.com/nats-io/jwt/go.sum new file mode 100644 index 00000000..862d5938 --- /dev/null +++ b/vendor/github.com/nats-io/jwt/go.sum @@ -0,0 +1,6 @@ +github.com/nats-io/nkeys v0.0.1 h1:D8diORXpjJEBxbDeeBtr4+drc4Ydzf4THJDVamDbd/g= +github.com/nats-io/nkeys v0.0.1/go.mod h1:/5AG7AMgoe6jJRxS8l8qz974c6zxp5ApcV7VkXwSciY= +github.com/nats-io/nkeys v0.0.2 h1:+qM7QpgXnvDDixitZtQUBDY9w/s9mu1ghS+JIbsrx6M= +github.com/nats-io/nkeys v0.0.2/go.mod h1:dab7URMsZm6Z/jp9Z5UGa87Uutgc2mVpXLC4B7TDb/4= +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 h1:mKdxBk7AujPs8kU4m80U72y/zjbZ3UcXC7dClwKbUI0= +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= diff --git a/vendor/github.com/nats-io/jwt/header.go b/vendor/github.com/nats-io/jwt/header.go index 7865d111..aabb89b0 100644 --- a/vendor/github.com/nats-io/jwt/header.go +++ b/vendor/github.com/nats-io/jwt/header.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018-2019 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( @@ -7,8 +22,8 @@ import ( ) const ( - // Version - Version = "0.0.5" + // Version is semantic version. + Version = "0.1.0" // TokenTypeJwt is the JWT token type supported JWT tokens // encoded and decoded by this library diff --git a/vendor/github.com/nats-io/jwt/imports.go b/vendor/github.com/nats-io/jwt/imports.go index 2aaced9c..c93048b2 100644 --- a/vendor/github.com/nats-io/jwt/imports.go +++ b/vendor/github.com/nats-io/jwt/imports.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/operator_claims.go b/vendor/github.com/nats-io/jwt/operator_claims.go index f03269ba..8eef305e 100644 --- a/vendor/github.com/nats-io/jwt/operator_claims.go +++ b/vendor/github.com/nats-io/jwt/operator_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/revocation_claims.go b/vendor/github.com/nats-io/jwt/revocation_claims.go index 2f86b294..20f4ad81 100644 --- a/vendor/github.com/nats-io/jwt/revocation_claims.go +++ b/vendor/github.com/nats-io/jwt/revocation_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/server_claims.go b/vendor/github.com/nats-io/jwt/server_claims.go index a62f830f..12f6dd71 100644 --- a/vendor/github.com/nats-io/jwt/server_claims.go +++ b/vendor/github.com/nats-io/jwt/server_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/types.go b/vendor/github.com/nats-io/jwt/types.go index 4383f5cc..8a7230dd 100644 --- a/vendor/github.com/nats-io/jwt/types.go +++ b/vendor/github.com/nats-io/jwt/types.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/user_claims.go b/vendor/github.com/nats-io/jwt/user_claims.go index 34e63035..7a8e8dae 100644 --- a/vendor/github.com/nats-io/jwt/user_claims.go +++ b/vendor/github.com/nats-io/jwt/user_claims.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/jwt/validation.go b/vendor/github.com/nats-io/jwt/validation.go index c725218c..c87a9922 100644 --- a/vendor/github.com/nats-io/jwt/validation.go +++ b/vendor/github.com/nats-io/jwt/validation.go @@ -1,3 +1,18 @@ +/* + * Copyright 2018 The NATS Authors + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + package jwt import ( diff --git a/vendor/github.com/nats-io/nkeys/.gitignore b/vendor/github.com/nats-io/nkeys/.gitignore new file mode 100644 index 00000000..9dca5eb4 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/.gitignore @@ -0,0 +1,15 @@ +# Binaries for programs and plugins +*.exe +*.dll +*.so +*.dylib +build/ + +# Test binary, build with `go test -c` +*.test + +# Output of the go coverage tool, specifically when used with LiteIDE +*.out + +# Project-local glide cache, RE: https://github.com/Masterminds/glide/issues/736 +.glide/ diff --git a/vendor/github.com/nats-io/nkeys/.goreleaser.yml b/vendor/github.com/nats-io/nkeys/.goreleaser.yml new file mode 100644 index 00000000..6df08bec --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/.goreleaser.yml @@ -0,0 +1,38 @@ +project_name: nkeys +release: + github: + owner: nats-io + name: nkeys + name_template: '{{.Tag}}' + draft: true +builds: + - main: ./nk/main.go + ldflags: "-X main.Version={{.Tag}}_{{.Commit}}" + binary: nk + goos: + - linux + - darwin + goarch: + - amd64 + + +dist: build + +archive: + wrap_in_directory: true + name_template: '{{ .ProjectName }}-v{{ .Version }}-{{ .Os }}-{{ .Arch }}{{ if .Arm + }}v{{ .Arm }}{{ end }}' + format: zip + +checksum: + name_template: '{{ .ProjectName }}-v{{ .Version }}-checksums.txt' + +snapshot: + name_template: 'dev' + +nfpm: + formats: + - deb + bindir: /usr/local/bin + description: NKeys utility cli program + vendor: nats-io diff --git a/vendor/github.com/nats-io/nkeys/.travis.yml b/vendor/github.com/nats-io/nkeys/.travis.yml new file mode 100644 index 00000000..59041cd6 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/.travis.yml @@ -0,0 +1,32 @@ +language: go +sudo: false +go: +- 1.11 +- 1.10.x +- 1.9.x + +install: +- go get -t ./... +- go get github.com/mattn/goveralls +- go get -u honnef.co/go/tools/cmd/megacheck +- go get -u github.com/client9/misspell/cmd/misspell + +before_script: +- $(exit $(go fmt ./... | wc -l)) +- go vet ./... +- misspell -error -locale US . +- megacheck -ignore "$(cat staticcheck.ignore)" ./... + +script: +- go test -v +- go test -v --race +- go test -v -covermode=count -coverprofile=coverage.out +- $HOME/gopath/bin/goveralls -coverprofile coverage.out -service travis-ci + +#deploy: +#- provider: script +# skip_cleanup: true +# script: curl -sL http://git.io/goreleaser | bash +# on: +# tags: true +# condition: $TRAVIS_OS_NAME = linux \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/GOVERNANCE.md b/vendor/github.com/nats-io/nkeys/GOVERNANCE.md new file mode 100644 index 00000000..744d3bc2 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/GOVERNANCE.md @@ -0,0 +1,3 @@ +# NATS NKEYS Governance + +NATS NKEYS is part of the NATS project and is subject to the [NATS Governance](https://github.com/nats-io/nats-general/blob/master/GOVERNANCE.md). \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/MAINTAINERS.md b/vendor/github.com/nats-io/nkeys/MAINTAINERS.md new file mode 100644 index 00000000..6d0ed3e3 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/MAINTAINERS.md @@ -0,0 +1,6 @@ +# Maintainers + +Maintainership is on a per project basis. + +### Core-maintainers + - Derek Collison [@derekcollison](https://github.com/derekcollison) \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/README.md b/vendor/github.com/nats-io/nkeys/README.md new file mode 100644 index 00000000..5cb87861 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/README.md @@ -0,0 +1,72 @@ +# NKEYS + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![ReportCard](http://goreportcard.com/badge/nats-io/nkeys)](http://goreportcard.com/report/nats-io/nkeys) +[![Build Status](https://travis-ci.org/nats-io/nkeys.svg?branch=master)](http://travis-ci.org/nats-io/nkeys) +[![GoDoc](http://godoc.org/github.com/nats-io/nkeys?status.svg)](http://godoc.org/github.com/nats-io/nkeys) +[![Coverage Status](https://coveralls.io/repos/github/nats-io/nkeys/badge.svg?branch=master&service=github)](https://coveralls.io/github/nats-io/nkeys?branch=master) +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys.svg?type=shield)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys?ref=badge_shield) + +A public-key signature system based on [Ed25519](https://ed25519.cr.yp.to/) for the NATS ecosystem. + +## About + +The NATS ecosystem will be moving to [Ed25519](https://ed25519.cr.yp.to/) keys for identity, authentication and authorization for entities such as Accounts, Users, Servers and Clusters. + +Ed25519 is fast and resistant to side channel attacks. Generation of a seed key is all that is needed to be stored and kept safe, as the seed can generate both the public and private keys. + +The NATS system will utilize Ed25519 keys, meaning that NATS systems will never store or even have access to any private keys. Authentication will utilize a random challenge response mechanism. + +Dealing with 32 byte and 64 byte raw keys can be challenging. NKEYS is designed to formulate keys in a much friendlier fashion and references work done in cryptocurrencies, specifically [Stellar](https://www.stellar.org/). Bitcoin and others used a form of Base58 (or Base58Check) to endode raw keys. Stellar utilized a more traditonal Base32 with a CRC16 and a version or prefix byte. NKEYS utilizes a similar format where the prefix will be 1 byte for public and private keys and will be 2 bytes for seeds. The base32 encoding of these prefixes will yield friendly human readbable prefixes, e.g. '**N**' = server, '**C**' = cluster, '**O**' = operator, '**A**' = account, and '**U**' = user. '**P**' is used for private keys. For seeds, the first encoded prefix is '**S**', and the second character will be the type for the public key, e.g. "**SU**" is a seed for a user key pair, "**SA**" is a seed for an account key pair. + +## Installation + +Use the `go` command: + + $ go get github.com/nats-io/nkeys + +## nk - Command Line Utility + +Located under the nk [directory](https://github.com/nats-io/nkeys/tree/master/nk). + +## Basic API Usage +```go + +// Create a new User KeyPair +user, _ := nkeys.CreateUser() + +// Sign some data with a full key pair user. +data := []byte("Hello World") +sig, _ := user.Sign(data) + +// Verify the signature. +err = user.Verify(data, sig) + +// Access the seed, the only thing that needs to be stored and kept safe. +// seed = "SUAKYRHVIOREXV7EUZTBHUHL7NUMHPMAS7QMDU3GTIUWEI5LDNOXD43IZY" +seed, _ := user.Seed() + +// Access the public key which can be shared. +// publicKey = "UD466L6EBCM3YY5HEGHJANNTN4LSKTSUXTH7RILHCKEQMQHTBNLHJJXT" +publicKey, _ := user.PublicKey() + +// Create a full User who can sign and verify from a private seed. +user, _ = nkeys.FromSeed(seed) + +// Create a User who can only verify signatures via a public key. +user, _ = nkeys.FromPublicKey(publicKey) + +// Create a User KeyPair with our own random data. +var rawSeed [32]byte +_, err := io.ReadFull(rand.Reader, rawSeed[:]) // Or some other random source. +user2, _ := nkeys.FromRawSeed(PrefixByteUser, rawSeed) + +``` + +## License + +Unless otherwise noted, the NATS source files are distributed +under the Apache Version 2.0 license found in the LICENSE file. + + +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys.svg?type=large)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys?ref=badge_large) \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/TODO.md b/vendor/github.com/nats-io/nkeys/TODO.md new file mode 100644 index 00000000..2649c9e5 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/TODO.md @@ -0,0 +1,5 @@ + +# General + +- [ ] Child key derivation +- [ ] Hardware support, e.g. YubiHSM diff --git a/vendor/github.com/nats-io/nkeys/go.mod b/vendor/github.com/nats-io/nkeys/go.mod new file mode 100644 index 00000000..64a700af --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/go.mod @@ -0,0 +1,3 @@ +module github.com/nats-io/nkeys + +require golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 diff --git a/vendor/github.com/nats-io/nkeys/go.sum b/vendor/github.com/nats-io/nkeys/go.sum new file mode 100644 index 00000000..8c4e7ae9 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/go.sum @@ -0,0 +1,2 @@ +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 h1:mKdxBk7AujPs8kU4m80U72y/zjbZ3UcXC7dClwKbUI0= +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= diff --git a/vendor/github.com/nats-io/nkeys/nk/main.go b/vendor/github.com/nats-io/nkeys/nk/main.go deleted file mode 100644 index 410668a3..00000000 --- a/vendor/github.com/nats-io/nkeys/nk/main.go +++ /dev/null @@ -1,288 +0,0 @@ -// Copyright 2018 The NATS Authors -// Licensed under the Apache License, Version 2.0 (the "License"); -// you may not use this file except in compliance with the License. -// You may obtain a copy of the License at -// -// http://www.apache.org/licenses/LICENSE-2.0 -// -// Unless required by applicable law or agreed to in writing, software -// distributed under the License is distributed on an "AS IS" BASIS, -// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -// See the License for the specific language governing permissions and -// limitations under the License. - -package main - -import ( - "bytes" - "crypto/rand" - "encoding/base32" - "encoding/base64" - "flag" - "fmt" - "io" - "io/ioutil" - "log" - "os" - "strings" - - "github.com/nats-io/nkeys" -) - -// this will be set during compilation when a release is made on tools -var Version string - -func usage() { - log.Fatalf("Usage: nk [-v] [-gen type] [-sign file] [-verify file] [-inkey keyfile] [-pubin keyfile] [-sigfile file] [-pubout] [-e entropy]\n") -} - -func main() { - var entropy = flag.String("e", "", "Entropy file, e.g. /dev/urandom") - var keyFile = flag.String("inkey", "", "Input key file (seed/private key)") - var pubFile = flag.String("pubin", "", "Public key file") - - var signFile = flag.String("sign", "", "Sign with -inkey ") - var sigFile = flag.String("sigfile", "", "Signature file") - - var verifyFile = flag.String("verify", "", "Verfify with -inkey or -pubin and -sigfile ") - - var keyType = flag.String("gen", "", "Generate key for , e.g. nk -gen user") - var pubout = flag.Bool("pubout", false, "Output public key") - - var version = flag.Bool("v", false, "Show version") - var vanPre = flag.String("pre", "", "Attempt to generate public key given prefix, e.g. nk -gen user -pre derek") - var vanMax = flag.Int("maxpre", 1000000, "Maximum attempts at generating the correct key prefix") - - log.SetFlags(0) - log.SetOutput(os.Stdout) - - flag.Usage = usage - flag.Parse() - - if *version { - fmt.Printf("nk version %s\n", Version) - } - - // Create Key - if *keyType != "" { - var kp nkeys.KeyPair - // Check to see if we are trying to do a vanity public key. - if *vanPre != "" { - kp = createVanityKey(*keyType, *vanPre, *entropy, *vanMax) - } else { - kp = genKeyPair(preForType(*keyType), *entropy) - } - seed, err := kp.Seed() - if err != nil { - log.Fatal(err) - } - log.Printf("%s", seed) - if *pubout || *vanPre != "" { - pub, _ := kp.PublicKey() - log.Printf("%s", pub) - } - return - } - - if *entropy != "" { - log.Fatalf("Entropy file only used when creating keys with -gen") - } - - // Sign - if *signFile != "" { - sign(*signFile, *keyFile) - return - } - - // Verfify - if *verifyFile != "" { - verify(*verifyFile, *keyFile, *pubFile, *sigFile) - return - } - - // Show public key from seed/private - if *keyFile != "" && *pubout { - printPublicFromSeed(*keyFile) - return - } - - usage() -} - -func printPublicFromSeed(keyFile string) { - seed := readKeyFile(keyFile) - kp, err := nkeys.FromSeed(seed) - if err != nil { - log.Fatal(err) - } - pub, _ := kp.PublicKey() - log.Printf("%s", pub) -} - -func sign(fname, keyFile string) { - if keyFile == "" { - log.Fatalf("Sign requires a seed/private key via -inkey ") - } - seed := readKeyFile(keyFile) - kp, err := nkeys.FromSeed(seed) - if err != nil { - log.Fatal(err) - } - - content, err := ioutil.ReadFile(fname) - if err != nil { - log.Fatal(err) - } - - sigraw, err := kp.Sign(content) - if err != nil { - log.Fatal(err) - } - log.Printf("%s", base64.StdEncoding.EncodeToString(sigraw)) -} - -func verify(fname, keyFile, pubFile, sigFile string) { - if keyFile == "" && pubFile == "" { - log.Fatalf("Verify requires a seed key via -inkey or a public key via -pubin") - } - if sigFile == "" { - log.Fatalf("Verify requires a signature via -sigfile") - } - var err error - var kp nkeys.KeyPair - if keyFile != "" { - var seed []byte - seed, err = ioutil.ReadFile(keyFile) - if err != nil { - log.Fatal(err) - } - kp, err = nkeys.FromSeed(seed) - } else { - // Public Key - var public []byte - public, err = ioutil.ReadFile(pubFile) - if err != nil { - log.Fatal(err) - } - kp, err = nkeys.FromPublicKey(string(public)) - } - if err != nil { - log.Fatal(err) - } - - content, err := ioutil.ReadFile(fname) - if err != nil { - log.Fatal(err) - } - - sigEnc, err := ioutil.ReadFile(sigFile) - if err != nil { - log.Fatal(err) - } - sig, err := base64.StdEncoding.DecodeString(string(sigEnc)) - if err != nil { - log.Fatal(err) - } - if err := kp.Verify(content, sig); err != nil { - log.Fatal(err) - } - log.Printf("Verified OK") -} - -func preForType(keyType string) nkeys.PrefixByte { - keyType = strings.ToLower(keyType) - switch keyType { - case "user": - return nkeys.PrefixByteUser - case "account": - return nkeys.PrefixByteAccount - case "server": - return nkeys.PrefixByteServer - case "cluster": - return nkeys.PrefixByteCluster - case "operator": - return nkeys.PrefixByteOperator - default: - log.Fatalf("Usage: nk -gen [user|account|server|cluster|operator]\n") - } - return nkeys.PrefixByte(0) -} - -func genKeyPair(pre nkeys.PrefixByte, entropy string) nkeys.KeyPair { - // See if we override entropy. - ef := rand.Reader - if entropy != "" { - r, err := os.Open(entropy) - if err != nil { - log.Fatal(err) - } - ef = r - } - - // Create raw seed from source or random. - var rawSeed [32]byte - _, err := io.ReadFull(ef, rawSeed[:]) // Or some other random source. - if err != nil { - log.Fatalf("Error reading from %s: %v", ef, err) - } - kp, err := nkeys.FromRawSeed(pre, rawSeed[:]) - if err != nil { - log.Fatalf("Error creating %c: %v", pre, err) - } - return kp -} - -var b32Enc = base32.StdEncoding.WithPadding(base32.NoPadding) - -func createVanityKey(keyType, vanity, entropy string, max int) nkeys.KeyPair { - spinners := []rune(`⠋⠙⠹⠸⠼⠴⠦⠧⠇⠏`) - pre := preForType(keyType) - vanity = strings.ToUpper(vanity) - // Check to make sure we can base32 into it by trying to decode it. - _, err := b32Enc.DecodeString(vanity) - if err != nil { - log.Fatalf("Can not generate base32 encoded strings to match '%s'", vanity) - } - - for i := 0; i < max; i++ { - spin := spinners[i%len(spinners)] - fmt.Fprintf(os.Stderr, "\r\033[mcomputing\033[m %s ", string(spin)) - kp := genKeyPair(pre, entropy) - pub, _ := kp.PublicKey() - if strings.HasPrefix(pub[1:], vanity) { - fmt.Fprintf(os.Stderr, "\r") - return kp - } - } - fmt.Fprintf(os.Stderr, "\r") - log.Fatalf("Failed to generate prefix after %d attempts", max) - return nil -} - -func readKeyFile(filename string) []byte { - var key []byte - contents, err := ioutil.ReadFile(filename) - if err != nil { - log.Fatal(err) - } - defer wipeSlice(contents) - - lines := bytes.Split(contents, []byte("\n")) - for _, line := range lines { - if nkeys.IsValidEncoding(line) { - key = make([]byte, len(line)) - copy(key, line) - return key - } - } - if key == nil { - log.Fatalf("Could not find a valid key") - } - return key -} - -func wipeSlice(buf []byte) { - for i := range buf { - buf[i] = 'x' - } -} diff --git a/vendor/github.com/nats-io/nuid/.gitignore b/vendor/github.com/nats-io/nuid/.gitignore new file mode 100644 index 00000000..daf913b1 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/.gitignore @@ -0,0 +1,24 @@ +# Compiled Object files, Static and Dynamic libs (Shared Objects) +*.o +*.a +*.so + +# Folders +_obj +_test + +# Architecture specific extensions/prefixes +*.[568vq] +[568vq].out + +*.cgo1.go +*.cgo2.c +_cgo_defun.c +_cgo_gotypes.go +_cgo_export.* + +_testmain.go + +*.exe +*.test +*.prof diff --git a/vendor/github.com/nats-io/nuid/.travis.yml b/vendor/github.com/nats-io/nuid/.travis.yml new file mode 100644 index 00000000..52be7265 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/.travis.yml @@ -0,0 +1,17 @@ +language: go +sudo: false +go: +- 1.9.x +- 1.10.x + +install: +- go get -t ./... +- go get github.com/mattn/goveralls + +script: +- go fmt ./... +- go vet ./... +- go test -v +- go test -v --race +- go test -v -covermode=count -coverprofile=coverage.out +- $HOME/gopath/bin/goveralls -coverprofile coverage.out -service travis-ci diff --git a/vendor/github.com/nats-io/nuid/README.md b/vendor/github.com/nats-io/nuid/README.md new file mode 100644 index 00000000..16e53948 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/README.md @@ -0,0 +1,47 @@ +# NUID + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![ReportCard](http://goreportcard.com/badge/nats-io/nuid)](http://goreportcard.com/report/nats-io/nuid) +[![Build Status](https://travis-ci.org/nats-io/nuid.svg?branch=master)](http://travis-ci.org/nats-io/nuid) +[![Release](https://img.shields.io/badge/release-v1.0.1-1eb0fc.svg)](https://github.com/nats-io/nuid/releases/tag/v1.0.1) +[![GoDoc](http://godoc.org/github.com/nats-io/nuid?status.png)](http://godoc.org/github.com/nats-io/nuid) +[![Coverage Status](https://coveralls.io/repos/github/nats-io/nuid/badge.svg?branch=master)](https://coveralls.io/github/nats-io/nuid?branch=master) + +A highly performant unique identifier generator. + +## Installation + +Use the `go` command: + + $ go get github.com/nats-io/nuid + +## Basic Usage +```go + +// Utilize the global locked instance +nuid := nuid.Next() + +// Create an instance, these are not locked. +n := nuid.New() +nuid = n.Next() + +// Generate a new crypto/rand seeded prefix. +// Generally not needed, happens automatically. +n.RandomizePrefix() +``` + +## Performance +NUID needs to be very fast to generate and be truly unique, all while being entropy pool friendly. +NUID uses 12 bytes of crypto generated data (entropy draining), and 10 bytes of pseudo-random +sequential data that increments with a pseudo-random increment. + +Total length of a NUID string is 22 bytes of base 62 ascii text, so 62^22 or +2707803647802660400290261537185326956544 possibilities. + +NUID can generate identifiers as fast as 60ns, or ~16 million per second. There is an associated +benchmark you can use to test performance on your own hardware. + +## License + +Unless otherwise noted, the NATS source files are distributed +under the Apache Version 2.0 license found in the LICENSE file. diff --git a/vendor/github.com/nats-io/nuid/nuid.go b/vendor/github.com/nats-io/nuid/nuid.go index d79e9ce1..8134c764 100644 --- a/vendor/github.com/nats-io/nuid/nuid.go +++ b/vendor/github.com/nats-io/nuid/nuid.go @@ -1,4 +1,4 @@ -// Copyright 2016-2018 The NATS Authors +// Copyright 2016-2019 The NATS Authors // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at @@ -31,7 +31,7 @@ import ( // Total is 22 bytes of base 62 ascii text :) // Version of the library -const Version = "1.0.0" +const Version = "1.0.1" const ( digits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz" @@ -105,7 +105,7 @@ func (n *NUID) Next() string { bs := b[:preLen] copy(bs, n.pre) - // copy in the seq in base36. + // copy in the seq in base62. for i, l := len(b), seq; i > preLen; l /= base { i -= 1 b[i] = digits[l%base] diff --git a/vendor/golang.org/x/crypto/AUTHORS b/vendor/golang.org/x/crypto/AUTHORS new file mode 100644 index 00000000..2b00ddba --- /dev/null +++ b/vendor/golang.org/x/crypto/AUTHORS @@ -0,0 +1,3 @@ +# This source code refers to The Go Authors for copyright purposes. +# The master list of authors is in the main Go distribution, +# visible at https://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/crypto/CONTRIBUTORS b/vendor/golang.org/x/crypto/CONTRIBUTORS new file mode 100644 index 00000000..1fbd3e97 --- /dev/null +++ b/vendor/golang.org/x/crypto/CONTRIBUTORS @@ -0,0 +1,3 @@ +# This source code was written by the Go contributors. +# The master list of contributors is in the main Go distribution, +# visible at https://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/crypto/bcrypt/LICENSE b/vendor/golang.org/x/crypto/LICENSE similarity index 100% rename from vendor/golang.org/x/crypto/bcrypt/LICENSE rename to vendor/golang.org/x/crypto/LICENSE diff --git a/vendor/golang.org/x/crypto/PATENTS b/vendor/golang.org/x/crypto/PATENTS new file mode 100644 index 00000000..73309904 --- /dev/null +++ b/vendor/golang.org/x/crypto/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/crypto/blowfish/cipher.go b/vendor/golang.org/x/crypto/blowfish/cipher.go index 2641dadd..213bf204 100644 --- a/vendor/golang.org/x/crypto/blowfish/cipher.go +++ b/vendor/golang.org/x/crypto/blowfish/cipher.go @@ -3,6 +3,14 @@ // license that can be found in the LICENSE file. // Package blowfish implements Bruce Schneier's Blowfish encryption algorithm. +// +// Blowfish is a legacy cipher and its short block size makes it vulnerable to +// birthday bound attacks (see https://sweet32.info). It should only be used +// where compatibility with legacy systems, not security, is the goal. +// +// Deprecated: any new system should use AES (from crypto/aes, if necessary in +// an AEAD mode like crypto/cipher.NewGCM) or XChaCha20-Poly1305 (from +// golang.org/x/crypto/chacha20poly1305). package blowfish // import "golang.org/x/crypto/blowfish" // The code is a port of Bruce Schneier's C implementation. diff --git a/vendor/golang.org/x/crypto/ed25519/LICENSE b/vendor/golang.org/x/crypto/ed25519/LICENSE deleted file mode 100644 index 6a66aea5..00000000 --- a/vendor/golang.org/x/crypto/ed25519/LICENSE +++ /dev/null @@ -1,27 +0,0 @@ -Copyright (c) 2009 The Go Authors. All rights reserved. - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions are -met: - - * Redistributions of source code must retain the above copyright -notice, this list of conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above -copyright notice, this list of conditions and the following disclaimer -in the documentation and/or other materials provided with the -distribution. - * Neither the name of Google Inc. nor the names of its -contributors may be used to endorse or promote products derived from -this software without specific prior written permission. - -THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS -"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT -LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR -A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT -OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, -SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT -LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, -DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY -THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT -(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE -OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/sys/AUTHORS b/vendor/golang.org/x/sys/AUTHORS new file mode 100644 index 00000000..15167cd7 --- /dev/null +++ b/vendor/golang.org/x/sys/AUTHORS @@ -0,0 +1,3 @@ +# This source code refers to The Go Authors for copyright purposes. +# The master list of authors is in the main Go distribution, +# visible at http://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/sys/CONTRIBUTORS b/vendor/golang.org/x/sys/CONTRIBUTORS new file mode 100644 index 00000000..1c4577e9 --- /dev/null +++ b/vendor/golang.org/x/sys/CONTRIBUTORS @@ -0,0 +1,3 @@ +# This source code was written by the Go contributors. +# The master list of contributors is in the main Go distribution, +# visible at http://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/crypto/blowfish/LICENSE b/vendor/golang.org/x/sys/LICENSE similarity index 100% rename from vendor/golang.org/x/crypto/blowfish/LICENSE rename to vendor/golang.org/x/sys/LICENSE diff --git a/vendor/golang.org/x/sys/PATENTS b/vendor/golang.org/x/sys/PATENTS new file mode 100644 index 00000000..73309904 --- /dev/null +++ b/vendor/golang.org/x/sys/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/sys/windows/LICENSE b/vendor/golang.org/x/sys/windows/LICENSE deleted file mode 100644 index 6a66aea5..00000000 --- a/vendor/golang.org/x/sys/windows/LICENSE +++ /dev/null @@ -1,27 +0,0 @@ -Copyright (c) 2009 The Go Authors. All rights reserved. - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions are -met: - - * Redistributions of source code must retain the above copyright -notice, this list of conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above -copyright notice, this list of conditions and the following disclaimer -in the documentation and/or other materials provided with the -distribution. - * Neither the name of Google Inc. nor the names of its -contributors may be used to endorse or promote products derived from -this software without specific prior written permission. - -THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS -"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT -LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR -A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT -OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, -SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT -LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, -DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY -THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT -(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE -OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/sys/windows/aliases.go b/vendor/golang.org/x/sys/windows/aliases.go new file mode 100644 index 00000000..af3af60d --- /dev/null +++ b/vendor/golang.org/x/sys/windows/aliases.go @@ -0,0 +1,13 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows +// +build go1.9 + +package windows + +import "syscall" + +type Errno = syscall.Errno +type SysProcAttr = syscall.SysProcAttr diff --git a/vendor/golang.org/x/sys/windows/asm_windows_386.s b/vendor/golang.org/x/sys/windows/asm_windows_386.s index 1c20dd2f..21d994d3 100644 --- a/vendor/golang.org/x/sys/windows/asm_windows_386.s +++ b/vendor/golang.org/x/sys/windows/asm_windows_386.s @@ -6,8 +6,8 @@ // System calls for 386, Windows are implemented in runtime/syscall_windows.goc // -TEXT ·getprocaddress(SB), 7, $0-8 +TEXT ·getprocaddress(SB), 7, $0-16 JMP syscall·getprocaddress(SB) -TEXT ·loadlibrary(SB), 7, $0-4 +TEXT ·loadlibrary(SB), 7, $0-12 JMP syscall·loadlibrary(SB) diff --git a/vendor/golang.org/x/sys/windows/asm_windows_amd64.s b/vendor/golang.org/x/sys/windows/asm_windows_amd64.s index 4d025ab5..5bfdf797 100644 --- a/vendor/golang.org/x/sys/windows/asm_windows_amd64.s +++ b/vendor/golang.org/x/sys/windows/asm_windows_amd64.s @@ -9,5 +9,5 @@ TEXT ·getprocaddress(SB), 7, $0-32 JMP syscall·getprocaddress(SB) -TEXT ·loadlibrary(SB), 7, $0-8 +TEXT ·loadlibrary(SB), 7, $0-24 JMP syscall·loadlibrary(SB) diff --git a/vendor/golang.org/x/sys/windows/asm_windows_arm.s b/vendor/golang.org/x/sys/windows/asm_windows_arm.s new file mode 100644 index 00000000..55d8b91a --- /dev/null +++ b/vendor/golang.org/x/sys/windows/asm_windows_arm.s @@ -0,0 +1,11 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +#include "textflag.h" + +TEXT ·getprocaddress(SB),NOSPLIT,$0 + B syscall·getprocaddress(SB) + +TEXT ·loadlibrary(SB),NOSPLIT,$0 + B syscall·loadlibrary(SB) diff --git a/vendor/golang.org/x/sys/windows/dll_windows.go b/vendor/golang.org/x/sys/windows/dll_windows.go index 0f620467..ba67658d 100644 --- a/vendor/golang.org/x/sys/windows/dll_windows.go +++ b/vendor/golang.org/x/sys/windows/dll_windows.go @@ -1,4 +1,4 @@ -// Copyright 2011 The Go Authors. All rights reserved. +// Copyright 2011 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -116,7 +116,7 @@ func (p *Proc) Addr() uintptr { //go:uintptrescapes -// Call executes procedure p with arguments a. It will panic, if more then 15 arguments +// Call executes procedure p with arguments a. It will panic, if more than 15 arguments // are supplied. // // The returned error is always non-nil, constructed from the result of GetLastError. @@ -160,7 +160,6 @@ func (p *Proc) Call(a ...uintptr) (r1, r2 uintptr, lastErr error) { default: panic("Call " + p.Name + " with too many arguments " + itoa(len(a)) + ".") } - return } // A LazyDLL implements access to a single DLL. @@ -290,6 +289,7 @@ func (p *LazyProc) mustFind() { // Addr returns the address of the procedure represented by p. // The return value can be passed to Syscall to run the procedure. +// It will panic if the procedure cannot be found. func (p *LazyProc) Addr() uintptr { p.mustFind() return p.proc.Addr() @@ -297,8 +297,8 @@ func (p *LazyProc) Addr() uintptr { //go:uintptrescapes -// Call executes procedure p with arguments a. It will panic, if more then 15 arguments -// are supplied. +// Call executes procedure p with arguments a. It will panic, if more than 15 arguments +// are supplied. It will also panic if the procedure cannot be found. // // The returned error is always non-nil, constructed from the result of GetLastError. // Callers must inspect the primary return value to decide whether an error occurred @@ -359,11 +359,11 @@ func loadLibraryEx(name string, system bool) (*DLL, error) { // trying to load "foo.dll" out of the system // folder, but LoadLibraryEx doesn't support // that yet on their system, so emulate it. - windir, _ := Getenv("WINDIR") // old var; apparently works on XP - if windir == "" { - return nil, errString("%WINDIR% not defined") + systemdir, err := GetSystemDirectory() + if err != nil { + return nil, err } - loadDLL = windir + "\\System32\\" + name + loadDLL = systemdir + "\\" + name } } h, err := LoadLibraryEx(loadDLL, 0, flags) diff --git a/vendor/golang.org/x/sys/windows/env_unset.go b/vendor/golang.org/x/sys/windows/env_unset.go deleted file mode 100644 index 4ed03aee..00000000 --- a/vendor/golang.org/x/sys/windows/env_unset.go +++ /dev/null @@ -1,15 +0,0 @@ -// Copyright 2014 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows -// +build go1.4 - -package windows - -import "syscall" - -func Unsetenv(key string) error { - // This was added in Go 1.4. - return syscall.Unsetenv(key) -} diff --git a/vendor/golang.org/x/sys/windows/env_windows.go b/vendor/golang.org/x/sys/windows/env_windows.go index a9d8ef4b..bdc71e24 100644 --- a/vendor/golang.org/x/sys/windows/env_windows.go +++ b/vendor/golang.org/x/sys/windows/env_windows.go @@ -1,4 +1,4 @@ -// Copyright 2010 The Go Authors. All rights reserved. +// Copyright 2010 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -23,3 +23,7 @@ func Clearenv() { func Environ() []string { return syscall.Environ() } + +func Unsetenv(key string) error { + return syscall.Unsetenv(key) +} diff --git a/vendor/golang.org/x/sys/windows/memory_windows.go b/vendor/golang.org/x/sys/windows/memory_windows.go new file mode 100644 index 00000000..f80a4204 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/memory_windows.go @@ -0,0 +1,26 @@ +// Copyright 2017 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package windows + +const ( + MEM_COMMIT = 0x00001000 + MEM_RESERVE = 0x00002000 + MEM_DECOMMIT = 0x00004000 + MEM_RELEASE = 0x00008000 + MEM_RESET = 0x00080000 + MEM_TOP_DOWN = 0x00100000 + MEM_WRITE_WATCH = 0x00200000 + MEM_PHYSICAL = 0x00400000 + MEM_RESET_UNDO = 0x01000000 + MEM_LARGE_PAGES = 0x20000000 + + PAGE_NOACCESS = 0x01 + PAGE_READONLY = 0x02 + PAGE_READWRITE = 0x04 + PAGE_WRITECOPY = 0x08 + PAGE_EXECUTE_READ = 0x20 + PAGE_EXECUTE_READWRITE = 0x40 + PAGE_EXECUTE_WRITECOPY = 0x80 +) diff --git a/vendor/golang.org/x/sys/windows/mksyscall.go b/vendor/golang.org/x/sys/windows/mksyscall.go index e1c88c9c..fb7db0ef 100644 --- a/vendor/golang.org/x/sys/windows/mksyscall.go +++ b/vendor/golang.org/x/sys/windows/mksyscall.go @@ -1,4 +1,4 @@ -// Copyright 2009 The Go Authors. All rights reserved. +// Copyright 2009 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/race.go b/vendor/golang.org/x/sys/windows/race.go index 343e18ab..a74e3e24 100644 --- a/vendor/golang.org/x/sys/windows/race.go +++ b/vendor/golang.org/x/sys/windows/race.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/race0.go b/vendor/golang.org/x/sys/windows/race0.go index 17af843b..e44a3cbf 100644 --- a/vendor/golang.org/x/sys/windows/race0.go +++ b/vendor/golang.org/x/sys/windows/race0.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/registry/key.go b/vendor/golang.org/x/sys/windows/registry/key.go index d0beb195..c2564834 100644 --- a/vendor/golang.org/x/sys/windows/registry/key.go +++ b/vendor/golang.org/x/sys/windows/registry/key.go @@ -113,12 +113,10 @@ func OpenRemoteKey(pcname string, k Key) (Key, error) { // The parameter n controls the number of returned names, // analogous to the way os.File.Readdirnames works. func (k Key) ReadSubKeyNames(n int) ([]string, error) { - ki, err := k.Stat() - if err != nil { - return nil, err - } - names := make([]string, 0, ki.SubKeyCount) - buf := make([]uint16, ki.MaxSubKeyLen+1) // extra room for terminating zero byte + names := make([]string, 0) + // Registry key size limit is 255 bytes and described there: + // https://msdn.microsoft.com/library/windows/desktop/ms724872.aspx + buf := make([]uint16, 256) //plus extra room for terminating zero byte loopItems: for i := uint32(0); ; i++ { if n > 0 { diff --git a/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go index ceebdd77..3778075d 100644 --- a/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go @@ -1,4 +1,4 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT +// Code generated by 'go generate'; DO NOT EDIT. package registry diff --git a/vendor/golang.org/x/sys/windows/security_windows.go b/vendor/golang.org/x/sys/windows/security_windows.go index ca09bdd7..da06406c 100644 --- a/vendor/golang.org/x/sys/windows/security_windows.go +++ b/vendor/golang.org/x/sys/windows/security_windows.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -132,6 +132,36 @@ const ( SECURITY_NT_NON_UNIQUE_RID = 0x15 ) +// Predefined domain-relative RIDs for local groups. +// See https://msdn.microsoft.com/en-us/library/windows/desktop/aa379649(v=vs.85).aspx +const ( + DOMAIN_ALIAS_RID_ADMINS = 0x220 + DOMAIN_ALIAS_RID_USERS = 0x221 + DOMAIN_ALIAS_RID_GUESTS = 0x222 + DOMAIN_ALIAS_RID_POWER_USERS = 0x223 + DOMAIN_ALIAS_RID_ACCOUNT_OPS = 0x224 + DOMAIN_ALIAS_RID_SYSTEM_OPS = 0x225 + DOMAIN_ALIAS_RID_PRINT_OPS = 0x226 + DOMAIN_ALIAS_RID_BACKUP_OPS = 0x227 + DOMAIN_ALIAS_RID_REPLICATOR = 0x228 + DOMAIN_ALIAS_RID_RAS_SERVERS = 0x229 + DOMAIN_ALIAS_RID_PREW2KCOMPACCESS = 0x22a + DOMAIN_ALIAS_RID_REMOTE_DESKTOP_USERS = 0x22b + DOMAIN_ALIAS_RID_NETWORK_CONFIGURATION_OPS = 0x22c + DOMAIN_ALIAS_RID_INCOMING_FOREST_TRUST_BUILDERS = 0x22d + DOMAIN_ALIAS_RID_MONITORING_USERS = 0x22e + DOMAIN_ALIAS_RID_LOGGING_USERS = 0x22f + DOMAIN_ALIAS_RID_AUTHORIZATIONACCESS = 0x230 + DOMAIN_ALIAS_RID_TS_LICENSE_SERVERS = 0x231 + DOMAIN_ALIAS_RID_DCOM_USERS = 0x232 + DOMAIN_ALIAS_RID_IUSERS = 0x238 + DOMAIN_ALIAS_RID_CRYPTO_OPERATORS = 0x239 + DOMAIN_ALIAS_RID_CACHEABLE_PRINCIPALS_GROUP = 0x23b + DOMAIN_ALIAS_RID_NON_CACHEABLE_PRINCIPALS_GROUP = 0x23c + DOMAIN_ALIAS_RID_EVENT_LOG_READERS_GROUP = 0x23d + DOMAIN_ALIAS_RID_CERTSVC_DCOM_ACCESS_GROUP = 0x23e +) + //sys LookupAccountSid(systemName *uint16, sid *SID, name *uint16, nameLen *uint32, refdDomainName *uint16, refdDomainNameLen *uint32, use *uint32) (err error) = advapi32.LookupAccountSidW //sys LookupAccountName(systemName *uint16, accountName *uint16, sid *SID, sidLen *uint32, refdDomainName *uint16, refdDomainNameLen *uint32, use *uint32) (err error) = advapi32.LookupAccountNameW //sys ConvertSidToStringSid(sid *SID, stringSid **uint16) (err error) = advapi32.ConvertSidToStringSidW @@ -139,6 +169,7 @@ const ( //sys GetLengthSid(sid *SID) (len uint32) = advapi32.GetLengthSid //sys CopySid(destSidLen uint32, destSid *SID, srcSid *SID) (err error) = advapi32.CopySid //sys AllocateAndInitializeSid(identAuth *SidIdentifierAuthority, subAuth byte, subAuth0 uint32, subAuth1 uint32, subAuth2 uint32, subAuth3 uint32, subAuth4 uint32, subAuth5 uint32, subAuth6 uint32, subAuth7 uint32, sid **SID) (err error) = advapi32.AllocateAndInitializeSid +//sys createWellKnownSid(sidType WELL_KNOWN_SID_TYPE, domainSid *SID, sid *SID, sizeSid *uint32) (err error) = advapi32.CreateWellKnownSid //sys FreeSid(sid *SID) (err error) [failretval!=0] = advapi32.FreeSid //sys EqualSid(sid1 *SID, sid2 *SID) (isEqual bool) = advapi32.EqualSid @@ -256,6 +287,158 @@ func (sid *SID) LookupAccount(system string) (account, domain string, accType ui } } +// Various types of pre-specified sids that can be synthesized at runtime. +type WELL_KNOWN_SID_TYPE uint32 + +const ( + WinNullSid = 0 + WinWorldSid = 1 + WinLocalSid = 2 + WinCreatorOwnerSid = 3 + WinCreatorGroupSid = 4 + WinCreatorOwnerServerSid = 5 + WinCreatorGroupServerSid = 6 + WinNtAuthoritySid = 7 + WinDialupSid = 8 + WinNetworkSid = 9 + WinBatchSid = 10 + WinInteractiveSid = 11 + WinServiceSid = 12 + WinAnonymousSid = 13 + WinProxySid = 14 + WinEnterpriseControllersSid = 15 + WinSelfSid = 16 + WinAuthenticatedUserSid = 17 + WinRestrictedCodeSid = 18 + WinTerminalServerSid = 19 + WinRemoteLogonIdSid = 20 + WinLogonIdsSid = 21 + WinLocalSystemSid = 22 + WinLocalServiceSid = 23 + WinNetworkServiceSid = 24 + WinBuiltinDomainSid = 25 + WinBuiltinAdministratorsSid = 26 + WinBuiltinUsersSid = 27 + WinBuiltinGuestsSid = 28 + WinBuiltinPowerUsersSid = 29 + WinBuiltinAccountOperatorsSid = 30 + WinBuiltinSystemOperatorsSid = 31 + WinBuiltinPrintOperatorsSid = 32 + WinBuiltinBackupOperatorsSid = 33 + WinBuiltinReplicatorSid = 34 + WinBuiltinPreWindows2000CompatibleAccessSid = 35 + WinBuiltinRemoteDesktopUsersSid = 36 + WinBuiltinNetworkConfigurationOperatorsSid = 37 + WinAccountAdministratorSid = 38 + WinAccountGuestSid = 39 + WinAccountKrbtgtSid = 40 + WinAccountDomainAdminsSid = 41 + WinAccountDomainUsersSid = 42 + WinAccountDomainGuestsSid = 43 + WinAccountComputersSid = 44 + WinAccountControllersSid = 45 + WinAccountCertAdminsSid = 46 + WinAccountSchemaAdminsSid = 47 + WinAccountEnterpriseAdminsSid = 48 + WinAccountPolicyAdminsSid = 49 + WinAccountRasAndIasServersSid = 50 + WinNTLMAuthenticationSid = 51 + WinDigestAuthenticationSid = 52 + WinSChannelAuthenticationSid = 53 + WinThisOrganizationSid = 54 + WinOtherOrganizationSid = 55 + WinBuiltinIncomingForestTrustBuildersSid = 56 + WinBuiltinPerfMonitoringUsersSid = 57 + WinBuiltinPerfLoggingUsersSid = 58 + WinBuiltinAuthorizationAccessSid = 59 + WinBuiltinTerminalServerLicenseServersSid = 60 + WinBuiltinDCOMUsersSid = 61 + WinBuiltinIUsersSid = 62 + WinIUserSid = 63 + WinBuiltinCryptoOperatorsSid = 64 + WinUntrustedLabelSid = 65 + WinLowLabelSid = 66 + WinMediumLabelSid = 67 + WinHighLabelSid = 68 + WinSystemLabelSid = 69 + WinWriteRestrictedCodeSid = 70 + WinCreatorOwnerRightsSid = 71 + WinCacheablePrincipalsGroupSid = 72 + WinNonCacheablePrincipalsGroupSid = 73 + WinEnterpriseReadonlyControllersSid = 74 + WinAccountReadonlyControllersSid = 75 + WinBuiltinEventLogReadersGroup = 76 + WinNewEnterpriseReadonlyControllersSid = 77 + WinBuiltinCertSvcDComAccessGroup = 78 + WinMediumPlusLabelSid = 79 + WinLocalLogonSid = 80 + WinConsoleLogonSid = 81 + WinThisOrganizationCertificateSid = 82 + WinApplicationPackageAuthoritySid = 83 + WinBuiltinAnyPackageSid = 84 + WinCapabilityInternetClientSid = 85 + WinCapabilityInternetClientServerSid = 86 + WinCapabilityPrivateNetworkClientServerSid = 87 + WinCapabilityPicturesLibrarySid = 88 + WinCapabilityVideosLibrarySid = 89 + WinCapabilityMusicLibrarySid = 90 + WinCapabilityDocumentsLibrarySid = 91 + WinCapabilitySharedUserCertificatesSid = 92 + WinCapabilityEnterpriseAuthenticationSid = 93 + WinCapabilityRemovableStorageSid = 94 + WinBuiltinRDSRemoteAccessServersSid = 95 + WinBuiltinRDSEndpointServersSid = 96 + WinBuiltinRDSManagementServersSid = 97 + WinUserModeDriversSid = 98 + WinBuiltinHyperVAdminsSid = 99 + WinAccountCloneableControllersSid = 100 + WinBuiltinAccessControlAssistanceOperatorsSid = 101 + WinBuiltinRemoteManagementUsersSid = 102 + WinAuthenticationAuthorityAssertedSid = 103 + WinAuthenticationServiceAssertedSid = 104 + WinLocalAccountSid = 105 + WinLocalAccountAndAdministratorSid = 106 + WinAccountProtectedUsersSid = 107 + WinCapabilityAppointmentsSid = 108 + WinCapabilityContactsSid = 109 + WinAccountDefaultSystemManagedSid = 110 + WinBuiltinDefaultSystemManagedGroupSid = 111 + WinBuiltinStorageReplicaAdminsSid = 112 + WinAccountKeyAdminsSid = 113 + WinAccountEnterpriseKeyAdminsSid = 114 + WinAuthenticationKeyTrustSid = 115 + WinAuthenticationKeyPropertyMFASid = 116 + WinAuthenticationKeyPropertyAttestationSid = 117 + WinAuthenticationFreshKeyAuthSid = 118 + WinBuiltinDeviceOwnersSid = 119 +) + +// Creates a sid for a well-known predefined alias, generally using the constants of the form +// Win*Sid, for the local machine. +func CreateWellKnownSid(sidType WELL_KNOWN_SID_TYPE) (*SID, error) { + return CreateWellKnownDomainSid(sidType, nil) +} + +// Creates a sid for a well-known predefined alias, generally using the constants of the form +// Win*Sid, for the domain specified by the domainSid parameter. +func CreateWellKnownDomainSid(sidType WELL_KNOWN_SID_TYPE, domainSid *SID) (*SID, error) { + n := uint32(50) + for { + b := make([]byte, n) + sid := (*SID)(unsafe.Pointer(&b[0])) + err := createWellKnownSid(sidType, domainSid, sid, &n) + if err == nil { + return sid, nil + } + if err != ERROR_INSUFFICIENT_BUFFER { + return nil, err + } + if n <= uint32(len(b)) { + return nil, err + } + } +} + const ( // do not reorder TOKEN_ASSIGN_PRIMARY = 1 << iota @@ -266,6 +449,7 @@ const ( TOKEN_ADJUST_PRIVILEGES TOKEN_ADJUST_GROUPS TOKEN_ADJUST_DEFAULT + TOKEN_ADJUST_SESSIONID TOKEN_ALL_ACCESS = STANDARD_RIGHTS_REQUIRED | TOKEN_ASSIGN_PRIMARY | @@ -275,7 +459,8 @@ const ( TOKEN_QUERY_SOURCE | TOKEN_ADJUST_PRIVILEGES | TOKEN_ADJUST_GROUPS | - TOKEN_ADJUST_DEFAULT + TOKEN_ADJUST_DEFAULT | + TOKEN_ADJUST_SESSIONID TOKEN_READ = STANDARD_RIGHTS_READ | TOKEN_QUERY TOKEN_WRITE = STANDARD_RIGHTS_WRITE | TOKEN_ADJUST_PRIVILEGES | @@ -335,9 +520,12 @@ type Tokengroups struct { Groups [1]SIDAndAttributes } +// Authorization Functions +//sys checkTokenMembership(tokenHandle Token, sidToCheck *SID, isMember *int32) (err error) = advapi32.CheckTokenMembership //sys OpenProcessToken(h Handle, access uint32, token *Token) (err error) = advapi32.OpenProcessToken //sys GetTokenInformation(t Token, infoClass uint32, info *byte, infoLen uint32, returnedLen *uint32) (err error) = advapi32.GetTokenInformation //sys GetUserProfileDirectory(t Token, dir *uint16, dirLen *uint32) (err error) = userenv.GetUserProfileDirectoryW +//sys getSystemDirectory(dir *uint16, dirLen uint32) (len uint32, err error) = kernel32.GetSystemDirectoryW // An access token contains the security information for a logon session. // The system creates an access token when a user logs on, and every @@ -433,3 +621,29 @@ func (t Token) GetUserProfileDirectory() (string, error) { } } } + +// GetSystemDirectory retrieves path to current location of the system +// directory, which is typically, though not always, C:\Windows\System32. +func GetSystemDirectory() (string, error) { + n := uint32(MAX_PATH) + for { + b := make([]uint16, n) + l, e := getSystemDirectory(&b[0], n) + if e != nil { + return "", e + } + if l <= n { + return UTF16ToString(b[:l]), nil + } + n = l + } +} + +// IsMember reports whether the access token t is a member of the provided SID. +func (t Token) IsMember(sid *SID) (bool, error) { + var b int32 + if e := checkTokenMembership(t, sid, &b); e != nil { + return false, e + } + return b != 0, nil +} diff --git a/vendor/golang.org/x/sys/windows/service.go b/vendor/golang.org/x/sys/windows/service.go index a500dd7d..62fc31b4 100644 --- a/vendor/golang.org/x/sys/windows/service.go +++ b/vendor/golang.org/x/sys/windows/service.go @@ -43,6 +43,11 @@ const ( SC_STATUS_PROCESS_INFO = 0 + SC_ACTION_NONE = 0 + SC_ACTION_RESTART = 1 + SC_ACTION_REBOOT = 2 + SC_ACTION_RUN_COMMAND = 3 + SERVICE_STOPPED = 1 SERVICE_START_PENDING = 2 SERVICE_STOP_PENDING = 3 @@ -148,6 +153,19 @@ type ENUM_SERVICE_STATUS_PROCESS struct { ServiceStatusProcess SERVICE_STATUS_PROCESS } +type SERVICE_FAILURE_ACTIONS struct { + ResetPeriod uint32 + RebootMsg *uint16 + Command *uint16 + ActionsCount uint32 + Actions *SC_ACTION +} + +type SC_ACTION struct { + Type uint32 + Delay uint32 +} + //sys CloseServiceHandle(handle Handle) (err error) = advapi32.CloseServiceHandle //sys CreateService(mgr Handle, serviceName *uint16, displayName *uint16, access uint32, srvType uint32, startType uint32, errCtl uint32, pathName *uint16, loadOrderGroup *uint16, tagId *uint32, dependencies *uint16, serviceStartName *uint16, password *uint16) (handle Handle, err error) [failretval==0] = advapi32.CreateServiceW //sys OpenService(mgr Handle, serviceName *uint16, access uint32) (handle Handle, err error) [failretval==0] = advapi32.OpenServiceW @@ -162,3 +180,4 @@ type ENUM_SERVICE_STATUS_PROCESS struct { //sys ChangeServiceConfig2(service Handle, infoLevel uint32, info *byte) (err error) = advapi32.ChangeServiceConfig2W //sys QueryServiceConfig2(service Handle, infoLevel uint32, buff *byte, buffSize uint32, bytesNeeded *uint32) (err error) = advapi32.QueryServiceConfig2W //sys EnumServicesStatusEx(mgr Handle, infoLevel uint32, serviceType uint32, serviceState uint32, services *byte, bufSize uint32, bytesNeeded *uint32, servicesReturned *uint32, resumeHandle *uint32, groupName *uint16) (err error) = advapi32.EnumServicesStatusExW +//sys QueryServiceStatusEx(service Handle, infoLevel uint32, buff *byte, buffSize uint32, bytesNeeded *uint32) (err error) = advapi32.QueryServiceStatusEx diff --git a/vendor/golang.org/x/sys/windows/svc/debug/service.go b/vendor/golang.org/x/sys/windows/svc/debug/service.go index 123df989..e621b87a 100644 --- a/vendor/golang.org/x/sys/windows/svc/debug/service.go +++ b/vendor/golang.org/x/sys/windows/svc/debug/service.go @@ -31,7 +31,7 @@ func Run(name string, handler svc.Handler) error { for { select { case <-sig: - cmds <- svc.ChangeRequest{svc.Stop, 0, 0, status} + cmds <- svc.ChangeRequest{Cmd: svc.Stop, CurrentStatus: status} case status = <-changes: } } diff --git a/vendor/golang.org/x/sys/windows/svc/example/beep.go b/vendor/golang.org/x/sys/windows/svc/example/beep.go deleted file mode 100644 index dcf23408..00000000 --- a/vendor/golang.org/x/sys/windows/svc/example/beep.go +++ /dev/null @@ -1,22 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -package main - -import ( - "syscall" -) - -// BUG(brainman): MessageBeep Windows api is broken on Windows 7, -// so this example does not beep when runs as service on Windows 7. - -var ( - beepFunc = syscall.MustLoadDLL("user32.dll").MustFindProc("MessageBeep") -) - -func beep() { - beepFunc.Call(0xffffffff) -} diff --git a/vendor/golang.org/x/sys/windows/svc/example/install.go b/vendor/golang.org/x/sys/windows/svc/example/install.go deleted file mode 100644 index 39cb00d2..00000000 --- a/vendor/golang.org/x/sys/windows/svc/example/install.go +++ /dev/null @@ -1,92 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -package main - -import ( - "fmt" - "os" - "path/filepath" - - "golang.org/x/sys/windows/svc/eventlog" - "golang.org/x/sys/windows/svc/mgr" -) - -func exePath() (string, error) { - prog := os.Args[0] - p, err := filepath.Abs(prog) - if err != nil { - return "", err - } - fi, err := os.Stat(p) - if err == nil { - if !fi.Mode().IsDir() { - return p, nil - } - err = fmt.Errorf("%s is directory", p) - } - if filepath.Ext(p) == "" { - p += ".exe" - fi, err := os.Stat(p) - if err == nil { - if !fi.Mode().IsDir() { - return p, nil - } - err = fmt.Errorf("%s is directory", p) - } - } - return "", err -} - -func installService(name, desc string) error { - exepath, err := exePath() - if err != nil { - return err - } - m, err := mgr.Connect() - if err != nil { - return err - } - defer m.Disconnect() - s, err := m.OpenService(name) - if err == nil { - s.Close() - return fmt.Errorf("service %s already exists", name) - } - s, err = m.CreateService(name, exepath, mgr.Config{DisplayName: desc}, "is", "auto-started") - if err != nil { - return err - } - defer s.Close() - err = eventlog.InstallAsEventCreate(name, eventlog.Error|eventlog.Warning|eventlog.Info) - if err != nil { - s.Delete() - return fmt.Errorf("SetupEventLogSource() failed: %s", err) - } - return nil -} - -func removeService(name string) error { - m, err := mgr.Connect() - if err != nil { - return err - } - defer m.Disconnect() - s, err := m.OpenService(name) - if err != nil { - return fmt.Errorf("service %s is not installed", name) - } - defer s.Close() - err = s.Delete() - if err != nil { - return err - } - err = eventlog.Remove(name) - if err != nil { - return fmt.Errorf("RemoveEventLogSource() failed: %s", err) - } - return nil -} diff --git a/vendor/golang.org/x/sys/windows/svc/example/main.go b/vendor/golang.org/x/sys/windows/svc/example/main.go deleted file mode 100644 index dc96c081..00000000 --- a/vendor/golang.org/x/sys/windows/svc/example/main.go +++ /dev/null @@ -1,76 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -// Example service program that beeps. -// -// The program demonstrates how to create Windows service and -// install / remove it on a computer. It also shows how to -// stop / start / pause / continue any service, and how to -// write to event log. It also shows how to use debug -// facilities available in debug package. -// -package main - -import ( - "fmt" - "log" - "os" - "strings" - - "golang.org/x/sys/windows/svc" -) - -func usage(errmsg string) { - fmt.Fprintf(os.Stderr, - "%s\n\n"+ - "usage: %s \n"+ - " where is one of\n"+ - " install, remove, debug, start, stop, pause or continue.\n", - errmsg, os.Args[0]) - os.Exit(2) -} - -func main() { - const svcName = "myservice" - - isIntSess, err := svc.IsAnInteractiveSession() - if err != nil { - log.Fatalf("failed to determine if we are running in an interactive session: %v", err) - } - if !isIntSess { - runService(svcName, false) - return - } - - if len(os.Args) < 2 { - usage("no command specified") - } - - cmd := strings.ToLower(os.Args[1]) - switch cmd { - case "debug": - runService(svcName, true) - return - case "install": - err = installService(svcName, "my service") - case "remove": - err = removeService(svcName) - case "start": - err = startService(svcName) - case "stop": - err = controlService(svcName, svc.Stop, svc.Stopped) - case "pause": - err = controlService(svcName, svc.Pause, svc.Paused) - case "continue": - err = controlService(svcName, svc.Continue, svc.Running) - default: - usage(fmt.Sprintf("invalid command %s", cmd)) - } - if err != nil { - log.Fatalf("failed to %s %s: %v", cmd, svcName, err) - } - return -} diff --git a/vendor/golang.org/x/sys/windows/svc/example/manage.go b/vendor/golang.org/x/sys/windows/svc/example/manage.go deleted file mode 100644 index 782dbd96..00000000 --- a/vendor/golang.org/x/sys/windows/svc/example/manage.go +++ /dev/null @@ -1,62 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -package main - -import ( - "fmt" - "time" - - "golang.org/x/sys/windows/svc" - "golang.org/x/sys/windows/svc/mgr" -) - -func startService(name string) error { - m, err := mgr.Connect() - if err != nil { - return err - } - defer m.Disconnect() - s, err := m.OpenService(name) - if err != nil { - return fmt.Errorf("could not access service: %v", err) - } - defer s.Close() - err = s.Start("is", "manual-started") - if err != nil { - return fmt.Errorf("could not start service: %v", err) - } - return nil -} - -func controlService(name string, c svc.Cmd, to svc.State) error { - m, err := mgr.Connect() - if err != nil { - return err - } - defer m.Disconnect() - s, err := m.OpenService(name) - if err != nil { - return fmt.Errorf("could not access service: %v", err) - } - defer s.Close() - status, err := s.Control(c) - if err != nil { - return fmt.Errorf("could not send control=%d: %v", c, err) - } - timeout := time.Now().Add(10 * time.Second) - for status.State != to { - if timeout.Before(time.Now()) { - return fmt.Errorf("timeout waiting for service to go to state=%d", to) - } - time.Sleep(300 * time.Millisecond) - status, err = s.Query() - if err != nil { - return fmt.Errorf("could not retrieve service status: %v", err) - } - } - return nil -} diff --git a/vendor/golang.org/x/sys/windows/svc/example/service.go b/vendor/golang.org/x/sys/windows/svc/example/service.go deleted file mode 100644 index 237e8098..00000000 --- a/vendor/golang.org/x/sys/windows/svc/example/service.go +++ /dev/null @@ -1,82 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -package main - -import ( - "fmt" - "time" - - "golang.org/x/sys/windows/svc" - "golang.org/x/sys/windows/svc/debug" - "golang.org/x/sys/windows/svc/eventlog" -) - -var elog debug.Log - -type myservice struct{} - -func (m *myservice) Execute(args []string, r <-chan svc.ChangeRequest, changes chan<- svc.Status) (ssec bool, errno uint32) { - const cmdsAccepted = svc.AcceptStop | svc.AcceptShutdown | svc.AcceptPauseAndContinue - changes <- svc.Status{State: svc.StartPending} - fasttick := time.Tick(500 * time.Millisecond) - slowtick := time.Tick(2 * time.Second) - tick := fasttick - changes <- svc.Status{State: svc.Running, Accepts: cmdsAccepted} -loop: - for { - select { - case <-tick: - beep() - elog.Info(1, "beep") - case c := <-r: - switch c.Cmd { - case svc.Interrogate: - changes <- c.CurrentStatus - // Testing deadlock from https://code.google.com/p/winsvc/issues/detail?id=4 - time.Sleep(100 * time.Millisecond) - changes <- c.CurrentStatus - case svc.Stop, svc.Shutdown: - break loop - case svc.Pause: - changes <- svc.Status{State: svc.Paused, Accepts: cmdsAccepted} - tick = slowtick - case svc.Continue: - changes <- svc.Status{State: svc.Running, Accepts: cmdsAccepted} - tick = fasttick - default: - elog.Error(1, fmt.Sprintf("unexpected control request #%d", c)) - } - } - } - changes <- svc.Status{State: svc.StopPending} - return -} - -func runService(name string, isDebug bool) { - var err error - if isDebug { - elog = debug.New(name) - } else { - elog, err = eventlog.Open(name) - if err != nil { - return - } - } - defer elog.Close() - - elog.Info(1, fmt.Sprintf("starting %s service", name)) - run := svc.Run - if isDebug { - run = debug.Run - } - err = run(name, &myservice{}) - if err != nil { - elog.Error(1, fmt.Sprintf("%s service failed: %v", name, err)) - return - } - elog.Info(1, fmt.Sprintf("%s service stopped", name)) -} diff --git a/vendor/golang.org/x/sys/windows/svc/go12.go b/vendor/golang.org/x/sys/windows/svc/go12.go index 6f0a924e..cd8b913c 100644 --- a/vendor/golang.org/x/sys/windows/svc/go12.go +++ b/vendor/golang.org/x/sys/windows/svc/go12.go @@ -1,4 +1,4 @@ -// Copyright 2014 The Go Authors. All rights reserved. +// Copyright 2014 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/svc/go13.go b/vendor/golang.org/x/sys/windows/svc/go13.go index 432a9e79..9d7f3cec 100644 --- a/vendor/golang.org/x/sys/windows/svc/go13.go +++ b/vendor/golang.org/x/sys/windows/svc/go13.go @@ -1,4 +1,4 @@ -// Copyright 2014 The Go Authors. All rights reserved. +// Copyright 2014 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/svc/mgr/config.go b/vendor/golang.org/x/sys/windows/svc/mgr/config.go index 0a6edba4..d804e31f 100644 --- a/vendor/golang.org/x/sys/windows/svc/mgr/config.go +++ b/vendor/golang.org/x/sys/windows/svc/mgr/config.go @@ -88,23 +88,11 @@ func (s *Service) Config() (Config, error) { } } - var p2 *windows.SERVICE_DESCRIPTION - n = uint32(1024) - for { - b := make([]byte, n) - p2 = (*windows.SERVICE_DESCRIPTION)(unsafe.Pointer(&b[0])) - err := windows.QueryServiceConfig2(s.Handle, - windows.SERVICE_CONFIG_DESCRIPTION, &b[0], n, &n) - if err == nil { - break - } - if err.(syscall.Errno) != syscall.ERROR_INSUFFICIENT_BUFFER { - return Config{}, err - } - if n <= uint32(len(b)) { - return Config{}, err - } + b, err := s.queryServiceConfig2(windows.SERVICE_CONFIG_DESCRIPTION) + if err != nil { + return Config{}, err } + p2 := (*windows.SERVICE_DESCRIPTION)(unsafe.Pointer(&b[0])) return Config{ ServiceType: p.ServiceType, @@ -121,7 +109,7 @@ func (s *Service) Config() (Config, error) { } func updateDescription(handle windows.Handle, desc string) error { - d := windows.SERVICE_DESCRIPTION{toPtr(desc)} + d := windows.SERVICE_DESCRIPTION{Description: toPtr(desc)} return windows.ChangeServiceConfig2(handle, windows.SERVICE_CONFIG_DESCRIPTION, (*byte)(unsafe.Pointer(&d))) } @@ -137,3 +125,21 @@ func (s *Service) UpdateConfig(c Config) error { } return updateDescription(s.Handle, c.Description) } + +// queryServiceConfig2 calls Windows QueryServiceConfig2 with infoLevel parameter and returns retrieved service configuration information. +func (s *Service) queryServiceConfig2(infoLevel uint32) ([]byte, error) { + n := uint32(1024) + for { + b := make([]byte, n) + err := windows.QueryServiceConfig2(s.Handle, infoLevel, &b[0], n, &n) + if err == nil { + return b, nil + } + if err.(syscall.Errno) != syscall.ERROR_INSUFFICIENT_BUFFER { + return nil, err + } + if n <= uint32(len(b)) { + return nil, err + } + } +} diff --git a/vendor/golang.org/x/sys/windows/svc/mgr/recovery.go b/vendor/golang.org/x/sys/windows/svc/mgr/recovery.go new file mode 100644 index 00000000..71ce2b81 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/mgr/recovery.go @@ -0,0 +1,135 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +package mgr + +import ( + "errors" + "syscall" + "time" + "unsafe" + + "golang.org/x/sys/windows" +) + +const ( + // Possible recovery actions that the service control manager can perform. + NoAction = windows.SC_ACTION_NONE // no action + ComputerReboot = windows.SC_ACTION_REBOOT // reboot the computer + ServiceRestart = windows.SC_ACTION_RESTART // restart the service + RunCommand = windows.SC_ACTION_RUN_COMMAND // run a command +) + +// RecoveryAction represents an action that the service control manager can perform when service fails. +// A service is considered failed when it terminates without reporting a status of SERVICE_STOPPED to the service controller. +type RecoveryAction struct { + Type int // one of NoAction, ComputerReboot, ServiceRestart or RunCommand + Delay time.Duration // the time to wait before performing the specified action +} + +// SetRecoveryActions sets actions that service controller performs when service fails and +// the time after which to reset the service failure count to zero if there are no failures, in seconds. +// Specify INFINITE to indicate that service failure count should never be reset. +func (s *Service) SetRecoveryActions(recoveryActions []RecoveryAction, resetPeriod uint32) error { + if recoveryActions == nil { + return errors.New("recoveryActions cannot be nil") + } + actions := []windows.SC_ACTION{} + for _, a := range recoveryActions { + action := windows.SC_ACTION{ + Type: uint32(a.Type), + Delay: uint32(a.Delay.Nanoseconds() / 1000000), + } + actions = append(actions, action) + } + rActions := windows.SERVICE_FAILURE_ACTIONS{ + ActionsCount: uint32(len(actions)), + Actions: &actions[0], + ResetPeriod: resetPeriod, + } + return windows.ChangeServiceConfig2(s.Handle, windows.SERVICE_CONFIG_FAILURE_ACTIONS, (*byte)(unsafe.Pointer(&rActions))) +} + +// RecoveryActions returns actions that service controller performs when service fails. +// The service control manager counts the number of times service s has failed since the system booted. +// The count is reset to 0 if the service has not failed for ResetPeriod seconds. +// When the service fails for the Nth time, the service controller performs the action specified in element [N-1] of returned slice. +// If N is greater than slice length, the service controller repeats the last action in the slice. +func (s *Service) RecoveryActions() ([]RecoveryAction, error) { + b, err := s.queryServiceConfig2(windows.SERVICE_CONFIG_FAILURE_ACTIONS) + if err != nil { + return nil, err + } + p := (*windows.SERVICE_FAILURE_ACTIONS)(unsafe.Pointer(&b[0])) + if p.Actions == nil { + return nil, err + } + + var recoveryActions []RecoveryAction + actions := (*[1024]windows.SC_ACTION)(unsafe.Pointer(p.Actions))[:p.ActionsCount] + for _, action := range actions { + recoveryActions = append(recoveryActions, RecoveryAction{Type: int(action.Type), Delay: time.Duration(action.Delay) * time.Millisecond}) + } + return recoveryActions, nil +} + +// ResetRecoveryActions deletes both reset period and array of failure actions. +func (s *Service) ResetRecoveryActions() error { + actions := make([]windows.SC_ACTION, 1) + rActions := windows.SERVICE_FAILURE_ACTIONS{ + Actions: &actions[0], + } + return windows.ChangeServiceConfig2(s.Handle, windows.SERVICE_CONFIG_FAILURE_ACTIONS, (*byte)(unsafe.Pointer(&rActions))) +} + +// ResetPeriod is the time after which to reset the service failure +// count to zero if there are no failures, in seconds. +func (s *Service) ResetPeriod() (uint32, error) { + b, err := s.queryServiceConfig2(windows.SERVICE_CONFIG_FAILURE_ACTIONS) + if err != nil { + return 0, err + } + p := (*windows.SERVICE_FAILURE_ACTIONS)(unsafe.Pointer(&b[0])) + return p.ResetPeriod, nil +} + +// SetRebootMessage sets service s reboot message. +// If msg is "", the reboot message is deleted and no message is broadcast. +func (s *Service) SetRebootMessage(msg string) error { + rActions := windows.SERVICE_FAILURE_ACTIONS{ + RebootMsg: syscall.StringToUTF16Ptr(msg), + } + return windows.ChangeServiceConfig2(s.Handle, windows.SERVICE_CONFIG_FAILURE_ACTIONS, (*byte)(unsafe.Pointer(&rActions))) +} + +// RebootMessage is broadcast to server users before rebooting in response to the ComputerReboot service controller action. +func (s *Service) RebootMessage() (string, error) { + b, err := s.queryServiceConfig2(windows.SERVICE_CONFIG_FAILURE_ACTIONS) + if err != nil { + return "", err + } + p := (*windows.SERVICE_FAILURE_ACTIONS)(unsafe.Pointer(&b[0])) + return toString(p.RebootMsg), nil +} + +// SetRecoveryCommand sets the command line of the process to execute in response to the RunCommand service controller action. +// If cmd is "", the command is deleted and no program is run when the service fails. +func (s *Service) SetRecoveryCommand(cmd string) error { + rActions := windows.SERVICE_FAILURE_ACTIONS{ + Command: syscall.StringToUTF16Ptr(cmd), + } + return windows.ChangeServiceConfig2(s.Handle, windows.SERVICE_CONFIG_FAILURE_ACTIONS, (*byte)(unsafe.Pointer(&rActions))) +} + +// RecoveryCommand is the command line of the process to execute in response to the RunCommand service controller action. This process runs under the same account as the service. +func (s *Service) RecoveryCommand() (string, error) { + b, err := s.queryServiceConfig2(windows.SERVICE_CONFIG_FAILURE_ACTIONS) + if err != nil { + return "", err + } + p := (*windows.SERVICE_FAILURE_ACTIONS)(unsafe.Pointer(&b[0])) + return toString(p.Command), nil +} diff --git a/vendor/golang.org/x/sys/windows/svc/service.go b/vendor/golang.org/x/sys/windows/svc/service.go index 903cba3f..38b147d5 100644 --- a/vendor/golang.org/x/sys/windows/svc/service.go +++ b/vendor/golang.org/x/sys/windows/svc/service.go @@ -80,6 +80,7 @@ type ChangeRequest struct { EventType uint32 EventData uintptr CurrentStatus Status + Context uintptr } // Handler is the interface that must be implemented to build Windows service. @@ -114,19 +115,18 @@ var ( ) func init() { - k := syscall.MustLoadDLL("kernel32.dll") - cSetEvent = k.MustFindProc("SetEvent").Addr() - cWaitForSingleObject = k.MustFindProc("WaitForSingleObject").Addr() - a := syscall.MustLoadDLL("advapi32.dll") - cRegisterServiceCtrlHandlerExW = a.MustFindProc("RegisterServiceCtrlHandlerExW").Addr() + k := windows.NewLazySystemDLL("kernel32.dll") + cSetEvent = k.NewProc("SetEvent").Addr() + cWaitForSingleObject = k.NewProc("WaitForSingleObject").Addr() + a := windows.NewLazySystemDLL("advapi32.dll") + cRegisterServiceCtrlHandlerExW = a.NewProc("RegisterServiceCtrlHandlerExW").Addr() } -// The HandlerEx prototype also has a context pointer but since we don't use -// it at start-up time we don't have to pass it over either. type ctlEvent struct { cmd Cmd eventType uint32 eventData uintptr + context uintptr errno uint32 } @@ -238,13 +238,12 @@ func (s *service) run() { exitFromHandler <- exitCode{ss, errno} }() - status := Status{State: Stopped} ec := exitCode{isSvcSpecific: true, errno: 0} + outcr := ChangeRequest{ + CurrentStatus: Status{State: Stopped}, + } var outch chan ChangeRequest inch := s.c - var cmd Cmd - var evtype uint32 - var evdata uintptr loop: for { select { @@ -255,10 +254,11 @@ loop: } inch = nil outch = cmdsToHandler - cmd = r.cmd - evtype = r.eventType - evdata = r.eventData - case outch <- ChangeRequest{cmd, evtype, evdata, status}: + outcr.Cmd = r.cmd + outcr.EventType = r.eventType + outcr.EventData = r.eventData + outcr.Context = r.context + case outch <- outcr: inch = s.c outch = nil case c := <-changesFromHandler: @@ -271,7 +271,7 @@ loop: } break loop } - status = c + outcr.CurrentStatus = c case ec = <-exitFromHandler: break loop } @@ -315,8 +315,8 @@ func Run(name string, handler Handler) error { return err } - ctlHandler := func(ctl uint32, evtype uint32, evdata uintptr, context uintptr) uintptr { - e := ctlEvent{cmd: Cmd(ctl), eventType: evtype, eventData: evdata} + ctlHandler := func(ctl, evtype, evdata, context uintptr) uintptr { + e := ctlEvent{cmd: Cmd(ctl), eventType: uint32(evtype), eventData: evdata, context: context} // We assume that this callback function is running on // the same thread as Run. Nowhere in MS documentation // I could find statement to guarantee that. So putting @@ -334,8 +334,8 @@ func Run(name string, handler Handler) error { var svcmain uintptr getServiceMain(&svcmain) t := []windows.SERVICE_TABLE_ENTRY{ - {syscall.StringToUTF16Ptr(s.name), svcmain}, - {nil, 0}, + {ServiceName: syscall.StringToUTF16Ptr(s.name), ServiceProc: svcmain}, + {ServiceName: nil, ServiceProc: 0}, } goWaitsH = uintptr(s.goWaits.h) diff --git a/vendor/golang.org/x/sys/windows/svc/sys_386.s b/vendor/golang.org/x/sys/windows/svc/sys_386.s index 2c82a9d9..c8a583d7 100644 --- a/vendor/golang.org/x/sys/windows/svc/sys_386.s +++ b/vendor/golang.org/x/sys/windows/svc/sys_386.s @@ -22,7 +22,8 @@ TEXT ·servicemain(SB),7,$0 MOVL AX, (SP) MOVL $·servicectlhandler(SB), AX MOVL AX, 4(SP) - MOVL $0, 8(SP) + // Set context to 123456 to test issue #25660. + MOVL $123456, 8(SP) MOVL ·cRegisterServiceCtrlHandlerExW(SB), AX MOVL SP, BP CALL AX diff --git a/vendor/golang.org/x/sys/windows/svc/sys_amd64.s b/vendor/golang.org/x/sys/windows/svc/sys_amd64.s index 06b42590..2f7609c5 100644 --- a/vendor/golang.org/x/sys/windows/svc/sys_amd64.s +++ b/vendor/golang.org/x/sys/windows/svc/sys_amd64.s @@ -7,13 +7,15 @@ // func servicemain(argc uint32, argv **uint16) TEXT ·servicemain(SB),7,$0 MOVL CX, ·sArgc(SB) - MOVL DX, ·sArgv(SB) + MOVQ DX, ·sArgv(SB) SUBQ $32, SP // stack for the first 4 syscall params MOVQ ·sName(SB), CX MOVQ $·servicectlhandler(SB), DX // BUG(pastarmovj): Figure out a way to pass in context in R8. + // Set context to 123456 to test issue #25660. + MOVQ $123456, R8 MOVQ ·cRegisterServiceCtrlHandlerExW(SB), AX CALL AX CMPQ AX, $0 diff --git a/vendor/golang.org/x/sys/windows/svc/sys_arm.s b/vendor/golang.org/x/sys/windows/svc/sys_arm.s new file mode 100644 index 00000000..33c692a8 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/sys_arm.s @@ -0,0 +1,38 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +#include "textflag.h" + +// func servicemain(argc uint32, argv **uint16) +TEXT ·servicemain(SB),NOSPLIT|NOFRAME,$0 + MOVM.DB.W [R4, R14], (R13) // push {r4, lr} + MOVW R13, R4 + BIC $0x7, R13 // alignment for ABI + + MOVW R0, ·sArgc(SB) + MOVW R1, ·sArgv(SB) + + MOVW ·sName(SB), R0 + MOVW ·ctlHandlerExProc(SB), R1 + MOVW $0, R2 + MOVW ·cRegisterServiceCtrlHandlerExW(SB), R3 + BL (R3) + CMP $0, R0 + BEQ exit + MOVW R0, ·ssHandle(SB) + + MOVW ·goWaitsH(SB), R0 + MOVW ·cSetEvent(SB), R1 + BL (R1) + + MOVW ·cWaitsH(SB), R0 + MOVW $-1, R1 + MOVW ·cWaitForSingleObject(SB), R2 + BL (R2) + +exit: + MOVW R4, R13 // free extra stack space + MOVM.IA.W (R13), [R4, R15] // pop {r4, pc} diff --git a/vendor/golang.org/x/sys/windows/syscall.go b/vendor/golang.org/x/sys/windows/syscall.go index 4e2fbe86..af828a91 100644 --- a/vendor/golang.org/x/sys/windows/syscall.go +++ b/vendor/golang.org/x/sys/windows/syscall.go @@ -5,17 +5,20 @@ // +build windows // Package windows contains an interface to the low-level operating system -// primitives. OS details vary depending on the underlying system, and +// primitives. OS details vary depending on the underlying system, and // by default, godoc will display the OS-specific documentation for the current -// system. If you want godoc to display syscall documentation for another -// system, set $GOOS and $GOARCH to the desired system. For example, if +// system. If you want godoc to display syscall documentation for another +// system, set $GOOS and $GOARCH to the desired system. For example, if // you want to view documentation for freebsd/arm on linux/amd64, set $GOOS // to freebsd and $GOARCH to arm. +// // The primary use of this package is inside other packages that provide a more // portable interface to the system, such as "os", "time" and "net". Use // those packages rather than this one if you can. +// // For details of the functions and data types in this package consult // the manuals for the appropriate operating system. +// // These calls return err == nil to indicate success; otherwise // err represents an operating system error describing the failure and // holds a value of type syscall.Errno. diff --git a/vendor/golang.org/x/sys/windows/syscall_windows.go b/vendor/golang.org/x/sys/windows/syscall_windows.go index e439c48a..7aff0d02 100644 --- a/vendor/golang.org/x/sys/windows/syscall_windows.go +++ b/vendor/golang.org/x/sys/windows/syscall_windows.go @@ -1,4 +1,4 @@ -// Copyright 2009 The Go Authors. All rights reserved. +// Copyright 2009 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -16,7 +16,46 @@ import ( type Handle uintptr -const InvalidHandle = ^Handle(0) +const ( + InvalidHandle = ^Handle(0) + + // Flags for DefineDosDevice. + DDD_EXACT_MATCH_ON_REMOVE = 0x00000004 + DDD_NO_BROADCAST_SYSTEM = 0x00000008 + DDD_RAW_TARGET_PATH = 0x00000001 + DDD_REMOVE_DEFINITION = 0x00000002 + + // Return values for GetDriveType. + DRIVE_UNKNOWN = 0 + DRIVE_NO_ROOT_DIR = 1 + DRIVE_REMOVABLE = 2 + DRIVE_FIXED = 3 + DRIVE_REMOTE = 4 + DRIVE_CDROM = 5 + DRIVE_RAMDISK = 6 + + // File system flags from GetVolumeInformation and GetVolumeInformationByHandle. + FILE_CASE_SENSITIVE_SEARCH = 0x00000001 + FILE_CASE_PRESERVED_NAMES = 0x00000002 + FILE_FILE_COMPRESSION = 0x00000010 + FILE_DAX_VOLUME = 0x20000000 + FILE_NAMED_STREAMS = 0x00040000 + FILE_PERSISTENT_ACLS = 0x00000008 + FILE_READ_ONLY_VOLUME = 0x00080000 + FILE_SEQUENTIAL_WRITE_ONCE = 0x00100000 + FILE_SUPPORTS_ENCRYPTION = 0x00020000 + FILE_SUPPORTS_EXTENDED_ATTRIBUTES = 0x00800000 + FILE_SUPPORTS_HARD_LINKS = 0x00400000 + FILE_SUPPORTS_OBJECT_IDS = 0x00010000 + FILE_SUPPORTS_OPEN_BY_FILE_ID = 0x01000000 + FILE_SUPPORTS_REPARSE_POINTS = 0x00000080 + FILE_SUPPORTS_SPARSE_FILES = 0x00000040 + FILE_SUPPORTS_TRANSACTIONS = 0x00200000 + FILE_SUPPORTS_USN_JOURNAL = 0x02000000 + FILE_UNICODE_ON_DISK = 0x00000004 + FILE_VOLUME_IS_COMPRESSED = 0x00008000 + FILE_VOLUME_QUOTAS = 0x00000020 +) // StringToUTF16 is deprecated. Use UTF16FromString instead. // If s contains a NUL byte this function panics instead of @@ -71,12 +110,19 @@ func UTF16PtrFromString(s string) (*uint16, error) { func Getpagesize() int { return 4096 } -// Converts a Go function to a function pointer conforming -// to the stdcall or cdecl calling convention. This is useful when -// interoperating with Windows code requiring callbacks. -// Implemented in runtime/syscall_windows.goc -func NewCallback(fn interface{}) uintptr -func NewCallbackCDecl(fn interface{}) uintptr +// NewCallback converts a Go function to a function pointer conforming to the stdcall calling convention. +// This is useful when interoperating with Windows code requiring callbacks. +// The argument is expected to be a function with with one uintptr-sized result. The function must not have arguments with size larger than the size of uintptr. +func NewCallback(fn interface{}) uintptr { + return syscall.NewCallback(fn) +} + +// NewCallbackCDecl converts a Go function to a function pointer conforming to the cdecl calling convention. +// This is useful when interoperating with Windows code requiring callbacks. +// The argument is expected to be a function with with one uintptr-sized result. The function must not have arguments with size larger than the size of uintptr. +func NewCallbackCDecl(fn interface{}) uintptr { + return syscall.NewCallbackCDecl(fn) +} // windows api calls @@ -91,6 +137,7 @@ func NewCallbackCDecl(fn interface{}) uintptr //sys CreateFile(name *uint16, access uint32, mode uint32, sa *SecurityAttributes, createmode uint32, attrs uint32, templatefile int32) (handle Handle, err error) [failretval==InvalidHandle] = CreateFileW //sys ReadFile(handle Handle, buf []byte, done *uint32, overlapped *Overlapped) (err error) //sys WriteFile(handle Handle, buf []byte, done *uint32, overlapped *Overlapped) (err error) +//sys GetOverlappedResult(handle Handle, overlapped *Overlapped, done *uint32, wait bool) (err error) //sys SetFilePointer(handle Handle, lowoffset int32, highoffsetptr *int32, whence uint32) (newlowoffset uint32, err error) [failretval==0xffffffff] //sys CloseHandle(handle Handle) (err error) //sys GetStdHandle(stdhandle uint32) (handle Handle, err error) [failretval==InvalidHandle] @@ -126,6 +173,7 @@ func NewCallbackCDecl(fn interface{}) uintptr //sys GetProcessTimes(handle Handle, creationTime *Filetime, exitTime *Filetime, kernelTime *Filetime, userTime *Filetime) (err error) //sys DuplicateHandle(hSourceProcessHandle Handle, hSourceHandle Handle, hTargetProcessHandle Handle, lpTargetHandle *Handle, dwDesiredAccess uint32, bInheritHandle bool, dwOptions uint32) (err error) //sys WaitForSingleObject(handle Handle, waitMilliseconds uint32) (event uint32, err error) [failretval==0xffffffff] +//sys waitForMultipleObjects(count uint32, handles uintptr, waitAll bool, waitMilliseconds uint32) (event uint32, err error) [failretval==0xffffffff] = WaitForMultipleObjects //sys GetTempPath(buflen uint32, buf *uint16) (n uint32, err error) = GetTempPathW //sys CreatePipe(readhandle *Handle, writehandle *Handle, sa *SecurityAttributes, size uint32) (err error) //sys GetFileType(filehandle Handle) (n uint32, err error) @@ -154,6 +202,9 @@ func NewCallbackCDecl(fn interface{}) uintptr //sys FlushViewOfFile(addr uintptr, length uintptr) (err error) //sys VirtualLock(addr uintptr, length uintptr) (err error) //sys VirtualUnlock(addr uintptr, length uintptr) (err error) +//sys VirtualAlloc(address uintptr, size uintptr, alloctype uint32, protect uint32) (value uintptr, err error) = kernel32.VirtualAlloc +//sys VirtualFree(address uintptr, size uintptr, freetype uint32) (err error) = kernel32.VirtualFree +//sys VirtualProtect(address uintptr, size uintptr, newprotect uint32, oldprotect *uint32) (err error) = kernel32.VirtualProtect //sys TransmitFile(s Handle, handle Handle, bytesToWrite uint32, bytsPerSend uint32, overlapped *Overlapped, transmitFileBuf *TransmitFileBuffers, flags uint32) (err error) = mswsock.TransmitFile //sys ReadDirectoryChanges(handle Handle, buf *byte, buflen uint32, watchSubTree bool, mask uint32, retlen *uint32, overlapped *Overlapped, completionRoutine uintptr) (err error) = kernel32.ReadDirectoryChangesW //sys CertOpenSystemStore(hprov Handle, name *uint16) (store Handle, err error) = crypt32.CertOpenSystemStoreW @@ -173,6 +224,8 @@ func NewCallbackCDecl(fn interface{}) uintptr //sys RegQueryValueEx(key Handle, name *uint16, reserved *uint32, valtype *uint32, buf *byte, buflen *uint32) (regerrno error) = advapi32.RegQueryValueExW //sys getCurrentProcessId() (pid uint32) = kernel32.GetCurrentProcessId //sys GetConsoleMode(console Handle, mode *uint32) (err error) = kernel32.GetConsoleMode +//sys SetConsoleMode(console Handle, mode uint32) (err error) = kernel32.SetConsoleMode +//sys GetConsoleScreenBufferInfo(console Handle, info *ConsoleScreenBufferInfo) (err error) = kernel32.GetConsoleScreenBufferInfo //sys WriteConsole(console Handle, buf *uint16, towrite uint32, written *uint32, reserved *byte) (err error) = kernel32.WriteConsoleW //sys ReadConsole(console Handle, buf *uint16, toread uint32, read *uint32, inputControl *byte) (err error) = kernel32.ReadConsoleW //sys CreateToolhelp32Snapshot(flags uint32, processId uint32) (handle Handle, err error) [failretval==InvalidHandle] = kernel32.CreateToolhelp32Snapshot @@ -183,11 +236,51 @@ func NewCallbackCDecl(fn interface{}) uintptr //sys CreateSymbolicLink(symlinkfilename *uint16, targetfilename *uint16, flags uint32) (err error) [failretval&0xff==0] = CreateSymbolicLinkW //sys CreateHardLink(filename *uint16, existingfilename *uint16, reserved uintptr) (err error) [failretval&0xff==0] = CreateHardLinkW //sys GetCurrentThreadId() (id uint32) -//sys CreateEvent(eventAttrs *syscall.SecurityAttributes, manualReset uint32, initialState uint32, name *uint16) (handle Handle, err error) = kernel32.CreateEventW +//sys CreateEvent(eventAttrs *SecurityAttributes, manualReset uint32, initialState uint32, name *uint16) (handle Handle, err error) = kernel32.CreateEventW +//sys CreateEventEx(eventAttrs *SecurityAttributes, name *uint16, flags uint32, desiredAccess uint32) (handle Handle, err error) = kernel32.CreateEventExW +//sys OpenEvent(desiredAccess uint32, inheritHandle bool, name *uint16) (handle Handle, err error) = kernel32.OpenEventW //sys SetEvent(event Handle) (err error) = kernel32.SetEvent +//sys ResetEvent(event Handle) (err error) = kernel32.ResetEvent +//sys PulseEvent(event Handle) (err error) = kernel32.PulseEvent + +// Volume Management Functions +//sys DefineDosDevice(flags uint32, deviceName *uint16, targetPath *uint16) (err error) = DefineDosDeviceW +//sys DeleteVolumeMountPoint(volumeMountPoint *uint16) (err error) = DeleteVolumeMountPointW +//sys FindFirstVolume(volumeName *uint16, bufferLength uint32) (handle Handle, err error) [failretval==InvalidHandle] = FindFirstVolumeW +//sys FindFirstVolumeMountPoint(rootPathName *uint16, volumeMountPoint *uint16, bufferLength uint32) (handle Handle, err error) [failretval==InvalidHandle] = FindFirstVolumeMountPointW +//sys FindNextVolume(findVolume Handle, volumeName *uint16, bufferLength uint32) (err error) = FindNextVolumeW +//sys FindNextVolumeMountPoint(findVolumeMountPoint Handle, volumeMountPoint *uint16, bufferLength uint32) (err error) = FindNextVolumeMountPointW +//sys FindVolumeClose(findVolume Handle) (err error) +//sys FindVolumeMountPointClose(findVolumeMountPoint Handle) (err error) +//sys GetDriveType(rootPathName *uint16) (driveType uint32) = GetDriveTypeW +//sys GetLogicalDrives() (drivesBitMask uint32, err error) [failretval==0] +//sys GetLogicalDriveStrings(bufferLength uint32, buffer *uint16) (n uint32, err error) [failretval==0] = GetLogicalDriveStringsW +//sys GetVolumeInformation(rootPathName *uint16, volumeNameBuffer *uint16, volumeNameSize uint32, volumeNameSerialNumber *uint32, maximumComponentLength *uint32, fileSystemFlags *uint32, fileSystemNameBuffer *uint16, fileSystemNameSize uint32) (err error) = GetVolumeInformationW +//sys GetVolumeInformationByHandle(file Handle, volumeNameBuffer *uint16, volumeNameSize uint32, volumeNameSerialNumber *uint32, maximumComponentLength *uint32, fileSystemFlags *uint32, fileSystemNameBuffer *uint16, fileSystemNameSize uint32) (err error) = GetVolumeInformationByHandleW +//sys GetVolumeNameForVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16, bufferlength uint32) (err error) = GetVolumeNameForVolumeMountPointW +//sys GetVolumePathName(fileName *uint16, volumePathName *uint16, bufferLength uint32) (err error) = GetVolumePathNameW +//sys GetVolumePathNamesForVolumeName(volumeName *uint16, volumePathNames *uint16, bufferLength uint32, returnLength *uint32) (err error) = GetVolumePathNamesForVolumeNameW +//sys QueryDosDevice(deviceName *uint16, targetPath *uint16, max uint32) (n uint32, err error) [failretval==0] = QueryDosDeviceW +//sys SetVolumeLabel(rootPathName *uint16, volumeName *uint16) (err error) = SetVolumeLabelW +//sys SetVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16) (err error) = SetVolumeMountPointW // syscall interface implementation for other packages +// GetProcAddressByOrdinal retrieves the address of the exported +// function from module by ordinal. +func GetProcAddressByOrdinal(module Handle, ordinal uintptr) (proc uintptr, err error) { + r0, _, e1 := syscall.Syscall(procGetProcAddress.Addr(), 2, uintptr(module), ordinal, 0) + proc = uintptr(r0) + if proc == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func Exit(code int) { ExitProcess(uint32(code)) } func makeInheritSa() *SecurityAttributes { @@ -498,6 +591,18 @@ func LoadSetFileCompletionNotificationModes() error { return procSetFileCompletionNotificationModes.Find() } +func WaitForMultipleObjects(handles []Handle, waitAll bool, waitMilliseconds uint32) (event uint32, err error) { + // Every other win32 array API takes arguments as "pointer, count", except for this function. So we + // can't declare it as a usual [] type, because mksyscall will use the opposite order. We therefore + // trivially stub this ourselves. + + var handlePtr *Handle + if len(handles) > 0 { + handlePtr = &handles[0] + } + return waitForMultipleObjects(uint32(len(handles)), uintptr(unsafe.Pointer(handlePtr)), waitAll, waitMilliseconds) +} + // net api calls const socket_error = uintptr(^uint32(0)) @@ -564,7 +669,7 @@ type RawSockaddr struct { type RawSockaddrAny struct { Addr RawSockaddr - Pad [96]int8 + Pad [100]int8 } type Sockaddr interface { @@ -613,19 +718,69 @@ func (sa *SockaddrInet6) sockaddr() (unsafe.Pointer, int32, error) { return unsafe.Pointer(&sa.raw), int32(unsafe.Sizeof(sa.raw)), nil } +type RawSockaddrUnix struct { + Family uint16 + Path [UNIX_PATH_MAX]int8 +} + type SockaddrUnix struct { Name string + raw RawSockaddrUnix } func (sa *SockaddrUnix) sockaddr() (unsafe.Pointer, int32, error) { - // TODO(brainman): implement SockaddrUnix.sockaddr() - return nil, 0, syscall.EWINDOWS + name := sa.Name + n := len(name) + if n > len(sa.raw.Path) { + return nil, 0, syscall.EINVAL + } + if n == len(sa.raw.Path) && name[0] != '@' { + return nil, 0, syscall.EINVAL + } + sa.raw.Family = AF_UNIX + for i := 0; i < n; i++ { + sa.raw.Path[i] = int8(name[i]) + } + // length is family (uint16), name, NUL. + sl := int32(2) + if n > 0 { + sl += int32(n) + 1 + } + if sa.raw.Path[0] == '@' { + sa.raw.Path[0] = 0 + // Don't count trailing NUL for abstract address. + sl-- + } + + return unsafe.Pointer(&sa.raw), sl, nil } func (rsa *RawSockaddrAny) Sockaddr() (Sockaddr, error) { switch rsa.Addr.Family { case AF_UNIX: - return nil, syscall.EWINDOWS + pp := (*RawSockaddrUnix)(unsafe.Pointer(rsa)) + sa := new(SockaddrUnix) + if pp.Path[0] == 0 { + // "Abstract" Unix domain socket. + // Rewrite leading NUL as @ for textual display. + // (This is the standard convention.) + // Not friendly to overwrite in place, + // but the callers below don't care. + pp.Path[0] = '@' + } + + // Assume path ends at NUL. + // This is not technically the Linux semantics for + // abstract Unix domain sockets--they are supposed + // to be uninterpreted fixed-size binary blobs--but + // everyone uses this convention. + n := 0 + for n < len(pp.Path) && pp.Path[n] != 0 { + n++ + } + bytes := (*[10000]byte)(unsafe.Pointer(&pp.Path[0]))[0:n] + sa.Name = string(bytes) + return sa, nil case AF_INET: pp := (*RawSockaddrInet4)(unsafe.Pointer(rsa)) @@ -767,6 +922,75 @@ func ConnectEx(fd Handle, sa Sockaddr, sendBuf *byte, sendDataLen uint32, bytesS return connectEx(fd, ptr, n, sendBuf, sendDataLen, bytesSent, overlapped) } +var sendRecvMsgFunc struct { + once sync.Once + sendAddr uintptr + recvAddr uintptr + err error +} + +func loadWSASendRecvMsg() error { + sendRecvMsgFunc.once.Do(func() { + var s Handle + s, sendRecvMsgFunc.err = Socket(AF_INET, SOCK_DGRAM, IPPROTO_UDP) + if sendRecvMsgFunc.err != nil { + return + } + defer CloseHandle(s) + var n uint32 + sendRecvMsgFunc.err = WSAIoctl(s, + SIO_GET_EXTENSION_FUNCTION_POINTER, + (*byte)(unsafe.Pointer(&WSAID_WSARECVMSG)), + uint32(unsafe.Sizeof(WSAID_WSARECVMSG)), + (*byte)(unsafe.Pointer(&sendRecvMsgFunc.recvAddr)), + uint32(unsafe.Sizeof(sendRecvMsgFunc.recvAddr)), + &n, nil, 0) + if sendRecvMsgFunc.err != nil { + return + } + sendRecvMsgFunc.err = WSAIoctl(s, + SIO_GET_EXTENSION_FUNCTION_POINTER, + (*byte)(unsafe.Pointer(&WSAID_WSASENDMSG)), + uint32(unsafe.Sizeof(WSAID_WSASENDMSG)), + (*byte)(unsafe.Pointer(&sendRecvMsgFunc.sendAddr)), + uint32(unsafe.Sizeof(sendRecvMsgFunc.sendAddr)), + &n, nil, 0) + }) + return sendRecvMsgFunc.err +} + +func WSASendMsg(fd Handle, msg *WSAMsg, flags uint32, bytesSent *uint32, overlapped *Overlapped, croutine *byte) error { + err := loadWSASendRecvMsg() + if err != nil { + return err + } + r1, _, e1 := syscall.Syscall6(sendRecvMsgFunc.sendAddr, 6, uintptr(fd), uintptr(unsafe.Pointer(msg)), uintptr(flags), uintptr(unsafe.Pointer(bytesSent)), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(croutine))) + if r1 == socket_error { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return err +} + +func WSARecvMsg(fd Handle, msg *WSAMsg, bytesReceived *uint32, overlapped *Overlapped, croutine *byte) error { + err := loadWSASendRecvMsg() + if err != nil { + return err + } + r1, _, e1 := syscall.Syscall6(sendRecvMsgFunc.recvAddr, 5, uintptr(fd), uintptr(unsafe.Pointer(msg)), uintptr(unsafe.Pointer(bytesReceived)), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(croutine)), 0) + if r1 == socket_error { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return err +} + // Invented structures to support what package os expects. type Rusage struct { CreationTime Filetime diff --git a/vendor/golang.org/x/sys/windows/ztypes_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go similarity index 73% rename from vendor/golang.org/x/sys/windows/ztypes_windows.go rename to vendor/golang.org/x/sys/windows/types_windows.go index a907ff2c..bbf19f0d 100644 --- a/vendor/golang.org/x/sys/windows/ztypes_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -1,4 +1,4 @@ -// Copyright 2011 The Go Authors. All rights reserved. +// Copyright 2011 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -29,6 +29,7 @@ const ( ERROR_NOT_FOUND syscall.Errno = 1168 ERROR_PRIVILEGE_NOT_HELD syscall.Errno = 1314 WSAEACCES syscall.Errno = 10013 + WSAEMSGSIZE syscall.Errno = 10040 WSAECONNRESET syscall.Errno = 10054 ) @@ -93,16 +94,29 @@ const ( FILE_APPEND_DATA = 0x00000004 FILE_WRITE_ATTRIBUTES = 0x00000100 - FILE_SHARE_READ = 0x00000001 - FILE_SHARE_WRITE = 0x00000002 - FILE_SHARE_DELETE = 0x00000004 - FILE_ATTRIBUTE_READONLY = 0x00000001 - FILE_ATTRIBUTE_HIDDEN = 0x00000002 - FILE_ATTRIBUTE_SYSTEM = 0x00000004 - FILE_ATTRIBUTE_DIRECTORY = 0x00000010 - FILE_ATTRIBUTE_ARCHIVE = 0x00000020 - FILE_ATTRIBUTE_NORMAL = 0x00000080 - FILE_ATTRIBUTE_REPARSE_POINT = 0x00000400 + FILE_SHARE_READ = 0x00000001 + FILE_SHARE_WRITE = 0x00000002 + FILE_SHARE_DELETE = 0x00000004 + + FILE_ATTRIBUTE_READONLY = 0x00000001 + FILE_ATTRIBUTE_HIDDEN = 0x00000002 + FILE_ATTRIBUTE_SYSTEM = 0x00000004 + FILE_ATTRIBUTE_DIRECTORY = 0x00000010 + FILE_ATTRIBUTE_ARCHIVE = 0x00000020 + FILE_ATTRIBUTE_DEVICE = 0x00000040 + FILE_ATTRIBUTE_NORMAL = 0x00000080 + FILE_ATTRIBUTE_TEMPORARY = 0x00000100 + FILE_ATTRIBUTE_SPARSE_FILE = 0x00000200 + FILE_ATTRIBUTE_REPARSE_POINT = 0x00000400 + FILE_ATTRIBUTE_COMPRESSED = 0x00000800 + FILE_ATTRIBUTE_OFFLINE = 0x00001000 + FILE_ATTRIBUTE_NOT_CONTENT_INDEXED = 0x00002000 + FILE_ATTRIBUTE_ENCRYPTED = 0x00004000 + FILE_ATTRIBUTE_INTEGRITY_STREAM = 0x00008000 + FILE_ATTRIBUTE_VIRTUAL = 0x00010000 + FILE_ATTRIBUTE_NO_SCRUB_DATA = 0x00020000 + FILE_ATTRIBUTE_RECALL_ON_OPEN = 0x00040000 + FILE_ATTRIBUTE_RECALL_ON_DATA_ACCESS = 0x00400000 INVALID_FILE_ATTRIBUTES = 0xffffffff @@ -112,9 +126,19 @@ const ( OPEN_ALWAYS = 4 TRUNCATE_EXISTING = 5 - FILE_FLAG_OPEN_REPARSE_POINT = 0x00200000 - FILE_FLAG_BACKUP_SEMANTICS = 0x02000000 - FILE_FLAG_OVERLAPPED = 0x40000000 + FILE_FLAG_OPEN_REQUIRING_OPLOCK = 0x00040000 + FILE_FLAG_FIRST_PIPE_INSTANCE = 0x00080000 + FILE_FLAG_OPEN_NO_RECALL = 0x00100000 + FILE_FLAG_OPEN_REPARSE_POINT = 0x00200000 + FILE_FLAG_SESSION_AWARE = 0x00800000 + FILE_FLAG_POSIX_SEMANTICS = 0x01000000 + FILE_FLAG_BACKUP_SEMANTICS = 0x02000000 + FILE_FLAG_DELETE_ON_CLOSE = 0x04000000 + FILE_FLAG_SEQUENTIAL_SCAN = 0x08000000 + FILE_FLAG_RANDOM_ACCESS = 0x10000000 + FILE_FLAG_NO_BUFFERING = 0x20000000 + FILE_FLAG_OVERLAPPED = 0x40000000 + FILE_FLAG_WRITE_THROUGH = 0x80000000 HANDLE_FLAG_INHERIT = 0x00000001 STARTF_USESTDHANDLES = 0x00000100 @@ -158,20 +182,10 @@ const ( WAIT_OBJECT_0 = 0x00000000 WAIT_FAILED = 0xFFFFFFFF - CREATE_NEW_PROCESS_GROUP = 0x00000200 - CREATE_UNICODE_ENVIRONMENT = 0x00000400 - PROCESS_TERMINATE = 1 PROCESS_QUERY_INFORMATION = 0x00000400 SYNCHRONIZE = 0x00100000 - PAGE_READONLY = 0x02 - PAGE_READWRITE = 0x04 - PAGE_WRITECOPY = 0x08 - PAGE_EXECUTE_READ = 0x20 - PAGE_EXECUTE_READWRITE = 0x40 - PAGE_EXECUTE_WRITECOPY = 0x80 - FILE_MAP_COPY = 0x01 FILE_MAP_WRITE = 0x02 FILE_MAP_READ = 0x04 @@ -184,6 +198,26 @@ const ( APPLICATION_ERROR = 1 << 29 ) +const ( + // Process creation flags. + CREATE_BREAKAWAY_FROM_JOB = 0x01000000 + CREATE_DEFAULT_ERROR_MODE = 0x04000000 + CREATE_NEW_CONSOLE = 0x00000010 + CREATE_NEW_PROCESS_GROUP = 0x00000200 + CREATE_NO_WINDOW = 0x08000000 + CREATE_PROTECTED_PROCESS = 0x00040000 + CREATE_PRESERVE_CODE_AUTHZ_LEVEL = 0x02000000 + CREATE_SEPARATE_WOW_VDM = 0x00000800 + CREATE_SHARED_WOW_VDM = 0x00001000 + CREATE_SUSPENDED = 0x00000004 + CREATE_UNICODE_ENVIRONMENT = 0x00000400 + DEBUG_ONLY_THIS_PROCESS = 0x00000002 + DEBUG_PROCESS = 0x00000001 + DETACHED_PROCESS = 0x00000008 + EXTENDED_STARTUPINFO_PRESENT = 0x00080000 + INHERIT_PARENT_AFFINITY = 0x00010000 +) + const ( // flags for CreateToolhelp32Snapshot TH32CS_SNAPHEAPLIST = 0x01 @@ -246,15 +280,87 @@ const ( USAGE_MATCH_TYPE_AND = 0 USAGE_MATCH_TYPE_OR = 1 + /* msgAndCertEncodingType values for CertOpenStore function */ X509_ASN_ENCODING = 0x00000001 PKCS_7_ASN_ENCODING = 0x00010000 - CERT_STORE_PROV_MEMORY = 2 - - CERT_STORE_ADD_ALWAYS = 4 + /* storeProvider values for CertOpenStore function */ + CERT_STORE_PROV_MSG = 1 + CERT_STORE_PROV_MEMORY = 2 + CERT_STORE_PROV_FILE = 3 + CERT_STORE_PROV_REG = 4 + CERT_STORE_PROV_PKCS7 = 5 + CERT_STORE_PROV_SERIALIZED = 6 + CERT_STORE_PROV_FILENAME_A = 7 + CERT_STORE_PROV_FILENAME_W = 8 + CERT_STORE_PROV_FILENAME = CERT_STORE_PROV_FILENAME_W + CERT_STORE_PROV_SYSTEM_A = 9 + CERT_STORE_PROV_SYSTEM_W = 10 + CERT_STORE_PROV_SYSTEM = CERT_STORE_PROV_SYSTEM_W + CERT_STORE_PROV_COLLECTION = 11 + CERT_STORE_PROV_SYSTEM_REGISTRY_A = 12 + CERT_STORE_PROV_SYSTEM_REGISTRY_W = 13 + CERT_STORE_PROV_SYSTEM_REGISTRY = CERT_STORE_PROV_SYSTEM_REGISTRY_W + CERT_STORE_PROV_PHYSICAL_W = 14 + CERT_STORE_PROV_PHYSICAL = CERT_STORE_PROV_PHYSICAL_W + CERT_STORE_PROV_SMART_CARD_W = 15 + CERT_STORE_PROV_SMART_CARD = CERT_STORE_PROV_SMART_CARD_W + CERT_STORE_PROV_LDAP_W = 16 + CERT_STORE_PROV_LDAP = CERT_STORE_PROV_LDAP_W + CERT_STORE_PROV_PKCS12 = 17 + /* store characteristics (low WORD of flag) for CertOpenStore function */ + CERT_STORE_NO_CRYPT_RELEASE_FLAG = 0x00000001 + CERT_STORE_SET_LOCALIZED_NAME_FLAG = 0x00000002 CERT_STORE_DEFER_CLOSE_UNTIL_LAST_FREE_FLAG = 0x00000004 + CERT_STORE_DELETE_FLAG = 0x00000010 + CERT_STORE_UNSAFE_PHYSICAL_FLAG = 0x00000020 + CERT_STORE_SHARE_STORE_FLAG = 0x00000040 + CERT_STORE_SHARE_CONTEXT_FLAG = 0x00000080 + CERT_STORE_MANIFOLD_FLAG = 0x00000100 + CERT_STORE_ENUM_ARCHIVED_FLAG = 0x00000200 + CERT_STORE_UPDATE_KEYID_FLAG = 0x00000400 + CERT_STORE_BACKUP_RESTORE_FLAG = 0x00000800 + CERT_STORE_MAXIMUM_ALLOWED_FLAG = 0x00001000 + CERT_STORE_CREATE_NEW_FLAG = 0x00002000 + CERT_STORE_OPEN_EXISTING_FLAG = 0x00004000 + CERT_STORE_READONLY_FLAG = 0x00008000 + /* store locations (high WORD of flag) for CertOpenStore function */ + CERT_SYSTEM_STORE_CURRENT_USER = 0x00010000 + CERT_SYSTEM_STORE_LOCAL_MACHINE = 0x00020000 + CERT_SYSTEM_STORE_CURRENT_SERVICE = 0x00040000 + CERT_SYSTEM_STORE_SERVICES = 0x00050000 + CERT_SYSTEM_STORE_USERS = 0x00060000 + CERT_SYSTEM_STORE_CURRENT_USER_GROUP_POLICY = 0x00070000 + CERT_SYSTEM_STORE_LOCAL_MACHINE_GROUP_POLICY = 0x00080000 + CERT_SYSTEM_STORE_LOCAL_MACHINE_ENTERPRISE = 0x00090000 + CERT_SYSTEM_STORE_UNPROTECTED_FLAG = 0x40000000 + CERT_SYSTEM_STORE_RELOCATE_FLAG = 0x80000000 + + /* Miscellaneous high-WORD flags for CertOpenStore function */ + CERT_REGISTRY_STORE_REMOTE_FLAG = 0x00010000 + CERT_REGISTRY_STORE_SERIALIZED_FLAG = 0x00020000 + CERT_REGISTRY_STORE_ROAMING_FLAG = 0x00040000 + CERT_REGISTRY_STORE_MY_IE_DIRTY_FLAG = 0x00080000 + CERT_REGISTRY_STORE_LM_GPT_FLAG = 0x01000000 + CERT_REGISTRY_STORE_CLIENT_GPT_FLAG = 0x80000000 + CERT_FILE_STORE_COMMIT_ENABLE_FLAG = 0x00010000 + CERT_LDAP_STORE_SIGN_FLAG = 0x00010000 + CERT_LDAP_STORE_AREC_EXCLUSIVE_FLAG = 0x00020000 + CERT_LDAP_STORE_OPENED_FLAG = 0x00040000 + CERT_LDAP_STORE_UNBIND_FLAG = 0x00080000 + + /* addDisposition values for CertAddCertificateContextToStore function */ + CERT_STORE_ADD_NEW = 1 + CERT_STORE_ADD_USE_EXISTING = 2 + CERT_STORE_ADD_REPLACE_EXISTING = 3 + CERT_STORE_ADD_ALWAYS = 4 + CERT_STORE_ADD_REPLACE_EXISTING_INHERIT_PROPERTIES = 5 + CERT_STORE_ADD_NEWER = 6 + CERT_STORE_ADD_NEWER_INHERIT_PROPERTIES = 7 + + /* ErrorStatus values for CertTrustStatus struct */ CERT_TRUST_NO_ERROR = 0x00000000 CERT_TRUST_IS_NOT_TIME_VALID = 0x00000001 CERT_TRUST_IS_REVOKED = 0x00000004 @@ -271,11 +377,31 @@ const ( CERT_TRUST_HAS_NOT_DEFINED_NAME_CONSTRAINT = 0x00002000 CERT_TRUST_HAS_NOT_PERMITTED_NAME_CONSTRAINT = 0x00004000 CERT_TRUST_HAS_EXCLUDED_NAME_CONSTRAINT = 0x00008000 + CERT_TRUST_IS_PARTIAL_CHAIN = 0x00010000 + CERT_TRUST_CTL_IS_NOT_TIME_VALID = 0x00020000 + CERT_TRUST_CTL_IS_NOT_SIGNATURE_VALID = 0x00040000 + CERT_TRUST_CTL_IS_NOT_VALID_FOR_USAGE = 0x00080000 + CERT_TRUST_HAS_WEAK_SIGNATURE = 0x00100000 CERT_TRUST_IS_OFFLINE_REVOCATION = 0x01000000 CERT_TRUST_NO_ISSUANCE_CHAIN_POLICY = 0x02000000 CERT_TRUST_IS_EXPLICIT_DISTRUST = 0x04000000 CERT_TRUST_HAS_NOT_SUPPORTED_CRITICAL_EXT = 0x08000000 + /* InfoStatus values for CertTrustStatus struct */ + CERT_TRUST_HAS_EXACT_MATCH_ISSUER = 0x00000001 + CERT_TRUST_HAS_KEY_MATCH_ISSUER = 0x00000002 + CERT_TRUST_HAS_NAME_MATCH_ISSUER = 0x00000004 + CERT_TRUST_IS_SELF_SIGNED = 0x00000008 + CERT_TRUST_HAS_PREFERRED_ISSUER = 0x00000100 + CERT_TRUST_HAS_ISSUANCE_CHAIN_POLICY = 0x00000400 + CERT_TRUST_HAS_VALID_NAME_CONSTRAINTS = 0x00000400 + CERT_TRUST_IS_PEER_TRUSTED = 0x00000800 + CERT_TRUST_HAS_CRL_VALIDITY_EXTENDED = 0x00001000 + CERT_TRUST_IS_FROM_EXCLUSIVE_TRUST_STORE = 0x00002000 + CERT_TRUST_IS_CA_TRUSTED = 0x00004000 + CERT_TRUST_IS_COMPLEX_CHAIN = 0x00010000 + + /* policyOID values for CertVerifyCertificateChainPolicy function */ CERT_CHAIN_POLICY_BASE = 1 CERT_CHAIN_POLICY_AUTHENTICODE = 2 CERT_CHAIN_POLICY_AUTHENTICODE_TS = 3 @@ -284,6 +410,7 @@ const ( CERT_CHAIN_POLICY_NT_AUTH = 6 CERT_CHAIN_POLICY_MICROSOFT_ROOT = 7 CERT_CHAIN_POLICY_EV = 8 + CERT_CHAIN_POLICY_SSL_F12 = 9 CERT_E_EXPIRED = 0x800B0101 CERT_E_ROLE = 0x800B0103 @@ -291,8 +418,16 @@ const ( CERT_E_UNTRUSTEDROOT = 0x800B0109 CERT_E_CN_NO_MATCH = 0x800B010F + /* AuthType values for SSLExtraCertChainPolicyPara struct */ AUTHTYPE_CLIENT = 1 AUTHTYPE_SERVER = 2 + + /* Checks values for SSLExtraCertChainPolicyPara struct */ + SECURITY_FLAG_IGNORE_REVOCATION = 0x00000080 + SECURITY_FLAG_IGNORE_UNKNOWN_CA = 0x00000100 + SECURITY_FLAG_IGNORE_WRONG_USAGE = 0x00000200 + SECURITY_FLAG_IGNORE_CERT_CN_INVALID = 0x00001000 + SECURITY_FLAG_IGNORE_CERT_DATE_INVALID = 0x00002000 ) var ( @@ -301,6 +436,14 @@ var ( OID_SGC_NETSCAPE = []byte("2.16.840.1.113730.4.1\x00") ) +// Pointer represents a pointer to an arbitrary Windows type. +// +// Pointer-typed fields may point to one of many different types. It's +// up to the caller to provide a pointer to the appropriate type, cast +// to Pointer. The caller must obey the unsafe.Pointer rules while +// doing so. +type Pointer *struct{} + // Invented values to support what package os expects. type Timeval struct { Sec int32 @@ -574,6 +717,16 @@ const ( IPV6_JOIN_GROUP = 0xc IPV6_LEAVE_GROUP = 0xd + MSG_OOB = 0x1 + MSG_PEEK = 0x2 + MSG_DONTROUTE = 0x4 + MSG_WAITALL = 0x8 + + MSG_TRUNC = 0x0100 + MSG_CTRUNC = 0x0200 + MSG_BCAST = 0x0400 + MSG_MCAST = 0x0800 + SOMAXCONN = 0x7fffffff TCP_NODELAY = 1 @@ -591,6 +744,15 @@ type WSABuf struct { Buf *byte } +type WSAMsg struct { + Name *syscall.RawSockaddrAny + Namelen int32 + Buffers *WSABuf + BufferCount uint32 + Control WSABuf + Flags uint32 +} + // Invented values to support what package os expects. const ( S_IFMT = 0x1f000 @@ -850,11 +1012,15 @@ type MibIfRow struct { Descr [MAXLEN_IFDESCR]byte } +type CertInfo struct { + // Not implemented +} + type CertContext struct { EncodingType uint32 EncodedCert *byte Length uint32 - CertInfo uintptr + CertInfo *CertInfo Store Handle } @@ -869,12 +1035,16 @@ type CertChainContext struct { RevocationFreshnessTime uint32 } +type CertTrustListInfo struct { + // Not implemented +} + type CertSimpleChain struct { Size uint32 TrustStatus CertTrustStatus NumElements uint32 Elements **CertChainElement - TrustListInfo uintptr + TrustListInfo *CertTrustListInfo HasRevocationFreshnessTime uint32 RevocationFreshnessTime uint32 } @@ -889,14 +1059,18 @@ type CertChainElement struct { ExtendedErrorInfo *uint16 } +type CertRevocationCrlInfo struct { + // Not implemented +} + type CertRevocationInfo struct { Size uint32 RevocationResult uint32 RevocationOid *byte - OidSpecificInfo uintptr + OidSpecificInfo Pointer HasFreshnessTime uint32 FreshnessTime uint32 - CrlInfo uintptr // *CertRevocationCrlInfo + CrlInfo *CertRevocationCrlInfo } type CertTrustStatus struct { @@ -927,7 +1101,7 @@ type CertChainPara struct { type CertChainPolicyPara struct { Size uint32 Flags uint32 - ExtraPolicyPara uintptr + ExtraPolicyPara Pointer } type SSLExtraCertChainPolicyPara struct { @@ -942,7 +1116,7 @@ type CertChainPolicyStatus struct { Error uint32 ChainIndex uint32 ElementIndex uint32 - ExtraPolicyStatus uintptr + ExtraPolicyStatus Pointer } const ( @@ -1018,6 +1192,20 @@ var WSAID_CONNECTEX = GUID{ [8]byte{0x8e, 0xe9, 0x76, 0xe5, 0x8c, 0x74, 0x06, 0x3e}, } +var WSAID_WSASENDMSG = GUID{ + 0xa441e712, + 0x754f, + 0x43ca, + [8]byte{0x84, 0xa7, 0x0d, 0xee, 0x44, 0xcf, 0x60, 0x6d}, +} + +var WSAID_WSARECVMSG = GUID{ + 0xf689d7c8, + 0x6f1f, + 0x436b, + [8]byte{0x8a, 0x53, 0xe5, 0x4f, 0xe3, 0x51, 0xc3, 0x22}, +} + const ( FILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1 FILE_SKIP_SET_EVENT_ON_HANDLE = 2 @@ -1240,3 +1428,52 @@ const ( IfOperStatusNotPresent = 6 IfOperStatusLowerLayerDown = 7 ) + +// Console related constants used for the mode parameter to SetConsoleMode. See +// https://docs.microsoft.com/en-us/windows/console/setconsolemode for details. + +const ( + ENABLE_PROCESSED_INPUT = 0x1 + ENABLE_LINE_INPUT = 0x2 + ENABLE_ECHO_INPUT = 0x4 + ENABLE_WINDOW_INPUT = 0x8 + ENABLE_MOUSE_INPUT = 0x10 + ENABLE_INSERT_MODE = 0x20 + ENABLE_QUICK_EDIT_MODE = 0x40 + ENABLE_EXTENDED_FLAGS = 0x80 + ENABLE_AUTO_POSITION = 0x100 + ENABLE_VIRTUAL_TERMINAL_INPUT = 0x200 + + ENABLE_PROCESSED_OUTPUT = 0x1 + ENABLE_WRAP_AT_EOL_OUTPUT = 0x2 + ENABLE_VIRTUAL_TERMINAL_PROCESSING = 0x4 + DISABLE_NEWLINE_AUTO_RETURN = 0x8 + ENABLE_LVB_GRID_WORLDWIDE = 0x10 +) + +type Coord struct { + X int16 + Y int16 +} + +type SmallRect struct { + Left int16 + Top int16 + Right int16 + Bottom int16 +} + +// Used with GetConsoleScreenBuffer to retrieve information about a console +// screen buffer. See +// https://docs.microsoft.com/en-us/windows/console/console-screen-buffer-info-str +// for details. + +type ConsoleScreenBufferInfo struct { + Size Coord + CursorPosition Coord + Attributes uint16 + Window SmallRect + MaximumWindowSize Coord +} + +const UNIX_PATH_MAX = 108 // defined in afunix.h diff --git a/vendor/golang.org/x/sys/windows/ztypes_windows_386.go b/vendor/golang.org/x/sys/windows/types_windows_386.go similarity index 88% rename from vendor/golang.org/x/sys/windows/ztypes_windows_386.go rename to vendor/golang.org/x/sys/windows/types_windows_386.go index 10f33be0..fe0ddd03 100644 --- a/vendor/golang.org/x/sys/windows/ztypes_windows_386.go +++ b/vendor/golang.org/x/sys/windows/types_windows_386.go @@ -1,4 +1,4 @@ -// Copyright 2011 The Go Authors. All rights reserved. +// Copyright 2011 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/ztypes_windows_amd64.go b/vendor/golang.org/x/sys/windows/types_windows_amd64.go similarity index 88% rename from vendor/golang.org/x/sys/windows/ztypes_windows_amd64.go rename to vendor/golang.org/x/sys/windows/types_windows_amd64.go index 3f272c24..7e154c2d 100644 --- a/vendor/golang.org/x/sys/windows/ztypes_windows_amd64.go +++ b/vendor/golang.org/x/sys/windows/types_windows_amd64.go @@ -1,4 +1,4 @@ -// Copyright 2011 The Go Authors. All rights reserved. +// Copyright 2011 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/sys/windows/types_windows_arm.go b/vendor/golang.org/x/sys/windows/types_windows_arm.go new file mode 100644 index 00000000..74571e36 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/types_windows_arm.go @@ -0,0 +1,22 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package windows + +type WSAData struct { + Version uint16 + HighVersion uint16 + Description [WSADESCRIPTION_LEN + 1]byte + SystemStatus [WSASYS_STATUS_LEN + 1]byte + MaxSockets uint16 + MaxUdpDg uint16 + VendorInfo *byte +} + +type Servent struct { + Name *byte + Aliases **byte + Port uint16 + Proto *byte +} diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index b9ee8278..eb9f0629 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -1,4 +1,4 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT +// Code generated by 'go generate'; DO NOT EDIT. package windows @@ -65,6 +65,7 @@ var ( procChangeServiceConfig2W = modadvapi32.NewProc("ChangeServiceConfig2W") procQueryServiceConfig2W = modadvapi32.NewProc("QueryServiceConfig2W") procEnumServicesStatusExW = modadvapi32.NewProc("EnumServicesStatusExW") + procQueryServiceStatusEx = modadvapi32.NewProc("QueryServiceStatusEx") procGetLastError = modkernel32.NewProc("GetLastError") procLoadLibraryW = modkernel32.NewProc("LoadLibraryW") procLoadLibraryExW = modkernel32.NewProc("LoadLibraryExW") @@ -76,6 +77,7 @@ var ( procCreateFileW = modkernel32.NewProc("CreateFileW") procReadFile = modkernel32.NewProc("ReadFile") procWriteFile = modkernel32.NewProc("WriteFile") + procGetOverlappedResult = modkernel32.NewProc("GetOverlappedResult") procSetFilePointer = modkernel32.NewProc("SetFilePointer") procCloseHandle = modkernel32.NewProc("CloseHandle") procGetStdHandle = modkernel32.NewProc("GetStdHandle") @@ -111,6 +113,7 @@ var ( procGetProcessTimes = modkernel32.NewProc("GetProcessTimes") procDuplicateHandle = modkernel32.NewProc("DuplicateHandle") procWaitForSingleObject = modkernel32.NewProc("WaitForSingleObject") + procWaitForMultipleObjects = modkernel32.NewProc("WaitForMultipleObjects") procGetTempPathW = modkernel32.NewProc("GetTempPathW") procCreatePipe = modkernel32.NewProc("CreatePipe") procGetFileType = modkernel32.NewProc("GetFileType") @@ -139,6 +142,9 @@ var ( procFlushViewOfFile = modkernel32.NewProc("FlushViewOfFile") procVirtualLock = modkernel32.NewProc("VirtualLock") procVirtualUnlock = modkernel32.NewProc("VirtualUnlock") + procVirtualAlloc = modkernel32.NewProc("VirtualAlloc") + procVirtualFree = modkernel32.NewProc("VirtualFree") + procVirtualProtect = modkernel32.NewProc("VirtualProtect") procTransmitFile = modmswsock.NewProc("TransmitFile") procReadDirectoryChangesW = modkernel32.NewProc("ReadDirectoryChangesW") procCertOpenSystemStoreW = modcrypt32.NewProc("CertOpenSystemStoreW") @@ -158,6 +164,8 @@ var ( procRegQueryValueExW = modadvapi32.NewProc("RegQueryValueExW") procGetCurrentProcessId = modkernel32.NewProc("GetCurrentProcessId") procGetConsoleMode = modkernel32.NewProc("GetConsoleMode") + procSetConsoleMode = modkernel32.NewProc("SetConsoleMode") + procGetConsoleScreenBufferInfo = modkernel32.NewProc("GetConsoleScreenBufferInfo") procWriteConsoleW = modkernel32.NewProc("WriteConsoleW") procReadConsoleW = modkernel32.NewProc("ReadConsoleW") procCreateToolhelp32Snapshot = modkernel32.NewProc("CreateToolhelp32Snapshot") @@ -168,7 +176,30 @@ var ( procCreateHardLinkW = modkernel32.NewProc("CreateHardLinkW") procGetCurrentThreadId = modkernel32.NewProc("GetCurrentThreadId") procCreateEventW = modkernel32.NewProc("CreateEventW") + procCreateEventExW = modkernel32.NewProc("CreateEventExW") + procOpenEventW = modkernel32.NewProc("OpenEventW") procSetEvent = modkernel32.NewProc("SetEvent") + procResetEvent = modkernel32.NewProc("ResetEvent") + procPulseEvent = modkernel32.NewProc("PulseEvent") + procDefineDosDeviceW = modkernel32.NewProc("DefineDosDeviceW") + procDeleteVolumeMountPointW = modkernel32.NewProc("DeleteVolumeMountPointW") + procFindFirstVolumeW = modkernel32.NewProc("FindFirstVolumeW") + procFindFirstVolumeMountPointW = modkernel32.NewProc("FindFirstVolumeMountPointW") + procFindNextVolumeW = modkernel32.NewProc("FindNextVolumeW") + procFindNextVolumeMountPointW = modkernel32.NewProc("FindNextVolumeMountPointW") + procFindVolumeClose = modkernel32.NewProc("FindVolumeClose") + procFindVolumeMountPointClose = modkernel32.NewProc("FindVolumeMountPointClose") + procGetDriveTypeW = modkernel32.NewProc("GetDriveTypeW") + procGetLogicalDrives = modkernel32.NewProc("GetLogicalDrives") + procGetLogicalDriveStringsW = modkernel32.NewProc("GetLogicalDriveStringsW") + procGetVolumeInformationW = modkernel32.NewProc("GetVolumeInformationW") + procGetVolumeInformationByHandleW = modkernel32.NewProc("GetVolumeInformationByHandleW") + procGetVolumeNameForVolumeMountPointW = modkernel32.NewProc("GetVolumeNameForVolumeMountPointW") + procGetVolumePathNameW = modkernel32.NewProc("GetVolumePathNameW") + procGetVolumePathNamesForVolumeNameW = modkernel32.NewProc("GetVolumePathNamesForVolumeNameW") + procQueryDosDeviceW = modkernel32.NewProc("QueryDosDeviceW") + procSetVolumeLabelW = modkernel32.NewProc("SetVolumeLabelW") + procSetVolumeMountPointW = modkernel32.NewProc("SetVolumeMountPointW") procWSAStartup = modws2_32.NewProc("WSAStartup") procWSACleanup = modws2_32.NewProc("WSACleanup") procWSAIoctl = modws2_32.NewProc("WSAIoctl") @@ -216,11 +247,14 @@ var ( procGetLengthSid = modadvapi32.NewProc("GetLengthSid") procCopySid = modadvapi32.NewProc("CopySid") procAllocateAndInitializeSid = modadvapi32.NewProc("AllocateAndInitializeSid") + procCreateWellKnownSid = modadvapi32.NewProc("CreateWellKnownSid") procFreeSid = modadvapi32.NewProc("FreeSid") procEqualSid = modadvapi32.NewProc("EqualSid") + procCheckTokenMembership = modadvapi32.NewProc("CheckTokenMembership") procOpenProcessToken = modadvapi32.NewProc("OpenProcessToken") procGetTokenInformation = modadvapi32.NewProc("GetTokenInformation") procGetUserProfileDirectoryW = moduserenv.NewProc("GetUserProfileDirectoryW") + procGetSystemDirectoryW = modkernel32.NewProc("GetSystemDirectoryW") ) func RegisterEventSource(uncServerName *uint16, sourceName *uint16) (handle Handle, err error) { @@ -443,6 +477,18 @@ func EnumServicesStatusEx(mgr Handle, infoLevel uint32, serviceType uint32, serv return } +func QueryServiceStatusEx(service Handle, infoLevel uint32, buff *byte, buffSize uint32, bytesNeeded *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryServiceStatusEx.Addr(), 5, uintptr(service), uintptr(infoLevel), uintptr(unsafe.Pointer(buff)), uintptr(buffSize), uintptr(unsafe.Pointer(bytesNeeded)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func GetLastError() (lasterr error) { r0, _, _ := syscall.Syscall(procGetLastError.Addr(), 0, 0, 0, 0) if r0 != 0 { @@ -609,6 +655,24 @@ func WriteFile(handle Handle, buf []byte, done *uint32, overlapped *Overlapped) return } +func GetOverlappedResult(handle Handle, overlapped *Overlapped, done *uint32, wait bool) (err error) { + var _p0 uint32 + if wait { + _p0 = 1 + } else { + _p0 = 0 + } + r1, _, e1 := syscall.Syscall6(procGetOverlappedResult.Addr(), 4, uintptr(handle), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(done)), uintptr(_p0), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func SetFilePointer(handle Handle, lowoffset int32, highoffsetptr *int32, whence uint32) (newlowoffset uint32, err error) { r0, _, e1 := syscall.Syscall6(procSetFilePointer.Addr(), 4, uintptr(handle), uintptr(lowoffset), uintptr(unsafe.Pointer(highoffsetptr)), uintptr(whence), 0, 0) newlowoffset = uint32(r0) @@ -1042,6 +1106,25 @@ func WaitForSingleObject(handle Handle, waitMilliseconds uint32) (event uint32, return } +func waitForMultipleObjects(count uint32, handles uintptr, waitAll bool, waitMilliseconds uint32) (event uint32, err error) { + var _p0 uint32 + if waitAll { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall6(procWaitForMultipleObjects.Addr(), 4, uintptr(count), uintptr(handles), uintptr(_p0), uintptr(waitMilliseconds), 0, 0) + event = uint32(r0) + if event == 0xffffffff { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func GetTempPath(buflen uint32, buf *uint16) (n uint32, err error) { r0, _, e1 := syscall.Syscall(procGetTempPathW.Addr(), 2, uintptr(buflen), uintptr(unsafe.Pointer(buf)), 0) n = uint32(r0) @@ -1384,6 +1467,43 @@ func VirtualUnlock(addr uintptr, length uintptr) (err error) { return } +func VirtualAlloc(address uintptr, size uintptr, alloctype uint32, protect uint32) (value uintptr, err error) { + r0, _, e1 := syscall.Syscall6(procVirtualAlloc.Addr(), 4, uintptr(address), uintptr(size), uintptr(alloctype), uintptr(protect), 0, 0) + value = uintptr(r0) + if value == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func VirtualFree(address uintptr, size uintptr, freetype uint32) (err error) { + r1, _, e1 := syscall.Syscall(procVirtualFree.Addr(), 3, uintptr(address), uintptr(size), uintptr(freetype)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func VirtualProtect(address uintptr, size uintptr, newprotect uint32, oldprotect *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procVirtualProtect.Addr(), 4, uintptr(address), uintptr(size), uintptr(newprotect), uintptr(unsafe.Pointer(oldprotect)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func TransmitFile(s Handle, handle Handle, bytesToWrite uint32, bytsPerSend uint32, overlapped *Overlapped, transmitFileBuf *TransmitFileBuffers, flags uint32) (err error) { r1, _, e1 := syscall.Syscall9(procTransmitFile.Addr(), 7, uintptr(s), uintptr(handle), uintptr(bytesToWrite), uintptr(bytsPerSend), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(transmitFileBuf)), uintptr(flags), 0, 0) if r1 == 0 { @@ -1589,6 +1709,30 @@ func GetConsoleMode(console Handle, mode *uint32) (err error) { return } +func SetConsoleMode(console Handle, mode uint32) (err error) { + r1, _, e1 := syscall.Syscall(procSetConsoleMode.Addr(), 2, uintptr(console), uintptr(mode), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetConsoleScreenBufferInfo(console Handle, info *ConsoleScreenBufferInfo) (err error) { + r1, _, e1 := syscall.Syscall(procGetConsoleScreenBufferInfo.Addr(), 2, uintptr(console), uintptr(unsafe.Pointer(info)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func WriteConsole(console Handle, buf *uint16, towrite uint32, written *uint32, reserved *byte) (err error) { r1, _, e1 := syscall.Syscall6(procWriteConsoleW.Addr(), 5, uintptr(console), uintptr(unsafe.Pointer(buf)), uintptr(towrite), uintptr(unsafe.Pointer(written)), uintptr(unsafe.Pointer(reserved)), 0) if r1 == 0 { @@ -1692,7 +1836,7 @@ func GetCurrentThreadId() (id uint32) { return } -func CreateEvent(eventAttrs *syscall.SecurityAttributes, manualReset uint32, initialState uint32, name *uint16) (handle Handle, err error) { +func CreateEvent(eventAttrs *SecurityAttributes, manualReset uint32, initialState uint32, name *uint16) (handle Handle, err error) { r0, _, e1 := syscall.Syscall6(procCreateEventW.Addr(), 4, uintptr(unsafe.Pointer(eventAttrs)), uintptr(manualReset), uintptr(initialState), uintptr(unsafe.Pointer(name)), 0, 0) handle = Handle(r0) if handle == 0 { @@ -1705,6 +1849,38 @@ func CreateEvent(eventAttrs *syscall.SecurityAttributes, manualReset uint32, ini return } +func CreateEventEx(eventAttrs *SecurityAttributes, name *uint16, flags uint32, desiredAccess uint32) (handle Handle, err error) { + r0, _, e1 := syscall.Syscall6(procCreateEventExW.Addr(), 4, uintptr(unsafe.Pointer(eventAttrs)), uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(desiredAccess), 0, 0) + handle = Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func OpenEvent(desiredAccess uint32, inheritHandle bool, name *uint16) (handle Handle, err error) { + var _p0 uint32 + if inheritHandle { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall(procOpenEventW.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(unsafe.Pointer(name))) + handle = Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func SetEvent(event Handle) (err error) { r1, _, e1 := syscall.Syscall(procSetEvent.Addr(), 1, uintptr(event), 0, 0) if r1 == 0 { @@ -1717,6 +1893,257 @@ func SetEvent(event Handle) (err error) { return } +func ResetEvent(event Handle) (err error) { + r1, _, e1 := syscall.Syscall(procResetEvent.Addr(), 1, uintptr(event), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func PulseEvent(event Handle) (err error) { + r1, _, e1 := syscall.Syscall(procPulseEvent.Addr(), 1, uintptr(event), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func DefineDosDevice(flags uint32, deviceName *uint16, targetPath *uint16) (err error) { + r1, _, e1 := syscall.Syscall(procDefineDosDeviceW.Addr(), 3, uintptr(flags), uintptr(unsafe.Pointer(deviceName)), uintptr(unsafe.Pointer(targetPath))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func DeleteVolumeMountPoint(volumeMountPoint *uint16) (err error) { + r1, _, e1 := syscall.Syscall(procDeleteVolumeMountPointW.Addr(), 1, uintptr(unsafe.Pointer(volumeMountPoint)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func FindFirstVolume(volumeName *uint16, bufferLength uint32) (handle Handle, err error) { + r0, _, e1 := syscall.Syscall(procFindFirstVolumeW.Addr(), 2, uintptr(unsafe.Pointer(volumeName)), uintptr(bufferLength), 0) + handle = Handle(r0) + if handle == InvalidHandle { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func FindFirstVolumeMountPoint(rootPathName *uint16, volumeMountPoint *uint16, bufferLength uint32) (handle Handle, err error) { + r0, _, e1 := syscall.Syscall(procFindFirstVolumeMountPointW.Addr(), 3, uintptr(unsafe.Pointer(rootPathName)), uintptr(unsafe.Pointer(volumeMountPoint)), uintptr(bufferLength)) + handle = Handle(r0) + if handle == InvalidHandle { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func FindNextVolume(findVolume Handle, volumeName *uint16, bufferLength uint32) (err error) { + r1, _, e1 := syscall.Syscall(procFindNextVolumeW.Addr(), 3, uintptr(findVolume), uintptr(unsafe.Pointer(volumeName)), uintptr(bufferLength)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func FindNextVolumeMountPoint(findVolumeMountPoint Handle, volumeMountPoint *uint16, bufferLength uint32) (err error) { + r1, _, e1 := syscall.Syscall(procFindNextVolumeMountPointW.Addr(), 3, uintptr(findVolumeMountPoint), uintptr(unsafe.Pointer(volumeMountPoint)), uintptr(bufferLength)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func FindVolumeClose(findVolume Handle) (err error) { + r1, _, e1 := syscall.Syscall(procFindVolumeClose.Addr(), 1, uintptr(findVolume), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func FindVolumeMountPointClose(findVolumeMountPoint Handle) (err error) { + r1, _, e1 := syscall.Syscall(procFindVolumeMountPointClose.Addr(), 1, uintptr(findVolumeMountPoint), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetDriveType(rootPathName *uint16) (driveType uint32) { + r0, _, _ := syscall.Syscall(procGetDriveTypeW.Addr(), 1, uintptr(unsafe.Pointer(rootPathName)), 0, 0) + driveType = uint32(r0) + return +} + +func GetLogicalDrives() (drivesBitMask uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetLogicalDrives.Addr(), 0, 0, 0, 0) + drivesBitMask = uint32(r0) + if drivesBitMask == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetLogicalDriveStrings(bufferLength uint32, buffer *uint16) (n uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetLogicalDriveStringsW.Addr(), 2, uintptr(bufferLength), uintptr(unsafe.Pointer(buffer)), 0) + n = uint32(r0) + if n == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetVolumeInformation(rootPathName *uint16, volumeNameBuffer *uint16, volumeNameSize uint32, volumeNameSerialNumber *uint32, maximumComponentLength *uint32, fileSystemFlags *uint32, fileSystemNameBuffer *uint16, fileSystemNameSize uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procGetVolumeInformationW.Addr(), 8, uintptr(unsafe.Pointer(rootPathName)), uintptr(unsafe.Pointer(volumeNameBuffer)), uintptr(volumeNameSize), uintptr(unsafe.Pointer(volumeNameSerialNumber)), uintptr(unsafe.Pointer(maximumComponentLength)), uintptr(unsafe.Pointer(fileSystemFlags)), uintptr(unsafe.Pointer(fileSystemNameBuffer)), uintptr(fileSystemNameSize), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetVolumeInformationByHandle(file Handle, volumeNameBuffer *uint16, volumeNameSize uint32, volumeNameSerialNumber *uint32, maximumComponentLength *uint32, fileSystemFlags *uint32, fileSystemNameBuffer *uint16, fileSystemNameSize uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procGetVolumeInformationByHandleW.Addr(), 8, uintptr(file), uintptr(unsafe.Pointer(volumeNameBuffer)), uintptr(volumeNameSize), uintptr(unsafe.Pointer(volumeNameSerialNumber)), uintptr(unsafe.Pointer(maximumComponentLength)), uintptr(unsafe.Pointer(fileSystemFlags)), uintptr(unsafe.Pointer(fileSystemNameBuffer)), uintptr(fileSystemNameSize), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetVolumeNameForVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16, bufferlength uint32) (err error) { + r1, _, e1 := syscall.Syscall(procGetVolumeNameForVolumeMountPointW.Addr(), 3, uintptr(unsafe.Pointer(volumeMountPoint)), uintptr(unsafe.Pointer(volumeName)), uintptr(bufferlength)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetVolumePathName(fileName *uint16, volumePathName *uint16, bufferLength uint32) (err error) { + r1, _, e1 := syscall.Syscall(procGetVolumePathNameW.Addr(), 3, uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(volumePathName)), uintptr(bufferLength)) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func GetVolumePathNamesForVolumeName(volumeName *uint16, volumePathNames *uint16, bufferLength uint32, returnLength *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procGetVolumePathNamesForVolumeNameW.Addr(), 4, uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(volumePathNames)), uintptr(bufferLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func QueryDosDevice(deviceName *uint16, targetPath *uint16, max uint32) (n uint32, err error) { + r0, _, e1 := syscall.Syscall(procQueryDosDeviceW.Addr(), 3, uintptr(unsafe.Pointer(deviceName)), uintptr(unsafe.Pointer(targetPath)), uintptr(max)) + n = uint32(r0) + if n == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetVolumeLabel(rootPathName *uint16, volumeName *uint16) (err error) { + r1, _, e1 := syscall.Syscall(procSetVolumeLabelW.Addr(), 2, uintptr(unsafe.Pointer(rootPathName)), uintptr(unsafe.Pointer(volumeName)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func SetVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16) (err error) { + r1, _, e1 := syscall.Syscall(procSetVolumeMountPointW.Addr(), 2, uintptr(unsafe.Pointer(volumeMountPoint)), uintptr(unsafe.Pointer(volumeName)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func WSAStartup(verreq uint32, data *WSAData) (sockerr error) { r0, _, _ := syscall.Syscall(procWSAStartup.Addr(), 2, uintptr(verreq), uintptr(unsafe.Pointer(data)), 0) if r0 != 0 { @@ -2247,6 +2674,18 @@ func AllocateAndInitializeSid(identAuth *SidIdentifierAuthority, subAuth byte, s return } +func createWellKnownSid(sidType WELL_KNOWN_SID_TYPE, domainSid *SID, sid *SID, sizeSid *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procCreateWellKnownSid.Addr(), 4, uintptr(sidType), uintptr(unsafe.Pointer(domainSid)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sizeSid)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func FreeSid(sid *SID) (err error) { r1, _, e1 := syscall.Syscall(procFreeSid.Addr(), 1, uintptr(unsafe.Pointer(sid)), 0, 0) if r1 != 0 { @@ -2265,6 +2704,18 @@ func EqualSid(sid1 *SID, sid2 *SID) (isEqual bool) { return } +func checkTokenMembership(tokenHandle Token, sidToCheck *SID, isMember *int32) (err error) { + r1, _, e1 := syscall.Syscall(procCheckTokenMembership.Addr(), 3, uintptr(tokenHandle), uintptr(unsafe.Pointer(sidToCheck)), uintptr(unsafe.Pointer(isMember))) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func OpenProcessToken(h Handle, access uint32, token *Token) (err error) { r1, _, e1 := syscall.Syscall(procOpenProcessToken.Addr(), 3, uintptr(h), uintptr(access), uintptr(unsafe.Pointer(token))) if r1 == 0 { @@ -2300,3 +2751,16 @@ func GetUserProfileDirectory(t Token, dir *uint16, dirLen *uint32) (err error) { } return } + +func getSystemDirectory(dir *uint16, dirLen uint32) (len uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetSystemDirectoryW.Addr(), 2, uintptr(unsafe.Pointer(dir)), uintptr(dirLen), 0) + len = uint32(r0) + if len == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/manifest b/vendor/manifest deleted file mode 100644 index 46781ee1..00000000 --- a/vendor/manifest +++ /dev/null @@ -1,65 +0,0 @@ -{ - "version": 0, - "dependencies": [ - { - "importpath": "github.com/nats-io/jwt", - "repository": "https://github.com/nats-io/jwt", - "vcs": "git", - "revision": "a7fd8925349a3183ec07e1683d4e34eb5ad0e453", - "branch": "master", - "notests": true - }, - { - "importpath": "github.com/nats-io/nkeys", - "repository": "https://github.com/nats-io/nkeys", - "vcs": "git", - "revision": "1546a3320a8f195a5b5c84aef8309377c2e411d5", - "branch": "master", - "notests": true - }, - { - "importpath": "github.com/nats-io/nuid", - "repository": "https://github.com/nats-io/nuid", - "vcs": "git", - "revision": "3024a71c3cbe30667286099921591e6fcc328230", - "branch": "master", - "notests": true - }, - { - "importpath": "golang.org/x/crypto/bcrypt", - "repository": "https://go.googlesource.com/crypto", - "vcs": "git", - "revision": "3d3f9f413869b949e48070b5bc593aa22cc2b8f2", - "branch": "master", - "path": "/bcrypt", - "notests": true - }, - { - "importpath": "golang.org/x/crypto/blowfish", - "repository": "https://go.googlesource.com/crypto", - "vcs": "git", - "revision": "3d3f9f413869b949e48070b5bc593aa22cc2b8f2", - "branch": "master", - "path": "/blowfish", - "notests": true - }, - { - "importpath": "golang.org/x/crypto/ed25519", - "repository": "https://go.googlesource.com/crypto", - "vcs": "git", - "revision": "3d3f9f413869b949e48070b5bc593aa22cc2b8f2", - "branch": "master", - "path": "/ed25519", - "notests": true - }, - { - "importpath": "golang.org/x/sys/windows", - "repository": "https://go.googlesource.com/sys", - "vcs": "git", - "revision": "f7928cfef4d09d1b080aa2b6fd3ca9ba1567c733", - "branch": "master", - "path": "windows", - "notests": true - } - ] -} \ No newline at end of file diff --git a/vendor/modules.txt b/vendor/modules.txt new file mode 100644 index 00000000..71753c5f --- /dev/null +++ b/vendor/modules.txt @@ -0,0 +1,22 @@ +# github.com/nats-io/go-nats v1.7.2 +github.com/nats-io/go-nats +github.com/nats-io/go-nats/encoders/builtin +github.com/nats-io/go-nats/util +# github.com/nats-io/jwt v0.1.0 +github.com/nats-io/jwt +# github.com/nats-io/nkeys v0.0.2 +github.com/nats-io/nkeys +# github.com/nats-io/nuid v1.0.1 +github.com/nats-io/nuid +# golang.org/x/crypto v0.0.0-20190404164418-38d8ce5564a5 +golang.org/x/crypto/bcrypt +golang.org/x/crypto/ed25519 +golang.org/x/crypto/blowfish +golang.org/x/crypto/ed25519/internal/edwards25519 +# golang.org/x/sys v0.0.0-20190405154228-4b34438f7a67 +golang.org/x/sys/windows/svc/eventlog +golang.org/x/sys/windows/svc +golang.org/x/sys/windows/svc/debug +golang.org/x/sys/windows/svc/mgr +golang.org/x/sys/windows +golang.org/x/sys/windows/registry